first commit

vendor/squizlabs/php_codesniffer/CodeSniffer.conf.dist

@@ -0,0 +1,9 @@
+<?php
+ $phpCodeSnifferConfig = array (
+  'default_standard' => 'PSR2',
+  'report_format' => 'summary',
+  'show_warnings' => '0',
+  'show_progress' => '1',
+  'report_width' => '120',
+);
+?>

vendor/squizlabs/php_codesniffer/README.md

@@ -0,0 +1,153 @@
+# PHP_CodeSniffer
+
+<div aria-hidden="true">
+
+[![Latest Stable Version](https://img.shields.io/github/v/release/PHPCSStandards/PHP_CodeSniffer?label=Stable)](https://github.com/PHPCSStandards/PHP_CodeSniffer/releases)
+[![Validate](https://github.com/PHPCSStandards/PHP_CodeSniffer/actions/workflows/validate.yml/badge.svg?branch=master)](https://github.com/PHPCSStandards/PHP_CodeSniffer/actions/workflows/validate.yml)
+[![Test](https://github.com/PHPCSStandards/PHP_CodeSniffer/actions/workflows/test.yml/badge.svg?branch=master)][GHA-test]
+[![Coverage Status](https://coveralls.io/repos/github/PHPCSStandards/PHP_CodeSniffer/badge.svg?branch=master)](https://coveralls.io/github/PHPCSStandards/PHP_CodeSniffer?branch=master)
+[![License](https://img.shields.io/github/license/PHPCSStandards/PHP_CodeSniffer)](https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt)
+
+![Minimum PHP Version](https://img.shields.io/packagist/dependency-v/squizlabs/php_codesniffer/php.svg)
+[![Tested on PHP 5.4 to 8.4](https://img.shields.io/badge/tested%20on-PHP%205.4%20|%205.5%20|%205.6%20|%207.0%20|%207.1%20|%207.2%20|%207.3%20|%207.4%20|%208.0%20|%208.1%20|%208.2%20|%208.3%20|%208.4-brightgreen.svg?maxAge=2419200)][GHA-test]
+
+[GHA-test]: https://github.com/PHPCSStandards/PHP_CodeSniffer/actions/workflows/test.yml
+
+</div>
+
+> [!NOTE]
+> This package is the official continuation of the now abandoned [PHP_CodeSniffer package which was created by Squizlabs](https://github.com/squizlabs/PHP_CodeSniffer).
+
+## About
+
+PHP_CodeSniffer is a set of two PHP scripts; the main `phpcs` script that tokenizes PHP, JavaScript and CSS files to detect violations of a defined coding standard, and a second `phpcbf` script to automatically correct coding standard violations. PHP_CodeSniffer is an essential development tool that ensures your code remains clean and consistent.
+
+
+## Requirements
+
+PHP_CodeSniffer requires PHP version 5.4.0 or greater, although individual sniffs may have additional requirements such as external applications and scripts. See the [Configuration Options manual page](https://github.com/PHPCSStandards/PHP_CodeSniffer/wiki/Configuration-Options) for a list of these requirements.
+
+If you're using PHP_CodeSniffer as part of a team, or you're running it on a [CI](https://en.wikipedia.org/wiki/Continuous_integration) server, you may want to configure your project's settings [using a configuration file](https://github.com/PHPCSStandards/PHP_CodeSniffer/wiki/Advanced-Usage#using-a-default-configuration-file).
+
+
+## Installation
+
+The easiest way to get started with PHP_CodeSniffer is to download the Phar files for each of the commands:
+```bash
+# Download using curl
+curl -OL https://phars.phpcodesniffer.com/phpcs.phar
+curl -OL https://phars.phpcodesniffer.com/phpcbf.phar
+
+# Or download using wget
+wget https://phars.phpcodesniffer.com/phpcs.phar
+wget https://phars.phpcodesniffer.com/phpcbf.phar
+
+# Then test the downloaded PHARs
+php phpcs.phar -h
+php phpcbf.phar -h
+```
+
+These Phars are signed with the official Release key for PHPCS with the
+fingerprint `D91D 8696 3AF3 A29B 6520 4622 97B0 2DD8 E507 1466`.
+
+As of PHP_CodeSniffer 3.10.3, the provenance of PHAR files associated with a release can be verified via [GitHub Artifact Attestations](https://docs.github.com/en/actions/how-tos/secure-your-work/use-artifact-attestations/use-artifact-attestations) using the [GitHub CLI tool](https://cli.github.com/) with the following command: `gh attestation verify [phpcs|phpcbf].phar -o PHPCSStandards`.
+
+### Composer
+If you use Composer, you can install PHP_CodeSniffer system-wide with the following command:
+```bash
+composer global require "squizlabs/php_codesniffer=*"
+```
+Make sure you have the composer bin dir in your PATH. The default value is `~/.composer/vendor/bin/`, but you can check the value that you need to use by running `composer global config bin-dir --absolute`.
+
+Or alternatively, include a dependency for `squizlabs/php_codesniffer` in your `composer.json` file. For example:
+
+```json
+{
+    "require-dev": {
+        "squizlabs/php_codesniffer": "^3.0"
+    }
+}
+```
+
+You will then be able to run PHP_CodeSniffer from the vendor bin directory:
+```bash
+./vendor/bin/phpcs -h
+./vendor/bin/phpcbf -h
+```
+
+### Phive
+If you use Phive, you can install PHP_CodeSniffer as a project tool using the following commands:
+```bash
+phive install --trust-gpg-keys D91D86963AF3A29B6520462297B02DD8E5071466 phpcs
+phive install --trust-gpg-keys D91D86963AF3A29B6520462297B02DD8E5071466 phpcbf
+```
+You will then be able to run PHP_CodeSniffer from the `tools` directory:
+```bash
+./tools/phpcs -h
+./tools/phpcbf -h
+```
+
+### Git Clone
+You can also download the PHP_CodeSniffer source and run the `phpcs` and `phpcbf` commands directly from the Git clone:
+```bash
+git clone https://github.com/PHPCSStandards/PHP_CodeSniffer.git
+cd PHP_CodeSniffer
+php bin/phpcs -h
+php bin/phpcbf -h
+```
+
+## Getting Started
+
+The default coding standard used by PHP_CodeSniffer is the PEAR coding standard. To check a file against the PEAR coding standard, simply specify the file's location:
+```bash
+phpcs /path/to/code/myfile.php
+```
+Or if you wish to check an entire directory you can specify the directory location instead of a file.
+```bash
+phpcs /path/to/code-directory
+```
+If you wish to check your code against the PSR-12 coding standard, use the `--standard` command line argument:
+```bash
+phpcs --standard=PSR12 /path/to/code-directory
+```
+
+If PHP_CodeSniffer finds any coding standard errors, a report will be shown after running the command.
+
+Full usage information and example reports are available on the [usage page](https://github.com/PHPCSStandards/PHP_CodeSniffer/wiki/Usage).
+
+## Documentation
+
+The documentation for PHP_CodeSniffer is available on the [GitHub wiki](https://github.com/PHPCSStandards/PHP_CodeSniffer/wiki).
+
+## Issues
+
+Bug reports and feature requests can be submitted on the [GitHub Issue Tracker](https://github.com/PHPCSStandards/PHP_CodeSniffer/issues).
+
+## Contributing
+
+See [CONTRIBUTING.md](.github/CONTRIBUTING.md) for information.
+
+## Versioning
+
+PHP_CodeSniffer uses a `MAJOR.MINOR.PATCH` version number format.
+
+The `MAJOR` version is incremented when:
+- backwards-incompatible changes are made to how the `phpcs` or `phpcbf` commands are used, or
+- backwards-incompatible changes are made to the `ruleset.xml` format, or
+- backwards-incompatible changes are made to the API used by sniff developers, or
+- custom PHP_CodeSniffer token types are removed, or
+- existing sniffs are removed from PHP_CodeSniffer entirely
+
+The `MINOR` version is incremented when:
+- new backwards-compatible features are added to the `phpcs` and `phpcbf` commands, or
+- backwards-compatible changes are made to the `ruleset.xml` format, or
+- backwards-compatible changes are made to the API used by sniff developers, or
+- new sniffs are added to an included standard, or
+- existing sniffs are removed from an included standard
+
+> NOTE: Backwards-compatible changes to the API used by sniff developers will allow an existing sniff to continue running without producing fatal errors but may not result in the sniff reporting the same errors as it did previously without changes being required.
+
+The `PATCH` version is incremented when:
+- backwards-compatible bug fixes are made
+
+> NOTE: As PHP_CodeSniffer exists to report and fix issues, most bugs are the result of coding standard errors being incorrectly reported or coding standard errors not being reported when they should be. This means that the messages produced by PHP_CodeSniffer, and the fixes it makes, are likely to be different between PATCH versions.

vendor/squizlabs/php_codesniffer/autoload.php

@@ -0,0 +1,346 @@
+<?php
+/**
+ * Autoloads files for PHP_CodeSniffer and tracks what has been loaded.
+ *
+ * Due to different namespaces being used for custom coding standards,
+ * the autoloader keeps track of what class is loaded after a file is included,
+ * even if the file is ultimately included by another autoloader (such as composer).
+ *
+ * This allows PHP_CodeSniffer to request the class name after loading a class
+ * when it only knows the filename, without having to parse the file to find it.
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer;
+
+use Composer\Autoload\ClassLoader;
+use Exception;
+
+if (class_exists('PHP_CodeSniffer\Autoload', false) === false) {
+    class Autoload
+    {
+
+        /**
+         * The composer autoloader.
+         *
+         * @var \Composer\Autoload\ClassLoader|false|null The autoloader object or FALSE if no Composer autoloader could
+         *                                                be found. NULL when this hasn't been determined yet.
+         */
+        private static $composerAutoloader = null;
+
+        /**
+         * A mapping of file names to class names.
+         *
+         * @var array<string, string>
+         */
+        private static $loadedClasses = [];
+
+        /**
+         * A mapping of class names to file names.
+         *
+         * @var array<string, string>
+         */
+        private static $loadedFiles = [];
+
+        /**
+         * A list of additional directories to search during autoloading.
+         *
+         * This is typically a list of coding standard directories.
+         *
+         * @var string[]
+         */
+        private static $searchPaths = [];
+
+
+        /**
+         * Loads a class.
+         *
+         * This method only loads classes that exist in the PHP_CodeSniffer namespace.
+         * All other classes are ignored and loaded by subsequent autoloaders.
+         *
+         * @param string $class The name of the class to load.
+         *
+         * @return bool
+         */
+        public static function load($class)
+        {
+            // Include the composer autoloader if there is one, but re-register it
+            // so this autoloader runs before the composer one as we need to include
+            // all files so we can figure out what the class/interface/trait name is.
+            if (self::$composerAutoloader === null) {
+                // Make sure we don't try to load any of Composer's classes
+                // while the autoloader is being setup.
+                if (strpos($class, 'Composer\\') === 0) {
+                    return false;
+                }
+
+                if (strpos(__DIR__, 'phar://') !== 0
+                    && @file_exists(__DIR__.'/../../autoload.php') === true
+                ) {
+                    self::$composerAutoloader = include __DIR__.'/../../autoload.php';
+                    if (self::$composerAutoloader instanceof ClassLoader) {
+                        self::$composerAutoloader->unregister();
+                        self::$composerAutoloader->register();
+                    } else {
+                        // Something went wrong, so keep going without the autoloader
+                        // although namespaced sniffs might error.
+                        self::$composerAutoloader = false;
+                    }
+                } else {
+                    self::$composerAutoloader = false;
+                }
+            }//end if
+
+            $ds   = DIRECTORY_SEPARATOR;
+            $path = false;
+
+            if (substr($class, 0, 16) === 'PHP_CodeSniffer\\') {
+                if (substr($class, 0, 22) === 'PHP_CodeSniffer\Tests\\') {
+                    $isInstalled = !is_dir(__DIR__.$ds.'tests');
+                    if ($isInstalled === false) {
+                        $path = __DIR__.$ds.'tests';
+                    } else {
+                        $path = '@test_dir@'.$ds.'PHP_CodeSniffer'.$ds.'CodeSniffer';
+                    }
+
+                    $path .= $ds.substr(str_replace('\\', $ds, $class), 22).'.php';
+                } else {
+                    $path = __DIR__.$ds.'src'.$ds.substr(str_replace('\\', $ds, $class), 16).'.php';
+                }
+            }
+
+            // See if the composer autoloader knows where the class is.
+            if ($path === false && self::$composerAutoloader !== false) {
+                $path = self::$composerAutoloader->findFile($class);
+            }
+
+            // See if the class is inside one of our alternate search paths.
+            if ($path === false) {
+                foreach (self::$searchPaths as $searchPath => $nsPrefix) {
+                    $className = $class;
+                    if ($nsPrefix !== '' && substr($class, 0, strlen($nsPrefix)) === $nsPrefix) {
+                        $className = substr($class, (strlen($nsPrefix) + 1));
+                    }
+
+                    $path = $searchPath.$ds.str_replace('\\', $ds, $className).'.php';
+                    if (is_file($path) === true) {
+                        break;
+                    }
+
+                    $path = false;
+                }
+            }
+
+            if ($path !== false && is_file($path) === true) {
+                self::loadFile($path);
+                return true;
+            }
+
+            return false;
+
+        }//end load()
+
+
+        /**
+         * Includes a file and tracks what class or interface was loaded as a result.
+         *
+         * @param string $path The path of the file to load.
+         *
+         * @return string The fully qualified name of the class in the loaded file.
+         */
+        public static function loadFile($path)
+        {
+            if (strpos(__DIR__, 'phar://') !== 0) {
+                $path = realpath($path);
+                if ($path === false) {
+                    return false;
+                }
+            }
+
+            if (isset(self::$loadedClasses[$path]) === true) {
+                return self::$loadedClasses[$path];
+            }
+
+            $classesBeforeLoad = [
+                'classes'    => get_declared_classes(),
+                'interfaces' => get_declared_interfaces(),
+                'traits'     => get_declared_traits(),
+            ];
+
+            include $path;
+
+            $classesAfterLoad = [
+                'classes'    => get_declared_classes(),
+                'interfaces' => get_declared_interfaces(),
+                'traits'     => get_declared_traits(),
+            ];
+
+            $className = self::determineLoadedClass($classesBeforeLoad, $classesAfterLoad);
+
+            self::$loadedClasses[$path]    = $className;
+            self::$loadedFiles[$className] = $path;
+            return self::$loadedClasses[$path];
+
+        }//end loadFile()
+
+
+        /**
+         * Determine which class was loaded based on the before and after lists of loaded classes.
+         *
+         * @param array $classesBeforeLoad The classes/interfaces/traits before the file was included.
+         * @param array $classesAfterLoad  The classes/interfaces/traits after the file was included.
+         *
+         * @return string The fully qualified name of the class in the loaded file.
+         */
+        public static function determineLoadedClass($classesBeforeLoad, $classesAfterLoad)
+        {
+            $className = null;
+
+            $newClasses = array_diff($classesAfterLoad['classes'], $classesBeforeLoad['classes']);
+            if (PHP_VERSION_ID < 70400) {
+                $newClasses = array_reverse($newClasses);
+            }
+
+            // Since PHP 7.4 get_declared_classes() does not guarantee any order, making
+            // it impossible to use order to determine which is the parent and which is the child.
+            // Let's reduce the list of candidates by removing all the classes known to be "parents".
+            // That way, at the end, only the "main" class just included will remain.
+            $newClasses = array_reduce(
+                $newClasses,
+                function ($remaining, $current) {
+                    return array_diff($remaining, class_parents($current));
+                },
+                $newClasses
+            );
+
+            foreach ($newClasses as $name) {
+                if (isset(self::$loadedFiles[$name]) === false) {
+                    $className = $name;
+                    break;
+                }
+            }
+
+            if ($className === null) {
+                $newClasses = array_reverse(array_diff($classesAfterLoad['interfaces'], $classesBeforeLoad['interfaces']));
+                foreach ($newClasses as $name) {
+                    if (isset(self::$loadedFiles[$name]) === false) {
+                        $className = $name;
+                        break;
+                    }
+                }
+            }
+
+            if ($className === null) {
+                $newClasses = array_reverse(array_diff($classesAfterLoad['traits'], $classesBeforeLoad['traits']));
+                foreach ($newClasses as $name) {
+                    if (isset(self::$loadedFiles[$name]) === false) {
+                        $className = $name;
+                        break;
+                    }
+                }
+            }
+
+            return $className;
+
+        }//end determineLoadedClass()
+
+
+        /**
+         * Adds a directory to search during autoloading.
+         *
+         * @param string $path     The path to the directory to search.
+         * @param string $nsPrefix The namespace prefix used by files under this path.
+         *
+         * @return void
+         */
+        public static function addSearchPath($path, $nsPrefix='')
+        {
+            self::$searchPaths[$path] = rtrim(trim((string) $nsPrefix), '\\');
+
+        }//end addSearchPath()
+
+
+        /**
+         * Retrieve the namespaces and paths registered by external standards.
+         *
+         * @return array
+         */
+        public static function getSearchPaths()
+        {
+            return self::$searchPaths;
+
+        }//end getSearchPaths()
+
+
+        /**
+         * Gets the class name for the given file path.
+         *
+         * @param string $path The name of the file.
+         *
+         * @throws \Exception If the file path has not been loaded.
+         * @return string
+         */
+        public static function getLoadedClassName($path)
+        {
+            if (isset(self::$loadedClasses[$path]) === false) {
+                throw new Exception("Cannot get class name for $path; file has not been included");
+            }
+
+            return self::$loadedClasses[$path];
+
+        }//end getLoadedClassName()
+
+
+        /**
+         * Gets the file path for the given class name.
+         *
+         * @param string $class The name of the class.
+         *
+         * @throws \Exception If the class name has not been loaded.
+         * @return string
+         */
+        public static function getLoadedFileName($class)
+        {
+            if (isset(self::$loadedFiles[$class]) === false) {
+                throw new Exception("Cannot get file name for $class; class has not been included");
+            }
+
+            return self::$loadedFiles[$class];
+
+        }//end getLoadedFileName()
+
+
+        /**
+         * Gets the mapping of file names to class names.
+         *
+         * @return array<string, string>
+         */
+        public static function getLoadedClasses()
+        {
+            return self::$loadedClasses;
+
+        }//end getLoadedClasses()
+
+
+        /**
+         * Gets the mapping of class names to file names.
+         *
+         * @return array<string, string>
+         */
+        public static function getLoadedFiles()
+        {
+            return self::$loadedFiles;
+
+        }//end getLoadedFiles()
+
+
+    }//end class
+
+    // Register the autoloader before any existing autoloaders to ensure
+    // it gets a chance to hear about every autoload request, and record
+    // the file and class name for it.
+    spl_autoload_register(__NAMESPACE__.'\Autoload::load', true, true);
+}//end if

vendor/squizlabs/php_codesniffer/bin/phpcbf

@@ -0,0 +1,15 @@
+#!/usr/bin/env php
+<?php
+/**
+ * PHP Code Beautifier and Fixer fixes violations of a defined coding standard.
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+require_once __DIR__.'/../autoload.php';
+
+$runner   = new PHP_CodeSniffer\Runner();
+$exitCode = $runner->runPHPCBF();
+exit($exitCode);

vendor/squizlabs/php_codesniffer/bin/phpcbf.bat

@@ -0,0 +1,10 @@
+@echo off
+REM PHP Code Beautifier and Fixer fixes violations of a defined coding standard.
+REM 
+REM @author    Greg Sherwood <gsherwood@squiz.net>
+REM @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+REM @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+
+set PHPBIN=php
+
+"%PHPBIN%" "%~dp0\phpcbf" %*

vendor/squizlabs/php_codesniffer/bin/phpcs

@@ -0,0 +1,15 @@
+#!/usr/bin/env php
+<?php
+/**
+ * PHP_CodeSniffer detects violations of a defined coding standard.
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+require_once __DIR__.'/../autoload.php';
+
+$runner   = new PHP_CodeSniffer\Runner();
+$exitCode = $runner->runPHPCS();
+exit($exitCode);

vendor/squizlabs/php_codesniffer/bin/phpcs.bat

@@ -0,0 +1,10 @@
+@echo off
+REM PHP_CodeSniffer detects violations of a defined coding standard.
+REM 
+REM @author    Greg Sherwood <gsherwood@squiz.net>
+REM @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+REM @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+
+set PHPBIN=php
+
+"%PHPBIN%" "%~dp0\phpcs" %*

vendor/squizlabs/php_codesniffer/composer.json

@@ -0,0 +1,90 @@
+{
+    "name": "squizlabs/php_codesniffer",
+    "description": "PHP_CodeSniffer tokenizes PHP, JavaScript and CSS files and detects violations of a defined set of coding standards.",
+    "license": "BSD-3-Clause",
+    "type": "library",
+    "keywords": [
+        "phpcs",
+        "standards",
+        "static analysis"
+    ],
+    "authors": [
+        {
+            "name": "Greg Sherwood",
+            "role": "Former lead"
+        },
+        {
+            "name": "Juliette Reinders Folmer",
+            "role": "Current lead"
+        },
+        {
+            "name": "Contributors",
+            "homepage": "https://github.com/PHPCSStandards/PHP_CodeSniffer/graphs/contributors"
+        }
+    ],
+    "homepage": "https://github.com/PHPCSStandards/PHP_CodeSniffer",
+    "support": {
+        "issues": "https://github.com/PHPCSStandards/PHP_CodeSniffer/issues",
+        "wiki": "https://github.com/PHPCSStandards/PHP_CodeSniffer/wiki",
+        "source": "https://github.com/PHPCSStandards/PHP_CodeSniffer",
+        "security": "https://github.com/PHPCSStandards/PHP_CodeSniffer/security/policy"
+    },
+    "require": {
+        "php": ">=5.4.0",
+        "ext-simplexml": "*",
+        "ext-tokenizer": "*",
+        "ext-xmlwriter": "*"
+    },
+    "require-dev": {
+        "phpunit/phpunit": "^4.0 || ^5.0 || ^6.0 || ^7.0 || ^8.0 || ^9.3.4"
+    },
+    "bin": [
+        "bin/phpcbf",
+        "bin/phpcs"
+    ],
+    "config": {
+        "lock": false
+    },
+    "extra": {
+        "branch-alias": {
+            "dev-master": "3.x-dev"
+        }
+    },
+    "scripts": {
+        "cs": [
+            "@php ./bin/phpcs"
+        ],
+        "cbf": [
+            "@php ./bin/phpcbf"
+        ],
+        "test": [
+            "Composer\\Config::disableProcessTimeout",
+            "@php ./vendor/phpunit/phpunit/phpunit tests/AllTests.php --no-coverage"
+        ],
+        "coverage": [
+            "Composer\\Config::disableProcessTimeout",
+            "@php ./vendor/phpunit/phpunit/phpunit tests/AllTests.php -d max_execution_time=0"
+        ],
+        "coverage-local": [
+            "Composer\\Config::disableProcessTimeout",
+            "@php ./vendor/phpunit/phpunit/phpunit tests/AllTests.php --coverage-html ./build/coverage-html -d max_execution_time=0"
+        ],
+        "build": [
+            "Composer\\Config::disableProcessTimeout",
+            "@php -d phar.readonly=0 -f ./scripts/build-phar.php"
+        ],
+        "check-all": [
+            "@cs",
+            "@test"
+        ]
+    },
+    "scripts-descriptions": {
+        "cs": "Check for code style violations.",
+        "cbf": "Fix code style violations.",
+        "test": "Run the unit tests without code coverage.",
+        "coverage": "Run the unit tests with code coverage.",
+        "coverage-local": "Run the unit tests with code coverage and generate an HTML report in a 'build' directory.",
+        "build": "Create PHAR files for PHPCS and PHPCBF.",
+        "check-all": "Run all checks (phpcs, tests)."
+    }
+}

vendor/squizlabs/php_codesniffer/licence.txt

@@ -0,0 +1,25 @@
+Copyright (c) 2012, Squiz Pty Ltd (ABN 77 084 670 600)
+Copyright (c) 2023, PHPCSStandards and contributors
+All rights reserved.
+
+Redistribution and use in source and binary forms, with or without
+modification, are permitted provided that the following conditions are met:
+    * Redistributions of source code must retain the above copyright
+      notice, this list of conditions and the following disclaimer.
+    * Redistributions in binary form must reproduce the above copyright
+      notice, this list of conditions and the following disclaimer in the
+      documentation and/or other materials provided with the distribution.
+    * Neither the name of the copyright holder nor the
+      names of its contributors may be used to endorse or promote products
+      derived from this software without specific prior written permission.
+
+THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND
+ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE
+DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY
+DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES
+(INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES;
+LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND
+ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.

vendor/squizlabs/php_codesniffer/phpcs.xsd

@@ -0,0 +1,136 @@
+<?xml version="1.0" encoding="utf-8"?>
+<xs:schema xmlns:xs="http://www.w3.org/2001/XMLSchema" attributeFormDefault="unqualified" elementFormDefault="qualified">
+
+    <xs:element name="ruleset">
+        <xs:complexType>
+            <xs:choice minOccurs="0" maxOccurs="unbounded">
+                <xs:element name="description" type="xs:string" maxOccurs="1" minOccurs="0"></xs:element>
+                <xs:element name="config" maxOccurs="unbounded" minOccurs="0">
+                    <xs:complexType>
+                        <xs:attribute name="name" type="xs:string" use="required"></xs:attribute>
+                        <xs:attribute name="value" type="xs:string" use="required"></xs:attribute>
+                        <xs:attributeGroup ref="applySelectively"/>
+                    </xs:complexType>
+                </xs:element>
+                <xs:element name="file" maxOccurs="unbounded" minOccurs="0">
+                    <xs:complexType>
+                        <xs:simpleContent>
+                            <xs:extension base="xs:string">
+                                <xs:attributeGroup ref="applySelectively"/>
+                            </xs:extension>
+                        </xs:simpleContent>
+                    </xs:complexType>
+                </xs:element>
+                <xs:element name="exclude-pattern" type="patternType" maxOccurs="unbounded" minOccurs="0"></xs:element>
+                <xs:element name="arg" maxOccurs="unbounded" minOccurs="0">
+                    <xs:complexType>
+                        <xs:attribute name="name" type="xs:string"></xs:attribute>
+                        <xs:attribute name="value" type="xs:string"></xs:attribute>
+                        <xs:attributeGroup ref="applySelectively"/>
+                    </xs:complexType>
+                </xs:element>
+                <xs:element name="ini" maxOccurs="unbounded" minOccurs="0">
+                    <xs:complexType>
+                        <xs:attribute name="name" type="xs:string" use="required"></xs:attribute>
+                        <xs:attribute name="value" type="xs:string" use="required"></xs:attribute>
+                        <xs:attributeGroup ref="applySelectively"/>
+                    </xs:complexType>
+                </xs:element>
+                <xs:element name="autoload" type="xs:string" maxOccurs="unbounded" minOccurs="0"></xs:element>
+                <xs:element name="rule" type="ruleType" maxOccurs="unbounded" minOccurs="0"></xs:element>
+            </xs:choice>
+            <xs:attribute name="name" type="xs:string"></xs:attribute>
+            <xs:attribute name="namespace" type="xs:string"></xs:attribute>
+        </xs:complexType>
+    </xs:element>
+
+    <xs:complexType name="ruleType">
+        <xs:choice minOccurs="0" maxOccurs="unbounded">
+            <xs:element name="exclude" maxOccurs="unbounded" minOccurs="0">
+                <xs:complexType>
+                    <xs:attribute name="name" type="xs:string" use="required"></xs:attribute>
+                    <xs:attributeGroup ref="applySelectively"/>
+                </xs:complexType>
+            </xs:element>
+            <xs:element name="message" type="xs:string" maxOccurs="1" minOccurs="0"></xs:element>
+            <xs:element name="severity" maxOccurs="1" minOccurs="0">
+                <xs:complexType>
+                    <xs:simpleContent>
+                        <xs:extension base="xs:integer">
+                            <xs:attributeGroup ref="applySelectively"/>
+                        </xs:extension>
+                    </xs:simpleContent>
+                </xs:complexType>
+            </xs:element>
+            <xs:element name="type" maxOccurs="1" minOccurs="0">
+                <xs:complexType>
+                    <xs:simpleContent>
+                        <xs:extension base="messageType">
+                            <xs:attributeGroup ref="applySelectively"/>
+                        </xs:extension>
+                    </xs:simpleContent>
+                </xs:complexType>
+            </xs:element>
+            <xs:element name="exclude-pattern" type="patternType" maxOccurs="unbounded" minOccurs="0"></xs:element>
+            <xs:element name="include-pattern" type="patternType" maxOccurs="unbounded" minOccurs="0"></xs:element>
+            <xs:element name="properties" type="propertiesType" maxOccurs="1" minOccurs="0"></xs:element>
+        </xs:choice>
+        <xs:attribute name="ref" type="xs:string" use="required"></xs:attribute>
+        <xs:attributeGroup ref="applySelectively"/>
+    </xs:complexType>
+
+    <xs:complexType name="patternType">
+        <xs:simpleContent>
+            <xs:extension base="xs:string">
+                <xs:attribute name="type">
+                    <xs:simpleType>
+                        <xs:restriction base="xs:string">
+                            <xs:enumeration value="relative"></xs:enumeration>
+                        </xs:restriction>
+                    </xs:simpleType>
+                </xs:attribute>
+                <xs:attributeGroup ref="applySelectively"/>
+            </xs:extension>
+        </xs:simpleContent>
+    </xs:complexType>
+
+    <xs:complexType name="propertiesType">
+        <xs:sequence>
+            <xs:element name="property" maxOccurs="unbounded" minOccurs="1">
+                <xs:complexType>
+                    <xs:sequence>
+                        <xs:element name="element" maxOccurs="unbounded" minOccurs="0">
+                            <xs:complexType>
+                                <xs:attribute name="key" type="xs:string"></xs:attribute>
+                                <xs:attribute name="value" type="xs:string" use="required"></xs:attribute>
+                            </xs:complexType>
+                        </xs:element>
+                    </xs:sequence>
+                    <xs:attribute name="type">
+                        <xs:simpleType>
+                            <xs:restriction base="xs:string">
+                                <xs:enumeration value="array"></xs:enumeration>
+                            </xs:restriction>
+                        </xs:simpleType>
+                    </xs:attribute>
+                    <xs:attribute name="name" type="xs:string" use="required"></xs:attribute>
+                    <xs:attribute name="value" type="xs:string"></xs:attribute>
+                    <xs:attribute name="extend" type="xs:boolean" default="false"/>
+                    <xs:attributeGroup ref="applySelectively"/>
+                </xs:complexType>
+            </xs:element>
+        </xs:sequence>
+    </xs:complexType>
+
+    <xs:simpleType name="messageType">
+        <xs:restriction base="xs:string">
+            <xs:enumeration value="error"></xs:enumeration>
+            <xs:enumeration value="warning"></xs:enumeration>
+        </xs:restriction>
+    </xs:simpleType>
+
+    <xs:attributeGroup name="applySelectively">
+        <xs:attribute name="phpcs-only" type="xs:boolean" default="false"/>
+        <xs:attribute name="phpcbf-only" type="xs:boolean" default="false"/>
+    </xs:attributeGroup>
+</xs:schema>

vendor/squizlabs/php_codesniffer/src/Exceptions/DeepExitException.php

@@ -0,0 +1,20 @@
+<?php
+/**
+ * An exception thrown by PHP_CodeSniffer when it wants to exit from somewhere not in the main runner.
+ *
+ * Allows the runner to return an exit code instead of putting exit codes elsewhere
+ * in the source code.
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Exceptions;
+
+use Exception;
+
+class DeepExitException extends Exception
+{
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Exceptions/RuntimeException.php

@@ -0,0 +1,17 @@
+<?php
+/**
+ * An exception thrown by PHP_CodeSniffer when it encounters an unrecoverable error.
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Exceptions;
+
+use RuntimeException as PHPRuntimeException;
+
+class RuntimeException extends PHPRuntimeException
+{
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Exceptions/TokenizerException.php

@@ -0,0 +1,17 @@
+<?php
+/**
+ * An exception thrown by PHP_CodeSniffer when it encounters an unrecoverable tokenizer error.
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Exceptions;
+
+use Exception;
+
+class TokenizerException extends Exception
+{
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Files/DummyFile.php

@@ -0,0 +1,82 @@
+<?php
+/**
+ * A dummy file represents a chunk of text that does not have a file system location.
+ *
+ * Dummy files can also represent a changed (but not saved) version of a file
+ * and so can have a file path either set manually, or set by putting
+ * phpcs_input_file: /path/to/file
+ * as the first line of the file contents.
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Files;
+
+use PHP_CodeSniffer\Config;
+use PHP_CodeSniffer\Ruleset;
+
+class DummyFile extends File
+{
+
+
+    /**
+     * Creates a DummyFile object and sets the content.
+     *
+     * @param string                   $content The content of the file.
+     * @param \PHP_CodeSniffer\Ruleset $ruleset The ruleset used for the run.
+     * @param \PHP_CodeSniffer\Config  $config  The config data for the run.
+     *
+     * @return void
+     */
+    public function __construct($content, Ruleset $ruleset, Config $config)
+    {
+        $this->setContent($content);
+
+        // See if a filename was defined in the content.
+        // This is done by including: phpcs_input_file: [file path]
+        // as the first line of content.
+        $path = 'STDIN';
+        if ($content !== '') {
+            if (substr($content, 0, 17) === 'phpcs_input_file:') {
+                $eolPos   = strpos($content, $this->eolChar);
+                $filename = trim(substr($content, 17, ($eolPos - 17)));
+                $content  = substr($content, ($eolPos + strlen($this->eolChar)));
+                $path     = $filename;
+
+                $this->setContent($content);
+            }
+        }
+
+        // The CLI arg overrides anything passed in the content.
+        if ($config->stdinPath !== null) {
+            $path = $config->stdinPath;
+        }
+
+        parent::__construct($path, $ruleset, $config);
+
+    }//end __construct()
+
+
+    /**
+     * Set the error, warning, and fixable counts for the file.
+     *
+     * @param int $errorCount   The number of errors found.
+     * @param int $warningCount The number of warnings found.
+     * @param int $fixableCount The number of fixable errors found.
+     * @param int $fixedCount   The number of errors that were fixed.
+     *
+     * @return void
+     */
+    public function setErrorCounts($errorCount, $warningCount, $fixableCount, $fixedCount)
+    {
+        $this->errorCount   = $errorCount;
+        $this->warningCount = $warningCount;
+        $this->fixableCount = $fixableCount;
+        $this->fixedCount   = $fixedCount;
+
+    }//end setErrorCounts()
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Files/FileList.php

@@ -0,0 +1,266 @@
+<?php
+/**
+ * Represents a list of files on the file system that are to be checked during the run.
+ *
+ * File objects are created as needed rather than all at once.
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Files;
+
+use Countable;
+use FilesystemIterator;
+use Iterator;
+use PHP_CodeSniffer\Autoload;
+use PHP_CodeSniffer\Config;
+use PHP_CodeSniffer\Exceptions\DeepExitException;
+use PHP_CodeSniffer\Ruleset;
+use PHP_CodeSniffer\Util\Common;
+use RecursiveArrayIterator;
+use RecursiveDirectoryIterator;
+use RecursiveIteratorIterator;
+use ReturnTypeWillChange;
+
+class FileList implements Iterator, Countable
+{
+
+    /**
+     * A list of file paths that are included in the list.
+     *
+     * @var array
+     */
+    private $files = [];
+
+    /**
+     * The number of files in the list.
+     *
+     * @var integer
+     */
+    private $numFiles = 0;
+
+    /**
+     * The config data for the run.
+     *
+     * @var \PHP_CodeSniffer\Config
+     */
+    public $config = null;
+
+    /**
+     * The ruleset used for the run.
+     *
+     * @var \PHP_CodeSniffer\Ruleset
+     */
+    public $ruleset = null;
+
+    /**
+     * An array of patterns to use for skipping files.
+     *
+     * @var array
+     */
+    protected $ignorePatterns = [];
+
+
+    /**
+     * Constructs a file list and loads in an array of file paths to process.
+     *
+     * @param \PHP_CodeSniffer\Config  $config  The config data for the run.
+     * @param \PHP_CodeSniffer\Ruleset $ruleset The ruleset used for the run.
+     *
+     * @return void
+     */
+    public function __construct(Config $config, Ruleset $ruleset)
+    {
+        $this->ruleset = $ruleset;
+        $this->config  = $config;
+
+        $paths = $config->files;
+        foreach ($paths as $path) {
+            $isPharFile = Common::isPharFile($path);
+            if (is_dir($path) === true || $isPharFile === true) {
+                if ($isPharFile === true) {
+                    $path = 'phar://'.$path;
+                }
+
+                $filterClass = $this->getFilterClass();
+
+                $di       = new RecursiveDirectoryIterator($path, (RecursiveDirectoryIterator::SKIP_DOTS | FilesystemIterator::FOLLOW_SYMLINKS));
+                $filter   = new $filterClass($di, $path, $config, $ruleset);
+                $iterator = new RecursiveIteratorIterator($filter);
+
+                foreach ($iterator as $file) {
+                    $this->files[$file->getPathname()] = null;
+                }
+            } else {
+                $this->addFile($path);
+            }//end if
+        }//end foreach
+
+        reset($this->files);
+        $this->numFiles = count($this->files);
+
+    }//end __construct()
+
+
+    /**
+     * Add a file to the list.
+     *
+     * If a file object has already been created, it can be passed here.
+     * If it is left NULL, it will be created when accessed.
+     *
+     * @param string                      $path The path to the file being added.
+     * @param \PHP_CodeSniffer\Files\File $file The file being added.
+     *
+     * @return void
+     */
+    public function addFile($path, $file=null)
+    {
+        // No filtering is done for STDIN when the filename
+        // has not been specified.
+        if ($path === 'STDIN') {
+            $this->files[$path] = $file;
+            $this->numFiles++;
+            return;
+        }
+
+        $filterClass = $this->getFilterClass();
+
+        $di       = new RecursiveArrayIterator([$path]);
+        $filter   = new $filterClass($di, $path, $this->config, $this->ruleset);
+        $iterator = new RecursiveIteratorIterator($filter);
+
+        foreach ($iterator as $path) {
+            if (array_key_exists($path, $this->files) === true) {
+                // The path has already been added.
+                continue;
+            }
+
+            $this->files[$path] = $file;
+            $this->numFiles++;
+        }
+
+    }//end addFile()
+
+
+    /**
+     * Get the class name of the filter being used for the run.
+     *
+     * @return string
+     * @throws \PHP_CodeSniffer\Exceptions\DeepExitException If the specified filter could not be found.
+     */
+    private function getFilterClass()
+    {
+        $filterType = $this->config->filter;
+
+        if ($filterType === null) {
+            $filterClass = '\PHP_CodeSniffer\Filters\Filter';
+        } else {
+            if (strpos($filterType, '.') !== false) {
+                // This is a path to a custom filter class.
+                $filename = realpath($filterType);
+                if ($filename === false) {
+                    $error = "ERROR: Custom filter \"$filterType\" not found".PHP_EOL;
+                    throw new DeepExitException($error, 3);
+                }
+
+                $filterClass = Autoload::loadFile($filename);
+            } else {
+                $filterClass = '\PHP_CodeSniffer\Filters\\'.$filterType;
+            }
+        }
+
+        return $filterClass;
+
+    }//end getFilterClass()
+
+
+    /**
+     * Rewind the iterator to the first file.
+     *
+     * @return void
+     */
+    #[ReturnTypeWillChange]
+    public function rewind()
+    {
+        reset($this->files);
+
+    }//end rewind()
+
+
+    /**
+     * Get the file that is currently being processed.
+     *
+     * @return \PHP_CodeSniffer\Files\File
+     */
+    #[ReturnTypeWillChange]
+    public function current()
+    {
+        $path = key($this->files);
+        if (isset($this->files[$path]) === false) {
+            $this->files[$path] = new LocalFile($path, $this->ruleset, $this->config);
+        }
+
+        return $this->files[$path];
+
+    }//end current()
+
+
+    /**
+     * Return the file path of the current file being processed.
+     *
+     * @return string|null Path name or `null` when the end of the iterator has been reached.
+     */
+    #[ReturnTypeWillChange]
+    public function key()
+    {
+        return key($this->files);
+
+    }//end key()
+
+
+    /**
+     * Move forward to the next file.
+     *
+     * @return void
+     */
+    #[ReturnTypeWillChange]
+    public function next()
+    {
+        next($this->files);
+
+    }//end next()
+
+
+    /**
+     * Checks if current position is valid.
+     *
+     * @return boolean
+     */
+    #[ReturnTypeWillChange]
+    public function valid()
+    {
+        if (current($this->files) === false) {
+            return false;
+        }
+
+        return true;
+
+    }//end valid()
+
+
+    /**
+     * Return the number of files in the list.
+     *
+     * @return integer
+     */
+    #[ReturnTypeWillChange]
+    public function count()
+    {
+        return $this->numFiles;
+
+    }//end count()
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Files/LocalFile.php

@@ -0,0 +1,219 @@
+<?php
+/**
+ * A local file represents a chunk of text has a file system location.
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Files;
+
+use PHP_CodeSniffer\Config;
+use PHP_CodeSniffer\Ruleset;
+use PHP_CodeSniffer\Util\Cache;
+use PHP_CodeSniffer\Util\Common;
+
+class LocalFile extends File
+{
+
+
+    /**
+     * Creates a LocalFile object and sets the content.
+     *
+     * @param string                   $path    The absolute path to the file.
+     * @param \PHP_CodeSniffer\Ruleset $ruleset The ruleset used for the run.
+     * @param \PHP_CodeSniffer\Config  $config  The config data for the run.
+     *
+     * @return void
+     */
+    public function __construct($path, Ruleset $ruleset, Config $config)
+    {
+        $this->path = trim($path);
+        if (Common::isReadable($this->path) === false) {
+            parent::__construct($this->path, $ruleset, $config);
+            $error = 'Error opening file; file no longer exists or you do not have access to read the file';
+            $this->addMessage(true, $error, 1, 1, 'Internal.LocalFile', [], 5, false);
+            $this->ignored = true;
+            return;
+        }
+
+        // Before we go and spend time tokenizing this file, just check
+        // to see if there is a tag up top to indicate that the whole
+        // file should be ignored. It must be on one of the first two lines.
+        if ($config->annotations === true) {
+            $handle = fopen($this->path, 'r');
+            if ($handle !== false) {
+                $firstContent  = fgets($handle);
+                $firstContent .= fgets($handle);
+                fclose($handle);
+
+                if (strpos($firstContent, '@codingStandardsIgnoreFile') !== false
+                    || stripos($firstContent, 'phpcs:ignorefile') !== false
+                ) {
+                    // We are ignoring the whole file.
+                    $this->ignored = true;
+                    return;
+                }
+            }
+        }
+
+        $this->reloadContent();
+
+        parent::__construct($this->path, $ruleset, $config);
+
+    }//end __construct()
+
+
+    /**
+     * Loads the latest version of the file's content from the file system.
+     *
+     * @return void
+     */
+    public function reloadContent()
+    {
+        $this->setContent(file_get_contents($this->path));
+
+    }//end reloadContent()
+
+
+    /**
+     * Processes the file.
+     *
+     * @return void
+     */
+    public function process()
+    {
+        if ($this->ignored === true) {
+            return;
+        }
+
+        if ($this->configCache['cache'] === false) {
+            parent::process();
+            return;
+        }
+
+        $hash  = md5_file($this->path);
+        $hash .= fileperms($this->path);
+        $cache = Cache::get($this->path);
+        if ($cache !== false && $cache['hash'] === $hash) {
+            // We can't filter metrics, so just load all of them.
+            $this->metrics = $cache['metrics'];
+
+            if ($this->configCache['recordErrors'] === true) {
+                // Replay the cached errors and warnings to filter out the ones
+                // we don't need for this specific run.
+                $this->configCache['cache'] = false;
+                $this->replayErrors($cache['errors'], $cache['warnings']);
+                $this->configCache['cache'] = true;
+            } else {
+                $this->errorCount   = $cache['errorCount'];
+                $this->warningCount = $cache['warningCount'];
+                $this->fixableCount = $cache['fixableCount'];
+            }
+
+            if (PHP_CODESNIFFER_VERBOSITY > 0
+                || (PHP_CODESNIFFER_CBF === true && empty($this->config->files) === false)
+            ) {
+                echo "[loaded from cache]... ";
+            }
+
+            $this->numTokens = $cache['numTokens'];
+            $this->fromCache = true;
+            return;
+        }//end if
+
+        if (PHP_CODESNIFFER_VERBOSITY > 1) {
+            echo PHP_EOL;
+        }
+
+        parent::process();
+
+        $cache = [
+            'hash'         => $hash,
+            'errors'       => $this->errors,
+            'warnings'     => $this->warnings,
+            'metrics'      => $this->metrics,
+            'errorCount'   => $this->errorCount,
+            'warningCount' => $this->warningCount,
+            'fixableCount' => $this->fixableCount,
+            'numTokens'    => $this->numTokens,
+        ];
+
+        Cache::set($this->path, $cache);
+
+        // During caching, we don't filter out errors in any way, so
+        // we need to do that manually now by replaying them.
+        if ($this->configCache['recordErrors'] === true) {
+            $this->configCache['cache'] = false;
+            $this->replayErrors($this->errors, $this->warnings);
+            $this->configCache['cache'] = true;
+        }
+
+    }//end process()
+
+
+    /**
+     * Clears and replays error and warnings for the file.
+     *
+     * Replaying errors and warnings allows for filtering rules to be changed
+     * and then errors and warnings to be reapplied with the new rules. This is
+     * particularly useful while caching.
+     *
+     * @param array $errors   The list of errors to replay.
+     * @param array $warnings The list of warnings to replay.
+     *
+     * @return void
+     */
+    private function replayErrors($errors, $warnings)
+    {
+        $this->errors       = [];
+        $this->warnings     = [];
+        $this->errorCount   = 0;
+        $this->warningCount = 0;
+        $this->fixableCount = 0;
+
+        $this->replayingErrors = true;
+
+        foreach ($errors as $line => $lineErrors) {
+            foreach ($lineErrors as $column => $colErrors) {
+                foreach ($colErrors as $error) {
+                    $this->activeListener = $error['listener'];
+                    $this->addMessage(
+                        true,
+                        $error['message'],
+                        $line,
+                        $column,
+                        $error['source'],
+                        [],
+                        $error['severity'],
+                        $error['fixable']
+                    );
+                }
+            }
+        }
+
+        foreach ($warnings as $line => $lineErrors) {
+            foreach ($lineErrors as $column => $colErrors) {
+                foreach ($colErrors as $error) {
+                    $this->activeListener = $error['listener'];
+                    $this->addMessage(
+                        false,
+                        $error['message'],
+                        $line,
+                        $column,
+                        $error['source'],
+                        [],
+                        $error['severity'],
+                        $error['fixable']
+                    );
+                }
+            }
+        }
+
+        $this->replayingErrors = false;
+
+    }//end replayErrors()
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Filters/ExactMatch.php

@@ -0,0 +1,156 @@
+<?php
+/**
+ * An abstract filter class for checking files and folders against exact matches.
+ *
+ * Supports both allowed files and disallowed files.
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Filters;
+
+use PHP_CodeSniffer\Util\Common;
+
+abstract class ExactMatch extends Filter
+{
+
+    /**
+     * A list of files to exclude.
+     *
+     * @var array
+     */
+    private $disallowedFiles = null;
+
+    /**
+     * A list of files to include.
+     *
+     * If the allowed files list is empty, only files in the disallowed files list will be excluded.
+     *
+     * @var array
+     */
+    private $allowedFiles = null;
+
+
+    /**
+     * Check whether the current element of the iterator is acceptable.
+     *
+     * If a file is both disallowed and allowed, it will be deemed unacceptable.
+     *
+     * @return bool
+     */
+    public function accept()
+    {
+        if (parent::accept() === false) {
+            return false;
+        }
+
+        if ($this->disallowedFiles === null) {
+            $this->disallowedFiles = $this->getDisallowedFiles();
+
+            // BC-layer.
+            if ($this->disallowedFiles === null) {
+                $this->disallowedFiles = $this->getBlacklist();
+            }
+        }
+
+        if ($this->allowedFiles === null) {
+            $this->allowedFiles = $this->getAllowedFiles();
+
+            // BC-layer.
+            if ($this->allowedFiles === null) {
+                $this->allowedFiles = $this->getWhitelist();
+            }
+        }
+
+        $filePath = Common::realpath($this->current());
+
+        // If a file is both disallowed and allowed, the disallowed files list takes precedence.
+        if (isset($this->disallowedFiles[$filePath]) === true) {
+            return false;
+        }
+
+        if (empty($this->allowedFiles) === true && empty($this->disallowedFiles) === false) {
+            // We are only checking the disallowed files list, so everything else should be allowed.
+            return true;
+        }
+
+        return isset($this->allowedFiles[$filePath]);
+
+    }//end accept()
+
+
+    /**
+     * Returns an iterator for the current entry.
+     *
+     * Ensures that the disallowed files list and the allowed files list are preserved so they don't have
+     * to be generated each time.
+     *
+     * @return \RecursiveIterator
+     */
+    public function getChildren()
+    {
+        $children = parent::getChildren();
+        $children->disallowedFiles = $this->disallowedFiles;
+        $children->allowedFiles    = $this->allowedFiles;
+        return $children;
+
+    }//end getChildren()
+
+
+    /**
+     * Get a list of file paths to exclude.
+     *
+     * @deprecated 3.9.0 Implement the `getDisallowedFiles()` method instead.
+     *                   The `getDisallowedFiles()` method will be made abstract and therefore required
+     *                   in v4.0 and this method will be removed.
+     *                   If both methods are implemented, the new `getDisallowedFiles()` method will take precedence.
+     *
+     * @return array
+     */
+    abstract protected function getBlacklist();
+
+
+    /**
+     * Get a list of file paths to include.
+     *
+     * @deprecated 3.9.0 Implement the `getAllowedFiles()` method instead.
+     *                   The `getAllowedFiles()` method will be made abstract and therefore required
+     *                   in v4.0 and this method will be removed.
+     *                   If both methods are implemented, the new `getAllowedFiles()` method will take precedence.
+     *
+     * @return array
+     */
+    abstract protected function getWhitelist();
+
+
+    /**
+     * Get a list of file paths to exclude.
+     *
+     * @since 3.9.0 Replaces the deprecated `getBlacklist()` method.
+     *
+     * @return array|null
+     */
+    protected function getDisallowedFiles()
+    {
+        return null;
+
+    }//end getDisallowedFiles()
+
+
+    /**
+     * Get a list of file paths to include.
+     *
+     * @since 3.9.0 Replaces the deprecated `getWhitelist()` method.
+     *
+     * @return array|null
+     */
+    protected function getAllowedFiles()
+    {
+        return null;
+
+    }//end getAllowedFiles()
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Filters/Filter.php

@@ -0,0 +1,281 @@
+<?php
+/**
+ * A base filter class for filtering out files and folders during a run.
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Filters;
+
+use FilesystemIterator;
+use PHP_CodeSniffer\Config;
+use PHP_CodeSniffer\Ruleset;
+use PHP_CodeSniffer\Util\Common;
+use RecursiveDirectoryIterator;
+use RecursiveFilterIterator;
+use ReturnTypeWillChange;
+
+class Filter extends RecursiveFilterIterator
+{
+
+    /**
+     * The top-level path we are filtering.
+     *
+     * @var string
+     */
+    protected $basedir = null;
+
+    /**
+     * The config data for the run.
+     *
+     * @var \PHP_CodeSniffer\Config
+     */
+    protected $config = null;
+
+    /**
+     * The ruleset used for the run.
+     *
+     * @var \PHP_CodeSniffer\Ruleset
+     */
+    protected $ruleset = null;
+
+    /**
+     * A list of ignore patterns that apply to directories only.
+     *
+     * @var array
+     */
+    protected $ignoreDirPatterns = null;
+
+    /**
+     * A list of ignore patterns that apply to files only.
+     *
+     * @var array
+     */
+    protected $ignoreFilePatterns = null;
+
+    /**
+     * A list of file paths we've already accepted.
+     *
+     * Used to ensure we aren't following circular symlinks.
+     *
+     * @var array
+     */
+    protected $acceptedPaths = [];
+
+
+    /**
+     * Constructs a filter.
+     *
+     * @param \RecursiveIterator       $iterator The iterator we are using to get file paths.
+     * @param string                   $basedir  The top-level path we are filtering.
+     * @param \PHP_CodeSniffer\Config  $config   The config data for the run.
+     * @param \PHP_CodeSniffer\Ruleset $ruleset  The ruleset used for the run.
+     *
+     * @return void
+     */
+    public function __construct($iterator, $basedir, Config $config, Ruleset $ruleset)
+    {
+        parent::__construct($iterator);
+        $this->basedir = $basedir;
+        $this->config  = $config;
+        $this->ruleset = $ruleset;
+
+    }//end __construct()
+
+
+    /**
+     * Check whether the current element of the iterator is acceptable.
+     *
+     * Files are checked for allowed extensions and ignore patterns.
+     * Directories are checked for ignore patterns only.
+     *
+     * @return bool
+     */
+    #[ReturnTypeWillChange]
+    public function accept()
+    {
+        $filePath = $this->current();
+        $realPath = Common::realpath($filePath);
+
+        if ($realPath !== false) {
+            // It's a real path somewhere, so record it
+            // to check for circular symlinks.
+            if (isset($this->acceptedPaths[$realPath]) === true) {
+                // We've been here before.
+                return false;
+            }
+        }
+
+        $filePath = $this->current();
+        if (is_dir($filePath) === true) {
+            if ($this->config->local === true) {
+                return false;
+            }
+        } else if ($this->shouldProcessFile($filePath) === false) {
+            return false;
+        }
+
+        if ($this->shouldIgnorePath($filePath) === true) {
+            return false;
+        }
+
+        $this->acceptedPaths[$realPath] = true;
+        return true;
+
+    }//end accept()
+
+
+    /**
+     * Returns an iterator for the current entry.
+     *
+     * Ensures that the ignore patterns are preserved so they don't have
+     * to be generated each time.
+     *
+     * @return \RecursiveIterator
+     */
+    #[ReturnTypeWillChange]
+    public function getChildren()
+    {
+        $filterClass = get_called_class();
+        $children    = new $filterClass(
+            new RecursiveDirectoryIterator($this->current(), (RecursiveDirectoryIterator::SKIP_DOTS | FilesystemIterator::FOLLOW_SYMLINKS)),
+            $this->basedir,
+            $this->config,
+            $this->ruleset
+        );
+
+        // Set the ignore patterns so we don't have to generate them again.
+        $children->ignoreDirPatterns  = $this->ignoreDirPatterns;
+        $children->ignoreFilePatterns = $this->ignoreFilePatterns;
+        $children->acceptedPaths      = $this->acceptedPaths;
+        return $children;
+
+    }//end getChildren()
+
+
+    /**
+     * Checks filtering rules to see if a file should be checked.
+     *
+     * Checks both file extension filters and path ignore filters.
+     *
+     * @param string $path The path to the file being checked.
+     *
+     * @return bool
+     */
+    protected function shouldProcessFile($path)
+    {
+        // Check that the file's extension is one we are checking.
+        // We are strict about checking the extension and we don't
+        // let files through with no extension or that start with a dot.
+        $fileName  = basename($path);
+        $fileParts = explode('.', $fileName);
+        if ($fileParts[0] === $fileName || $fileParts[0] === '') {
+            return false;
+        }
+
+        // Checking multi-part file extensions, so need to create a
+        // complete extension list and make sure one is allowed.
+        $extensions = [];
+        array_shift($fileParts);
+        while (empty($fileParts) === false) {
+            $extensions[implode('.', $fileParts)] = 1;
+            array_shift($fileParts);
+        }
+
+        $matches = array_intersect_key($extensions, $this->config->extensions);
+        if (empty($matches) === true) {
+            return false;
+        }
+
+        return true;
+
+    }//end shouldProcessFile()
+
+
+    /**
+     * Checks filtering rules to see if a path should be ignored.
+     *
+     * @param string $path The path to the file or directory being checked.
+     *
+     * @return bool
+     */
+    protected function shouldIgnorePath($path)
+    {
+        if ($this->ignoreFilePatterns === null) {
+            $this->ignoreDirPatterns  = [];
+            $this->ignoreFilePatterns = [];
+
+            $ignorePatterns        = $this->config->ignored;
+            $rulesetIgnorePatterns = $this->ruleset->getIgnorePatterns();
+            foreach ($rulesetIgnorePatterns as $pattern => $type) {
+                // Ignore standard/sniff specific exclude rules.
+                if (is_array($type) === true) {
+                    continue;
+                }
+
+                $ignorePatterns[$pattern] = $type;
+            }
+
+            foreach ($ignorePatterns as $pattern => $type) {
+                // If the ignore pattern ends with /* then it is ignoring an entire directory.
+                if (substr($pattern, -2) === '/*') {
+                    // Need to check this pattern for dirs as well as individual file paths.
+                    $this->ignoreFilePatterns[$pattern] = $type;
+
+                    $pattern = substr($pattern, 0, -2).'(?=/|$)';
+                    $this->ignoreDirPatterns[$pattern] = $type;
+                } else {
+                    // This is a file-specific pattern, so only need to check this
+                    // for individual file paths.
+                    $this->ignoreFilePatterns[$pattern] = $type;
+                }
+            }
+        }//end if
+
+        $relativePath = $path;
+        if (strpos($path, $this->basedir) === 0) {
+            // The +1 cuts off the directory separator as well.
+            $relativePath = substr($path, (strlen($this->basedir) + 1));
+        }
+
+        if (is_dir($path) === true) {
+            $ignorePatterns = $this->ignoreDirPatterns;
+        } else {
+            $ignorePatterns = $this->ignoreFilePatterns;
+        }
+
+        foreach ($ignorePatterns as $pattern => $type) {
+            $replacements = [
+                '\\,' => ',',
+                '*'   => '.*',
+            ];
+
+            // We assume a / directory separator, as do the exclude rules
+            // most developers write, so we need a special case for any system
+            // that is different.
+            if (DIRECTORY_SEPARATOR === '\\') {
+                $replacements['/'] = '\\\\';
+            }
+
+            $pattern = strtr($pattern, $replacements);
+
+            if ($type === 'relative') {
+                $testPath = $relativePath;
+            } else {
+                $testPath = $path;
+            }
+
+            $pattern = '`'.$pattern.'`i';
+            if (preg_match($pattern, $testPath) === 1) {
+                return true;
+            }
+        }//end foreach
+
+        return false;
+
+    }//end shouldIgnorePath()
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Filters/GitModified.php

@@ -0,0 +1,124 @@
+<?php
+/**
+ * A filter to only include files that have been modified or added in a Git repository.
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Filters;
+
+use PHP_CodeSniffer\Util\Common;
+
+class GitModified extends ExactMatch
+{
+
+
+    /**
+     * Get a list of file paths to exclude.
+     *
+     * @since 3.9.0
+     *
+     * @return array
+     */
+    protected function getDisallowedFiles()
+    {
+        return [];
+
+    }//end getDisallowedFiles()
+
+
+    /**
+     * Get a list of file paths to exclude.
+     *
+     * @deprecated 3.9.0 Overload the `getDisallowedFiles()` method instead.
+     *
+     * @codeCoverageIgnore
+     *
+     * @return array
+     */
+    protected function getBlacklist()
+    {
+        return $this->getDisallowedFiles();
+
+    }//end getBlacklist()
+
+
+    /**
+     * Get a list of file paths to include.
+     *
+     * @since 3.9.0
+     *
+     * @return array
+     */
+    protected function getAllowedFiles()
+    {
+        $modified = [];
+
+        $cmd    = 'git ls-files -o -m --exclude-standard -- '.escapeshellarg($this->basedir);
+        $output = $this->exec($cmd);
+
+        $basedir = $this->basedir;
+        if (is_dir($basedir) === false) {
+            $basedir = dirname($basedir);
+        }
+
+        foreach ($output as $path) {
+            $path = Common::realpath($path);
+
+            if ($path === false) {
+                continue;
+            }
+
+            do {
+                $modified[$path] = true;
+                $path            = dirname($path);
+            } while ($path !== $basedir);
+        }
+
+        return $modified;
+
+    }//end getAllowedFiles()
+
+
+    /**
+     * Get a list of file paths to include.
+     *
+     * @deprecated 3.9.0 Overload the `getAllowedFiles()` method instead.
+     *
+     * @codeCoverageIgnore
+     *
+     * @return array
+     */
+    protected function getWhitelist()
+    {
+        return $this->getAllowedFiles();
+
+    }//end getWhitelist()
+
+
+    /**
+     * Execute an external command.
+     *
+     * {@internal This method is only needed to allow for mocking the return value
+     * to test the class logic.}
+     *
+     * @param string $cmd Command.
+     *
+     * @return array
+     */
+    protected function exec($cmd)
+    {
+        $output   = [];
+        $lastLine = exec($cmd, $output);
+        if ($lastLine === false) {
+            return [];
+        }
+
+        return $output;
+
+    }//end exec()
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Filters/GitStaged.php

@@ -0,0 +1,126 @@
+<?php
+/**
+ * A filter to only include files that have been staged for commit in a Git repository.
+ *
+ * This filter is the ideal companion for your pre-commit git hook.
+ *
+ * @author    Juliette Reinders Folmer <phpcs_nospam@adviesenzo.nl>
+ * @copyright 2018 Juliette Reinders Folmer. All rights reserved.
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Filters;
+
+use PHP_CodeSniffer\Util\Common;
+
+class GitStaged extends ExactMatch
+{
+
+
+    /**
+     * Get a list of file paths to exclude.
+     *
+     * @since 3.9.0
+     *
+     * @return array
+     */
+    protected function getDisallowedFiles()
+    {
+        return [];
+
+    }//end getDisallowedFiles()
+
+
+    /**
+     * Get a list of file paths to exclude.
+     *
+     * @deprecated 3.9.0 Overload the `getDisallowedFiles()` method instead.
+     *
+     * @codeCoverageIgnore
+     *
+     * @return array
+     */
+    protected function getBlacklist()
+    {
+        return $this->getDisallowedFiles();
+
+    }//end getBlacklist()
+
+
+    /**
+     * Get a list of file paths to include.
+     *
+     * @since 3.9.0
+     *
+     * @return array
+     */
+    protected function getAllowedFiles()
+    {
+        $modified = [];
+
+        $cmd    = 'git diff --cached --name-only -- '.escapeshellarg($this->basedir);
+        $output = $this->exec($cmd);
+
+        $basedir = $this->basedir;
+        if (is_dir($basedir) === false) {
+            $basedir = dirname($basedir);
+        }
+
+        foreach ($output as $path) {
+            $path = Common::realpath($path);
+            if ($path === false) {
+                // Skip deleted files.
+                continue;
+            }
+
+            do {
+                $modified[$path] = true;
+                $path            = dirname($path);
+            } while ($path !== $basedir);
+        }
+
+        return $modified;
+
+    }//end getAllowedFiles()
+
+
+    /**
+     * Get a list of file paths to include.
+     *
+     * @deprecated 3.9.0 Overload the `getAllowedFiles()` method instead.
+     *
+     * @codeCoverageIgnore
+     *
+     * @return array
+     */
+    protected function getWhitelist()
+    {
+        return $this->getAllowedFiles();
+
+    }//end getWhitelist()
+
+
+    /**
+     * Execute an external command.
+     *
+     * {@internal This method is only needed to allow for mocking the return value
+     * to test the class logic.}
+     *
+     * @param string $cmd Command.
+     *
+     * @return array
+     */
+    protected function exec($cmd)
+    {
+        $output   = [];
+        $lastLine = exec($cmd, $output);
+        if ($lastLine === false) {
+            return [];
+        }
+
+        return $output;
+
+    }//end exec()
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Fixer.php

@@ -0,0 +1,867 @@
+<?php
+/**
+ * A helper class for fixing errors.
+ *
+ * Provides helper functions that act upon a token array and modify the file
+ * content.
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer;
+
+use InvalidArgumentException;
+use PHP_CodeSniffer\Exceptions\RuntimeException;
+use PHP_CodeSniffer\Files\File;
+use PHP_CodeSniffer\Util\Common;
+
+class Fixer
+{
+
+    /**
+     * Is the fixer enabled and fixing a file?
+     *
+     * Sniffs should check this value to ensure they are not
+     * doing extra processing to prepare for a fix when fixing is
+     * not required.
+     *
+     * @var boolean
+     */
+    public $enabled = false;
+
+    /**
+     * The number of times we have looped over a file.
+     *
+     * @var integer
+     */
+    public $loops = 0;
+
+    /**
+     * The file being fixed.
+     *
+     * @var \PHP_CodeSniffer\Files\File
+     */
+    private $currentFile = null;
+
+    /**
+     * The list of tokens that make up the file contents.
+     *
+     * This is a simplified list which just contains the token content and nothing
+     * else. This is the array that is updated as fixes are made, not the file's
+     * token array. Imploding this array will give you the file content back.
+     *
+     * @var array<int, string>
+     */
+    private $tokens = [];
+
+    /**
+     * A list of tokens that have already been fixed.
+     *
+     * We don't allow the same token to be fixed more than once each time
+     * through a file as this can easily cause conflicts between sniffs.
+     *
+     * @var int[]
+     */
+    private $fixedTokens = [];
+
+    /**
+     * The last value of each fixed token.
+     *
+     * If a token is being "fixed" back to its last value, the fix is
+     * probably conflicting with another.
+     *
+     * @var array<int, array<string, mixed>>
+     */
+    private $oldTokenValues = [];
+
+    /**
+     * A list of tokens that have been fixed during a changeset.
+     *
+     * All changes in changeset must be able to be applied, or else
+     * the entire changeset is rejected.
+     *
+     * @var array
+     */
+    private $changeset = [];
+
+    /**
+     * Is there an open changeset.
+     *
+     * @var boolean
+     */
+    private $inChangeset = false;
+
+    /**
+     * Is the current fixing loop in conflict?
+     *
+     * @var boolean
+     */
+    private $inConflict = false;
+
+    /**
+     * The number of fixes that have been performed.
+     *
+     * @var integer
+     */
+    private $numFixes = 0;
+
+
+    /**
+     * Starts fixing a new file.
+     *
+     * @param \PHP_CodeSniffer\Files\File $phpcsFile The file being fixed.
+     *
+     * @return void
+     */
+    public function startFile(File $phpcsFile)
+    {
+        $this->currentFile = $phpcsFile;
+        $this->numFixes    = 0;
+        $this->fixedTokens = [];
+
+        $tokens       = $phpcsFile->getTokens();
+        $this->tokens = [];
+        foreach ($tokens as $index => $token) {
+            if (isset($token['orig_content']) === true) {
+                $this->tokens[$index] = $token['orig_content'];
+            } else {
+                $this->tokens[$index] = $token['content'];
+            }
+        }
+
+    }//end startFile()
+
+
+    /**
+     * Attempt to fix the file by processing it until no fixes are made.
+     *
+     * @return boolean
+     */
+    public function fixFile()
+    {
+        $fixable = $this->currentFile->getFixableCount();
+        if ($fixable === 0) {
+            // Nothing to fix.
+            return false;
+        }
+
+        $this->enabled = true;
+
+        $this->loops = 0;
+        while ($this->loops < 50) {
+            ob_start();
+
+            // Only needed once file content has changed.
+            $contents = $this->getContents();
+
+            if (PHP_CODESNIFFER_VERBOSITY > 2) {
+                @ob_end_clean();
+                echo '---START FILE CONTENT---'.PHP_EOL;
+                $lines = explode($this->currentFile->eolChar, $contents);
+                $max   = strlen(count($lines));
+                foreach ($lines as $lineNum => $line) {
+                    $lineNum++;
+                    echo str_pad($lineNum, $max, ' ', STR_PAD_LEFT).'|'.$line.PHP_EOL;
+                }
+
+                echo '--- END FILE CONTENT ---'.PHP_EOL;
+                ob_start();
+            }
+
+            $this->inConflict = false;
+            $this->currentFile->ruleset->populateTokenListeners();
+            $this->currentFile->setContent($contents);
+            $this->currentFile->process();
+            ob_end_clean();
+
+            $this->loops++;
+
+            if (PHP_CODESNIFFER_CBF === true && PHP_CODESNIFFER_VERBOSITY > 0) {
+                echo "\r".str_repeat(' ', 80)."\r";
+                echo "\t=> Fixing file: $this->numFixes/$fixable violations remaining [made $this->loops pass";
+                if ($this->loops > 1) {
+                    echo 'es';
+                }
+
+                echo ']... ';
+                if (PHP_CODESNIFFER_VERBOSITY > 1) {
+                    echo PHP_EOL;
+                }
+            }
+
+            if ($this->numFixes === 0 && $this->inConflict === false) {
+                // Nothing left to do.
+                break;
+            } else if (PHP_CODESNIFFER_VERBOSITY > 1) {
+                echo "\t* fixed $this->numFixes violations, starting loop ".($this->loops + 1).' *'.PHP_EOL;
+            }
+        }//end while
+
+        $this->enabled = false;
+
+        if ($this->numFixes > 0 || $this->inConflict === true) {
+            if (PHP_CODESNIFFER_VERBOSITY > 1) {
+                if (ob_get_level() > 0) {
+                    ob_end_clean();
+                }
+
+                echo "\t*** Reached maximum number of loops with $this->numFixes violations left unfixed ***".PHP_EOL;
+                ob_start();
+            }
+
+            return false;
+        }
+
+        return true;
+
+    }//end fixFile()
+
+
+    /**
+     * Generates a text diff of the original file and the new content.
+     *
+     * @param string  $filePath Optional file path to diff the file against.
+     *                          If not specified, the original version of the
+     *                          file will be used.
+     * @param boolean $colors   Print coloured output or not.
+     *
+     * @return string
+     *
+     * @throws \PHP_CodeSniffer\Exceptions\RuntimeException When the diff command fails.
+     */
+    public function generateDiff($filePath=null, $colors=true)
+    {
+        if ($filePath === null) {
+            $filePath = $this->currentFile->getFilename();
+        }
+
+        $cwd = getcwd().DIRECTORY_SEPARATOR;
+        if (strpos($filePath, $cwd) === 0) {
+            $filename = substr($filePath, strlen($cwd));
+        } else {
+            $filename = $filePath;
+        }
+
+        $contents = $this->getContents();
+
+        $tempName  = tempnam(sys_get_temp_dir(), 'phpcs-fixer');
+        $fixedFile = fopen($tempName, 'w');
+        fwrite($fixedFile, $contents);
+
+        // We must use something like shell_exec() or proc_open() because whitespace at the end
+        // of lines is critical to diff files.
+        // Using proc_open() instead of shell_exec improves performance on Windows significantly,
+        // while the results are the same (though more code is needed to get the results).
+        // This is specifically due to proc_open allowing to set the "bypass_shell" option.
+        $filename = escapeshellarg($filename);
+        $cmd      = "diff -u -L$filename -LPHP_CodeSniffer $filename \"$tempName\"";
+
+        // Stream 0 = STDIN, 1 = STDOUT, 2 = STDERR.
+        $descriptorspec = [
+            0 => [
+                'pipe',
+                'r',
+            ],
+            1 => [
+                'pipe',
+                'w',
+            ],
+            2 => [
+                'pipe',
+                'w',
+            ],
+        ];
+
+        $options = null;
+        if (stripos(PHP_OS, 'WIN') === 0) {
+            $options = ['bypass_shell' => true];
+        }
+
+        $process = proc_open($cmd, $descriptorspec, $pipes, $cwd, null, $options);
+        if (is_resource($process) === false) {
+            throw new RuntimeException('Could not obtain a resource to execute the diff command.');
+        }
+
+        // We don't need these.
+        fclose($pipes[0]);
+        fclose($pipes[2]);
+
+        // Stdout will contain the actual diff.
+        $diff = stream_get_contents($pipes[1]);
+        fclose($pipes[1]);
+
+        proc_close($process);
+
+        fclose($fixedFile);
+        if (is_file($tempName) === true) {
+            unlink($tempName);
+        }
+
+        if ($diff === false || $diff === '') {
+            return '';
+        }
+
+        if ($colors === false) {
+            return $diff;
+        }
+
+        $diffLines = explode(PHP_EOL, $diff);
+        if (count($diffLines) === 1) {
+            // Seems to be required for cygwin.
+            $diffLines = explode("\n", $diff);
+        }
+
+        $diff = [];
+        foreach ($diffLines as $line) {
+            if (isset($line[0]) === true) {
+                switch ($line[0]) {
+                case '-':
+                    $diff[] = "\033[31m$line\033[0m";
+                    break;
+                case '+':
+                    $diff[] = "\033[32m$line\033[0m";
+                    break;
+                default:
+                    $diff[] = $line;
+                }
+            }
+        }
+
+        $diff = implode(PHP_EOL, $diff);
+
+        return $diff;
+
+    }//end generateDiff()
+
+
+    /**
+     * Get a count of fixes that have been performed on the file.
+     *
+     * This value is reset every time a new file is started, or an existing
+     * file is restarted.
+     *
+     * @return int
+     */
+    public function getFixCount()
+    {
+        return $this->numFixes;
+
+    }//end getFixCount()
+
+
+    /**
+     * Get the current content of the file, as a string.
+     *
+     * @return string
+     */
+    public function getContents()
+    {
+        $contents = implode($this->tokens);
+        return $contents;
+
+    }//end getContents()
+
+
+    /**
+     * Get the current fixed content of a token.
+     *
+     * This function takes changesets into account so should be used
+     * instead of directly accessing the token array.
+     *
+     * @param int $stackPtr The position of the token in the token stack.
+     *
+     * @return string
+     */
+    public function getTokenContent($stackPtr)
+    {
+        if ($this->inChangeset === true
+            && isset($this->changeset[$stackPtr]) === true
+        ) {
+            return $this->changeset[$stackPtr];
+        } else {
+            return $this->tokens[$stackPtr];
+        }
+
+    }//end getTokenContent()
+
+
+    /**
+     * Start recording actions for a changeset.
+     *
+     * @return void|false
+     */
+    public function beginChangeset()
+    {
+        if ($this->inConflict === true) {
+            return false;
+        }
+
+        if (PHP_CODESNIFFER_VERBOSITY > 1) {
+            $bt = debug_backtrace(DEBUG_BACKTRACE_IGNORE_ARGS);
+            if ($bt[1]['class'] === __CLASS__) {
+                $sniff = 'Fixer';
+            } else {
+                $sniff = $this->getSniffCodeForDebug($bt[1]['class']);
+            }
+
+            $line = $bt[0]['line'];
+
+            @ob_end_clean();
+            echo "\t=> Changeset started by $sniff:$line".PHP_EOL;
+            ob_start();
+        }
+
+        $this->changeset   = [];
+        $this->inChangeset = true;
+
+    }//end beginChangeset()
+
+
+    /**
+     * Stop recording actions for a changeset, and apply logged changes.
+     *
+     * @return boolean
+     */
+    public function endChangeset()
+    {
+        if ($this->inConflict === true) {
+            return false;
+        }
+
+        $this->inChangeset = false;
+
+        $success = true;
+        $applied = [];
+        foreach ($this->changeset as $stackPtr => $content) {
+            $success = $this->replaceToken($stackPtr, $content);
+            if ($success === false) {
+                break;
+            } else {
+                $applied[] = $stackPtr;
+            }
+        }
+
+        if ($success === false) {
+            // Rolling back all changes.
+            foreach ($applied as $stackPtr) {
+                $this->revertToken($stackPtr);
+            }
+
+            if (PHP_CODESNIFFER_VERBOSITY > 1) {
+                @ob_end_clean();
+                echo "\t=> Changeset failed to apply".PHP_EOL;
+                ob_start();
+            }
+        } else if (PHP_CODESNIFFER_VERBOSITY > 1) {
+            $fixes = count($this->changeset);
+            @ob_end_clean();
+            echo "\t=> Changeset ended: $fixes changes applied".PHP_EOL;
+            ob_start();
+        }
+
+        $this->changeset = [];
+        return true;
+
+    }//end endChangeset()
+
+
+    /**
+     * Stop recording actions for a changeset, and discard logged changes.
+     *
+     * @return void
+     */
+    public function rollbackChangeset()
+    {
+        $this->inChangeset = false;
+        $this->inConflict  = false;
+
+        if (empty($this->changeset) === false) {
+            if (PHP_CODESNIFFER_VERBOSITY > 1) {
+                $bt = debug_backtrace();
+                if ($bt[1]['class'] === 'PHP_CodeSniffer\Fixer') {
+                    $sniff = $bt[2]['class'];
+                    $line  = $bt[1]['line'];
+                } else {
+                    $sniff = $bt[1]['class'];
+                    $line  = $bt[0]['line'];
+                }
+
+                $sniff = $this->getSniffCodeForDebug($sniff);
+
+                $numChanges = count($this->changeset);
+
+                @ob_end_clean();
+                echo "\t\tR: $sniff:$line rolled back the changeset ($numChanges changes)".PHP_EOL;
+                echo "\t=> Changeset rolled back".PHP_EOL;
+                ob_start();
+            }
+
+            $this->changeset = [];
+        }//end if
+
+    }//end rollbackChangeset()
+
+
+    /**
+     * Replace the entire contents of a token.
+     *
+     * @param int    $stackPtr The position of the token in the token stack.
+     * @param string $content  The new content of the token.
+     *
+     * @return bool If the change was accepted.
+     */
+    public function replaceToken($stackPtr, $content)
+    {
+        if ($this->inConflict === true) {
+            return false;
+        }
+
+        if ($this->inChangeset === false
+            && isset($this->fixedTokens[$stackPtr]) === true
+        ) {
+            $indent = "\t";
+            if (empty($this->changeset) === false) {
+                $indent .= "\t";
+            }
+
+            if (PHP_CODESNIFFER_VERBOSITY > 1) {
+                @ob_end_clean();
+                echo "$indent* token $stackPtr has already been modified, skipping *".PHP_EOL;
+                ob_start();
+            }
+
+            return false;
+        }
+
+        if (PHP_CODESNIFFER_VERBOSITY > 1) {
+            $bt = debug_backtrace(DEBUG_BACKTRACE_IGNORE_ARGS);
+            if ($bt[1]['class'] === 'PHP_CodeSniffer\Fixer') {
+                $sniff = $bt[2]['class'];
+                $line  = $bt[1]['line'];
+            } else {
+                $sniff = $bt[1]['class'];
+                $line  = $bt[0]['line'];
+            }
+
+            $sniff = $this->getSniffCodeForDebug($sniff);
+
+            $tokens     = $this->currentFile->getTokens();
+            $type       = $tokens[$stackPtr]['type'];
+            $tokenLine  = $tokens[$stackPtr]['line'];
+            $oldContent = Common::prepareForOutput($this->tokens[$stackPtr]);
+            $newContent = Common::prepareForOutput($content);
+            if (trim($this->tokens[$stackPtr]) === '' && isset($this->tokens[($stackPtr + 1)]) === true) {
+                // Add some context for whitespace only changes.
+                $append      = Common::prepareForOutput($this->tokens[($stackPtr + 1)]);
+                $oldContent .= $append;
+                $newContent .= $append;
+            }
+        }//end if
+
+        if ($this->inChangeset === true) {
+            $this->changeset[$stackPtr] = $content;
+
+            if (PHP_CODESNIFFER_VERBOSITY > 1) {
+                @ob_end_clean();
+                echo "\t\tQ: $sniff:$line replaced token $stackPtr ($type on line $tokenLine) \"$oldContent\" => \"$newContent\"".PHP_EOL;
+                ob_start();
+            }
+
+            return true;
+        }
+
+        if (isset($this->oldTokenValues[$stackPtr]) === false) {
+            $this->oldTokenValues[$stackPtr] = [
+                'curr' => $content,
+                'prev' => $this->tokens[$stackPtr],
+                'loop' => $this->loops,
+            ];
+        } else {
+            if ($this->oldTokenValues[$stackPtr]['prev'] === $content
+                && $this->oldTokenValues[$stackPtr]['loop'] === ($this->loops - 1)
+            ) {
+                if (PHP_CODESNIFFER_VERBOSITY > 1) {
+                    $indent = "\t";
+                    if (empty($this->changeset) === false) {
+                        $indent .= "\t";
+                    }
+
+                    $loop = $this->oldTokenValues[$stackPtr]['loop'];
+
+                    @ob_end_clean();
+                    echo "$indent**** $sniff:$line has possible conflict with another sniff on loop $loop; caused by the following change ****".PHP_EOL;
+                    echo "$indent**** replaced token $stackPtr ($type on line $tokenLine) \"$oldContent\" => \"$newContent\" ****".PHP_EOL;
+                }
+
+                if ($this->oldTokenValues[$stackPtr]['loop'] >= ($this->loops - 1)) {
+                    $this->inConflict = true;
+                    if (PHP_CODESNIFFER_VERBOSITY > 1) {
+                        echo "$indent**** ignoring all changes until next loop ****".PHP_EOL;
+                    }
+                }
+
+                if (PHP_CODESNIFFER_VERBOSITY > 1) {
+                    ob_start();
+                }
+
+                return false;
+            }//end if
+
+            $this->oldTokenValues[$stackPtr]['prev'] = $this->oldTokenValues[$stackPtr]['curr'];
+            $this->oldTokenValues[$stackPtr]['curr'] = $content;
+            $this->oldTokenValues[$stackPtr]['loop'] = $this->loops;
+        }//end if
+
+        $this->fixedTokens[$stackPtr] = $this->tokens[$stackPtr];
+        $this->tokens[$stackPtr]      = $content;
+        $this->numFixes++;
+
+        if (PHP_CODESNIFFER_VERBOSITY > 1) {
+            $indent = "\t";
+            if (empty($this->changeset) === false) {
+                $indent .= "\tA: ";
+            }
+
+            if (ob_get_level() > 0) {
+                ob_end_clean();
+            }
+
+            echo "$indent$sniff:$line replaced token $stackPtr ($type on line $tokenLine) \"$oldContent\" => \"$newContent\"".PHP_EOL;
+            ob_start();
+        }
+
+        return true;
+
+    }//end replaceToken()
+
+
+    /**
+     * Reverts the previous fix made to a token.
+     *
+     * @param int $stackPtr The position of the token in the token stack.
+     *
+     * @return bool If a change was reverted.
+     */
+    public function revertToken($stackPtr)
+    {
+        if (isset($this->fixedTokens[$stackPtr]) === false) {
+            return false;
+        }
+
+        if (PHP_CODESNIFFER_VERBOSITY > 1) {
+            $bt = debug_backtrace(DEBUG_BACKTRACE_IGNORE_ARGS);
+            if ($bt[1]['class'] === 'PHP_CodeSniffer\Fixer') {
+                $sniff = $bt[2]['class'];
+                $line  = $bt[1]['line'];
+            } else {
+                $sniff = $bt[1]['class'];
+                $line  = $bt[0]['line'];
+            }
+
+            $sniff = $this->getSniffCodeForDebug($sniff);
+
+            $tokens     = $this->currentFile->getTokens();
+            $type       = $tokens[$stackPtr]['type'];
+            $tokenLine  = $tokens[$stackPtr]['line'];
+            $oldContent = Common::prepareForOutput($this->tokens[$stackPtr]);
+            $newContent = Common::prepareForOutput($this->fixedTokens[$stackPtr]);
+            if (trim($this->tokens[$stackPtr]) === '' && isset($tokens[($stackPtr + 1)]) === true) {
+                // Add some context for whitespace only changes.
+                $append      = Common::prepareForOutput($this->tokens[($stackPtr + 1)]);
+                $oldContent .= $append;
+                $newContent .= $append;
+            }
+        }//end if
+
+        $this->tokens[$stackPtr] = $this->fixedTokens[$stackPtr];
+        unset($this->fixedTokens[$stackPtr]);
+        $this->numFixes--;
+
+        if (PHP_CODESNIFFER_VERBOSITY > 1) {
+            $indent = "\t";
+            if (empty($this->changeset) === false) {
+                $indent .= "\tR: ";
+            }
+
+            @ob_end_clean();
+            echo "$indent$sniff:$line reverted token $stackPtr ($type on line $tokenLine) \"$oldContent\" => \"$newContent\"".PHP_EOL;
+            ob_start();
+        }
+
+        return true;
+
+    }//end revertToken()
+
+
+    /**
+     * Replace the content of a token with a part of its current content.
+     *
+     * @param int $stackPtr The position of the token in the token stack.
+     * @param int $start    The first character to keep.
+     * @param int $length   The number of characters to keep. If NULL, the content of
+     *                      the token from $start to the end of the content is kept.
+     *
+     * @return bool If the change was accepted.
+     */
+    public function substrToken($stackPtr, $start, $length=null)
+    {
+        $current = $this->getTokenContent($stackPtr);
+
+        if ($length === null) {
+            $newContent = substr($current, $start);
+        } else {
+            $newContent = substr($current, $start, $length);
+        }
+
+        return $this->replaceToken($stackPtr, $newContent);
+
+    }//end substrToken()
+
+
+    /**
+     * Adds a newline to end of a token's content.
+     *
+     * @param int $stackPtr The position of the token in the token stack.
+     *
+     * @return bool If the change was accepted.
+     */
+    public function addNewline($stackPtr)
+    {
+        $current = $this->getTokenContent($stackPtr);
+        return $this->replaceToken($stackPtr, $current.$this->currentFile->eolChar);
+
+    }//end addNewline()
+
+
+    /**
+     * Adds a newline to the start of a token's content.
+     *
+     * @param int $stackPtr The position of the token in the token stack.
+     *
+     * @return bool If the change was accepted.
+     */
+    public function addNewlineBefore($stackPtr)
+    {
+        $current = $this->getTokenContent($stackPtr);
+        return $this->replaceToken($stackPtr, $this->currentFile->eolChar.$current);
+
+    }//end addNewlineBefore()
+
+
+    /**
+     * Adds content to the end of a token's current content.
+     *
+     * @param int    $stackPtr The position of the token in the token stack.
+     * @param string $content  The content to add.
+     *
+     * @return bool If the change was accepted.
+     */
+    public function addContent($stackPtr, $content)
+    {
+        $current = $this->getTokenContent($stackPtr);
+        return $this->replaceToken($stackPtr, $current.$content);
+
+    }//end addContent()
+
+
+    /**
+     * Adds content to the start of a token's current content.
+     *
+     * @param int    $stackPtr The position of the token in the token stack.
+     * @param string $content  The content to add.
+     *
+     * @return bool If the change was accepted.
+     */
+    public function addContentBefore($stackPtr, $content)
+    {
+        $current = $this->getTokenContent($stackPtr);
+        return $this->replaceToken($stackPtr, $content.$current);
+
+    }//end addContentBefore()
+
+
+    /**
+     * Adjust the indent of a code block.
+     *
+     * @param int $start  The position of the token in the token stack
+     *                    to start adjusting the indent from.
+     * @param int $end    The position of the token in the token stack
+     *                    to end adjusting the indent.
+     * @param int $change The number of spaces to adjust the indent by
+     *                    (positive or negative).
+     *
+     * @return void
+     */
+    public function changeCodeBlockIndent($start, $end, $change)
+    {
+        $tokens = $this->currentFile->getTokens();
+
+        $baseIndent = '';
+        if ($change > 0) {
+            $baseIndent = str_repeat(' ', $change);
+        }
+
+        $useChangeset = false;
+        if ($this->inChangeset === false) {
+            $this->beginChangeset();
+            $useChangeset = true;
+        }
+
+        for ($i = $start; $i <= $end; $i++) {
+            if ($tokens[$i]['column'] !== 1
+                || $tokens[($i + 1)]['line'] !== $tokens[$i]['line']
+            ) {
+                continue;
+            }
+
+            $length = 0;
+            if ($tokens[$i]['code'] === T_WHITESPACE
+                || $tokens[$i]['code'] === T_DOC_COMMENT_WHITESPACE
+            ) {
+                $length = $tokens[$i]['length'];
+
+                $padding = ($length + $change);
+                if ($padding > 0) {
+                    $padding = str_repeat(' ', $padding);
+                } else {
+                    $padding = '';
+                }
+
+                $newContent = $padding.ltrim($tokens[$i]['content']);
+            } else {
+                $newContent = $baseIndent.$tokens[$i]['content'];
+            }
+
+            $this->replaceToken($i, $newContent);
+        }//end for
+
+        if ($useChangeset === true) {
+            $this->endChangeset();
+        }
+
+    }//end changeCodeBlockIndent()
+
+
+    /**
+     * Get the sniff code for the current sniff or the class name if the passed class is not a sniff.
+     *
+     * @param string $className Class name.
+     *
+     * @return string
+     */
+    private function getSniffCodeForDebug($className)
+    {
+        try {
+            $sniffCode = Common::getSniffCode($className);
+            return $sniffCode;
+        } catch (InvalidArgumentException $e) {
+            // Sniff code could not be determined. This may be an abstract sniff class or a helper class.
+            return $className;
+        }
+
+    }//end getSniffCodeForDebug()
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Generators/Generator.php

@@ -0,0 +1,143 @@
+<?php
+/**
+ * The base class for all PHP_CodeSniffer documentation generators.
+ *
+ * Documentation generators are used to print documentation about code sniffs
+ * in a standard.
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @author    Juliette Reinders Folmer <phpcs_nospam@adviesenzo.nl>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @copyright 2024 PHPCSStandards and contributors
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Generators;
+
+use DOMDocument;
+use DOMNode;
+use PHP_CodeSniffer\Autoload;
+use PHP_CodeSniffer\Ruleset;
+
+abstract class Generator
+{
+
+    /**
+     * The ruleset used for the run.
+     *
+     * @var \PHP_CodeSniffer\Ruleset
+     */
+    public $ruleset = null;
+
+    /**
+     * XML documentation files used to produce the final output.
+     *
+     * @var string[]
+     */
+    public $docFiles = [];
+
+
+    /**
+     * Constructs a doc generator.
+     *
+     * @param \PHP_CodeSniffer\Ruleset $ruleset The ruleset used for the run.
+     *
+     * @see generate()
+     */
+    public function __construct(Ruleset $ruleset)
+    {
+        $this->ruleset = $ruleset;
+
+        $find    = [
+            DIRECTORY_SEPARATOR.'Sniffs'.DIRECTORY_SEPARATOR,
+            'Sniff.php',
+        ];
+        $replace = [
+            DIRECTORY_SEPARATOR.'Docs'.DIRECTORY_SEPARATOR,
+            'Standard.xml',
+        ];
+
+        foreach ($ruleset->sniffs as $className => $sniffClass) {
+            $file    = Autoload::getLoadedFileName($className);
+            $docFile = str_replace($find, $replace, $file);
+
+            if (is_file($docFile) === true) {
+                $this->docFiles[] = $docFile;
+            }
+        }
+
+        // Always present the docs in a consistent alphabetical order.
+        sort($this->docFiles, (SORT_NATURAL | SORT_FLAG_CASE));
+
+    }//end __construct()
+
+
+    /**
+     * Retrieves the title of the sniff from the DOMNode supplied.
+     *
+     * @param \DOMNode $doc The DOMNode object for the sniff.
+     *                      It represents the "documentation" tag in the XML
+     *                      standard file.
+     *
+     * @return string
+     */
+    protected function getTitle(DOMNode $doc)
+    {
+        $title = $doc->getAttribute('title');
+
+        if (empty($title) === true) {
+            // Fall back to the sniff name if no title was supplied.
+            $fileName  = $doc->ownerDocument->documentURI;
+            $lastSlash = strrpos($fileName, '/');
+            if (is_int($lastSlash) === true) {
+                // Get the sniff name without "Standard.xml".
+                $title = substr($fileName, ($lastSlash + 1), -12);
+
+                // Split the sniff name to individual words.
+                $title = preg_replace('`[-._]|(?<=[a-z])(?=[A-Z])|(?<=[A-Z])(?=[A-Z][a-z])`', '$1 $2', $title);
+            }
+        }
+
+        return $title;
+
+    }//end getTitle()
+
+
+    /**
+     * Generates the documentation for a standard.
+     *
+     * It's probably wise for doc generators to override this method so they
+     * have control over how the docs are produced. Otherwise, the processSniff
+     * method should be overridden to output content for each sniff.
+     *
+     * @return void
+     * @see    processSniff()
+     */
+    public function generate()
+    {
+        foreach ($this->docFiles as $file) {
+            $doc = new DOMDocument();
+            $doc->load($file);
+            $documentation = $doc->getElementsByTagName('documentation')->item(0);
+            $this->processSniff($documentation);
+        }
+
+    }//end generate()
+
+
+    /**
+     * Process the documentation for a single sniff.
+     *
+     * Doc generators must implement this function to produce output.
+     *
+     * @param \DOMNode $doc The DOMNode object for the sniff.
+     *                      It represents the "documentation" tag in the XML
+     *                      standard file.
+     *
+     * @return void
+     * @see    generate()
+     */
+    abstract protected function processSniff(DOMNode $doc);
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Generators/HTML.php

@@ -0,0 +1,564 @@
+<?php
+/**
+ * A doc generator that outputs documentation in one big HTML file.
+ *
+ * Output is in one large HTML file and is designed for you to style with
+ * your own stylesheet. It contains a table of contents at the top with anchors
+ * to each sniff.
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @author    Juliette Reinders Folmer <phpcs_nospam@adviesenzo.nl>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @copyright 2024 PHPCSStandards and contributors
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Generators;
+
+use DOMDocument;
+use DOMElement;
+use DOMNode;
+use PHP_CodeSniffer\Config;
+
+class HTML extends Generator
+{
+
+    /**
+     * Stylesheet for the HTML output.
+     *
+     * @var string
+     */
+    const STYLESHEET = '<style>
+        body {
+            background-color: #FFFFFF;
+            font-size: 14px;
+            font-family: Arial, Helvetica, sans-serif;
+            color: #000000;
+        }
+
+        h1 {
+            color: #666666;
+            font-size: 20px;
+            font-weight: bold;
+            margin-top: 0px;
+            background-color: #E6E7E8;
+            padding: 20px;
+            border: 1px solid #BBBBBB;
+        }
+
+        h2 {
+            color: #00A5E3;
+            font-size: 16px;
+            font-weight: normal;
+            margin-top: 50px;
+        }
+
+        h2 a.sniffanchor,
+        h2 a.sniffanchor {
+            color: #006C95;
+            opacity: 0;
+            padding: 0 3px;
+            text-decoration: none;
+            font-weight: bold;
+        }
+        h2:hover a.sniffanchor,
+        h2:focus a.sniffanchor {
+            opacity: 1;
+        }
+
+        .code-comparison {
+            width: 100%;
+        }
+
+        .code-comparison td {
+            border: 1px solid #CCCCCC;
+        }
+
+        .code-comparison-title, .code-comparison-code {
+            font-family: Arial, Helvetica, sans-serif;
+            font-size: 12px;
+            color: #000000;
+            vertical-align: top;
+            padding: 4px;
+            width: 50%;
+            background-color: #F1F1F1;
+            line-height: 15px;
+        }
+
+        .code-comparison-title {
+            text-align: left;
+            font-weight: 600;
+        }
+
+        .code-comparison-code {
+            font-family: Courier;
+            background-color: #F9F9F9;
+        }
+
+        .code-comparison-highlight {
+            background-color: #DDF1F7;
+            border: 1px solid #00A5E3;
+            line-height: 15px;
+        }
+
+        .tag-line {
+            text-align: center;
+            width: 100%;
+            margin-top: 30px;
+            font-size: 12px;
+        }
+
+        .tag-line a {
+            color: #000000;
+        }
+    </style>';
+
+    /**
+     * List of seen slugified anchors to ensure uniqueness.
+     *
+     * @var array<string, true>
+     */
+    private $seenAnchors = [];
+
+
+    /**
+     * Generates the documentation for a standard.
+     *
+     * @return void
+     * @see    processSniff()
+     */
+    public function generate()
+    {
+        if (empty($this->docFiles) === true) {
+            return;
+        }
+
+        ob_start();
+        parent::generate();
+
+        $content = ob_get_contents();
+        ob_end_clean();
+
+        // Clear anchor cache after Documentation generation.
+        // The anchor generation for the TOC anchor links will use the same logic, so should end up with the same unique slugs.
+        $this->seenAnchors = [];
+
+        if (trim($content) !== '') {
+            echo $this->getFormattedHeader();
+            echo $this->getFormattedToc();
+            echo $content;
+            echo $this->getFormattedFooter();
+        }
+
+    }//end generate()
+
+
+    /**
+     * Print the header of the HTML page.
+     *
+     * @deprecated 3.12.0 Use HTML::getFormattedHeader() instead.
+     *
+     * @codeCoverageIgnore
+     *
+     * @return void
+     */
+    protected function printHeader()
+    {
+        trigger_error(
+            'The '.__METHOD__.'() method is deprecated. Use "echo '.__CLASS__.'::getFormattedHeader()" instead.',
+            E_USER_DEPRECATED
+        );
+
+        echo $this->getFormattedHeader();
+
+    }//end printHeader()
+
+
+    /**
+     * Format the header of the HTML page.
+     *
+     * @since 3.12.0 Replaces the deprecated HTML::printHeader() method.
+     *
+     * @return string
+     */
+    protected function getFormattedHeader()
+    {
+        $standard = $this->ruleset->name;
+        $output   = sprintf(
+            '<html>
+ <head>
+  <title>%1$s Coding Standards</title>
+  %2$s
+ </head>
+ <body>
+  <h1>%1$s Coding Standards</h1>',
+            $standard,
+            self::STYLESHEET
+        );
+
+        // Use the correct line endings based on the OS.
+        return str_replace("\n", PHP_EOL, $output).PHP_EOL;
+
+    }//end getFormattedHeader()
+
+
+    /**
+     * Print the table of contents for the standard.
+     *
+     * @deprecated 3.12.0 Use HTML::getFormattedToc() instead.
+     *
+     * @codeCoverageIgnore
+     *
+     * @return void
+     */
+    protected function printToc()
+    {
+        trigger_error(
+            'The '.__METHOD__.'() method is deprecated. Use "echo '.__CLASS__.'::getFormattedToc()" instead.',
+            E_USER_DEPRECATED
+        );
+
+        echo $this->getFormattedToc();
+
+    }//end printToc()
+
+
+    /**
+     * Format the table of contents for the standard.
+     *
+     * The TOC is just an unordered list of bookmarks to sniffs on the page.
+     *
+     * @since 3.12.0 Replaces the deprecated HTML::printToc() method.
+     *
+     * @return string
+     */
+    protected function getFormattedToc()
+    {
+        // Only show a TOC when there are two or more docs to display.
+        if (count($this->docFiles) < 2) {
+            return '';
+        }
+
+        $output  = '  <h2>Table of Contents</h2>'.PHP_EOL;
+        $output .= '  <ul class="toc">'.PHP_EOL;
+
+        $listItemTemplate = '   <li><a href="#%s">%s</a></li>'.PHP_EOL;
+
+        foreach ($this->docFiles as $file) {
+            $doc = new DOMDocument();
+            $doc->load($file);
+            $documentation = $doc->getElementsByTagName('documentation')->item(0);
+            $title         = $this->getTitle($documentation);
+            $output       .= sprintf($listItemTemplate, $this->titleToAnchor($title), $title);
+        }
+
+        $output .= '  </ul>'.PHP_EOL;
+
+        return $output;
+
+    }//end getFormattedToc()
+
+
+    /**
+     * Print the footer of the HTML page.
+     *
+     * @deprecated 3.12.0 Use HTML::getFormattedFooter() instead.
+     *
+     * @codeCoverageIgnore
+     *
+     * @return void
+     */
+    protected function printFooter()
+    {
+        trigger_error(
+            'The '.__METHOD__.'() method is deprecated. Use "echo '.__CLASS__.'::getFormattedFooter()" instead.',
+            E_USER_DEPRECATED
+        );
+
+        echo $this->getFormattedFooter();
+
+    }//end printFooter()
+
+
+    /**
+     * Format the footer of the HTML page.
+     *
+     * @since 3.12.0 Replaces the deprecated HTML::printFooter() method.
+     *
+     * @return string
+     */
+    protected function getFormattedFooter()
+    {
+        // Turn off errors so we don't get timezone warnings if people
+        // don't have their timezone set.
+        $errorLevel = error_reporting(0);
+        $output     = sprintf(
+            '  <div class="tag-line">Documentation generated on %s by <a href="https://github.com/PHPCSStandards/PHP_CodeSniffer">PHP_CodeSniffer %s</a></div>
+ </body>
+</html>',
+            date('r'),
+            Config::VERSION
+        );
+        error_reporting($errorLevel);
+
+        // Use the correct line endings based on the OS.
+        return str_replace("\n", PHP_EOL, $output).PHP_EOL;
+
+    }//end getFormattedFooter()
+
+
+    /**
+     * Process the documentation for a single sniff.
+     *
+     * @param \DOMNode $doc The DOMNode object for the sniff.
+     *                      It represents the "documentation" tag in the XML
+     *                      standard file.
+     *
+     * @return void
+     */
+    public function processSniff(DOMNode $doc)
+    {
+        $content = '';
+        foreach ($doc->childNodes as $node) {
+            if ($node->nodeName === 'standard') {
+                $content .= $this->getFormattedTextBlock($node);
+            } else if ($node->nodeName === 'code_comparison') {
+                $content .= $this->getFormattedCodeComparisonBlock($node);
+            }
+        }
+
+        if (trim($content) !== '') {
+            $title = $this->getTitle($doc);
+            printf(
+                '  <h2 id="%1$s">%2$s<a class="sniffanchor" href="#%1$s"> &sect; </a></h2>'.PHP_EOL,
+                $this->titleToAnchor($title),
+                $title
+            );
+            echo $content;
+        }
+
+    }//end processSniff()
+
+
+    /**
+     * Transform a title to a string which can be used as an HTML anchor.
+     *
+     * @param string $title The title.
+     *
+     * @since 3.12.0
+     *
+     * @return string
+     */
+    private function titleToAnchor($title)
+    {
+        // Slugify the text.
+        $title = strtolower($title);
+        $title = preg_replace('`[^a-z0-9\._-]`', '-', $title);
+
+        if (isset($this->seenAnchors[$title]) === true) {
+            // Try to find a unique anchor for this title.
+            for ($i = 2; (isset($this->seenAnchors[$title.'-'.$i]) === true); $i++);
+            $title .= '-'.$i;
+        }
+
+        // Add to "seen" list.
+        $this->seenAnchors[$title] = true;
+
+        return $title;
+
+    }//end titleToAnchor()
+
+
+    /**
+     * Print a text block found in a standard.
+     *
+     * @param \DOMNode $node The DOMNode object for the text block.
+     *
+     * @deprecated 3.12.0 Use HTML::getFormattedTextBlock() instead.
+     *
+     * @codeCoverageIgnore
+     *
+     * @return void
+     */
+    protected function printTextBlock(DOMNode $node)
+    {
+        trigger_error(
+            'The '.__METHOD__.'() method is deprecated. Use "echo '.__CLASS__.'::getFormattedTextBlock()" instead.',
+            E_USER_DEPRECATED
+        );
+
+        echo $this->getFormattedTextBlock($node);
+
+    }//end printTextBlock()
+
+
+    /**
+     * Format a text block found in a standard.
+     *
+     * @param \DOMNode $node The DOMNode object for the text block.
+     *
+     * @since 3.12.0 Replaces the deprecated HTML::printTextBlock() method.
+     *
+     * @return string
+     */
+    protected function getFormattedTextBlock(DOMNode $node)
+    {
+        $content = $node->nodeValue;
+        if (empty($content) === true) {
+            return '';
+        }
+
+        $content = trim($content);
+        $content = htmlspecialchars($content, (ENT_QUOTES | ENT_SUBSTITUTE | ENT_HTML401));
+
+        // Allow only em tags.
+        $content = str_replace('&lt;em&gt;', '<em>', $content);
+        $content = str_replace('&lt;/em&gt;', '</em>', $content);
+
+        $nodeLines = explode("\n", $content);
+        $lineCount = count($nodeLines);
+        $lines     = [];
+
+        for ($i = 0; $i < $lineCount; $i++) {
+            $currentLine = trim($nodeLines[$i]);
+
+            if (isset($nodeLines[($i + 1)]) === false) {
+                // We're at the end of the text, just add the line.
+                $lines[] = $currentLine;
+            } else {
+                $nextLine = trim($nodeLines[($i + 1)]);
+                if ($nextLine === '') {
+                    // Next line is a blank line, end the paragraph and start a new one.
+                    // Also skip over the blank line.
+                    $lines[] = $currentLine.'</p>'.PHP_EOL.'  <p class="text">';
+                    ++$i;
+                } else {
+                    // Next line is not blank, so just add a line break.
+                    $lines[] = $currentLine.'<br/>'.PHP_EOL;
+                }
+            }
+        }
+
+        return '  <p class="text">'.implode('', $lines).'</p>'.PHP_EOL;
+
+    }//end getFormattedTextBlock()
+
+
+    /**
+     * Print a code comparison block found in a standard.
+     *
+     * @param \DOMNode $node The DOMNode object for the code comparison block.
+     *
+     * @deprecated 3.12.0 Use HTML::getFormattedCodeComparisonBlock() instead.
+     *
+     * @codeCoverageIgnore
+     *
+     * @return void
+     */
+    protected function printCodeComparisonBlock(DOMNode $node)
+    {
+        trigger_error(
+            'The '.__METHOD__.'() method is deprecated. Use "echo '.__CLASS__.'::getFormattedCodeComparisonBlock()" instead.',
+            E_USER_DEPRECATED
+        );
+
+        echo $this->getFormattedCodeComparisonBlock($node);
+
+    }//end printCodeComparisonBlock()
+
+
+    /**
+     * Format a code comparison block found in a standard.
+     *
+     * @param \DOMNode $node The DOMNode object for the code comparison block.
+     *
+     * @since 3.12.0 Replaces the deprecated HTML::printCodeComparisonBlock() method.
+     *
+     * @return string
+     */
+    protected function getFormattedCodeComparisonBlock(DOMNode $node)
+    {
+        $codeBlocks    = $node->getElementsByTagName('code');
+        $firstCodeElm  = $codeBlocks->item(0);
+        $secondCodeElm = $codeBlocks->item(1);
+
+        if (isset($firstCodeElm, $secondCodeElm) === false) {
+            // Missing at least one code block.
+            return '';
+        }
+
+        $firstTitle = $this->formatCodeTitle($firstCodeElm);
+        $first      = $this->formatCodeSample($firstCodeElm);
+
+        $secondTitle = $this->formatCodeTitle($secondCodeElm);
+        $second      = $this->formatCodeSample($secondCodeElm);
+
+        $titleRow = '';
+        if ($firstTitle !== '' || $secondTitle !== '') {
+            $titleRow .= '   <tr>'.PHP_EOL;
+            $titleRow .= "    <th class=\"code-comparison-title\">$firstTitle</th>".PHP_EOL;
+            $titleRow .= "    <th class=\"code-comparison-title\">$secondTitle</th>".PHP_EOL;
+            $titleRow .= '   </tr>'.PHP_EOL;
+        }
+
+        $codeRow = '';
+        if ($first !== '' || $second !== '') {
+            $codeRow .= '   <tr>'.PHP_EOL;
+            $codeRow .= "    <td class=\"code-comparison-code\">$first</td>".PHP_EOL;
+            $codeRow .= "    <td class=\"code-comparison-code\">$second</td>".PHP_EOL;
+            $codeRow .= '   </tr>'.PHP_EOL;
+        }
+
+        $output = '';
+        if ($titleRow !== '' || $codeRow !== '') {
+            $output  = '  <table class="code-comparison">'.PHP_EOL;
+            $output .= $titleRow;
+            $output .= $codeRow;
+            $output .= '  </table>'.PHP_EOL;
+        }
+
+        return $output;
+
+    }//end getFormattedCodeComparisonBlock()
+
+
+    /**
+     * Retrieve a code block title and prepare it for output as HTML.
+     *
+     * @param \DOMElement $codeElm The DOMElement object for a code block.
+     *
+     * @since 3.12.0
+     *
+     * @return string
+     */
+    private function formatCodeTitle(DOMElement $codeElm)
+    {
+        $title = trim($codeElm->getAttribute('title'));
+        return str_replace('  ', '&nbsp;&nbsp;', $title);
+
+    }//end formatCodeTitle()
+
+
+    /**
+     * Retrieve a code block contents and prepare it for output as HTML.
+     *
+     * @param \DOMElement $codeElm The DOMElement object for a code block.
+     *
+     * @since 3.12.0
+     *
+     * @return string
+     */
+    private function formatCodeSample(DOMElement $codeElm)
+    {
+        $code = (string) $codeElm->nodeValue;
+        $code = trim($code);
+        $code = str_replace('<?php', '&lt;?php', $code);
+        $code = str_replace(["\n", ' '], ['</br>', '&nbsp;'], $code);
+        $code = str_replace(['<em>', '</em>'], ['<span class="code-comparison-highlight">', '</span>'], $code);
+
+        return $code;
+
+    }//end formatCodeSample()
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Generators/Markdown.php

@@ -0,0 +1,350 @@
+<?php
+/**
+ * A doc generator that outputs documentation in Markdown format.
+ *
+ * @author    Stefano Kowalke <blueduck@gmx.net>
+ * @author    Juliette Reinders Folmer <phpcs_nospam@adviesenzo.nl>
+ * @copyright 2014 Arroba IT
+ * @copyright 2024 PHPCSStandards and contributors
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Generators;
+
+use DOMElement;
+use DOMNode;
+use PHP_CodeSniffer\Config;
+
+class Markdown extends Generator
+{
+
+
+    /**
+     * Generates the documentation for a standard.
+     *
+     * @return void
+     * @see    processSniff()
+     */
+    public function generate()
+    {
+        if (empty($this->docFiles) === true) {
+            return;
+        }
+
+        ob_start();
+        parent::generate();
+
+        $content = ob_get_contents();
+        ob_end_clean();
+
+        if (trim($content) !== '') {
+            echo $this->getFormattedHeader();
+            echo $content;
+            echo $this->getFormattedFooter();
+        }
+
+    }//end generate()
+
+
+    /**
+     * Print the markdown header.
+     *
+     * @deprecated 3.12.0 Use Markdown::getFormattedHeader() instead.
+     *
+     * @codeCoverageIgnore
+     *
+     * @return void
+     */
+    protected function printHeader()
+    {
+        trigger_error(
+            'The '.__METHOD__.'() method is deprecated. Use "echo '.__CLASS__.'::getFormattedHeader()" instead.',
+            E_USER_DEPRECATED
+        );
+
+        echo $this->getFormattedHeader();
+
+    }//end printHeader()
+
+
+    /**
+     * Format the markdown header.
+     *
+     * @since 3.12.0 Replaces the deprecated Markdown::printHeader() method.
+     *
+     * @return string
+     */
+    protected function getFormattedHeader()
+    {
+        $standard = $this->ruleset->name;
+
+        return "# $standard Coding Standard".PHP_EOL;
+
+    }//end getFormattedHeader()
+
+
+    /**
+     * Print the markdown footer.
+     *
+     * @deprecated 3.12.0 Use Markdown::getFormattedFooter() instead.
+     *
+     * @codeCoverageIgnore
+     *
+     * @return void
+     */
+    protected function printFooter()
+    {
+        trigger_error(
+            'The '.__METHOD__.'() method is deprecated. Use "echo '.__CLASS__.'::getFormattedFooter()" instead.',
+            E_USER_DEPRECATED
+        );
+
+        echo $this->getFormattedFooter();
+
+    }//end printFooter()
+
+
+    /**
+     * Format the markdown footer.
+     *
+     * @since 3.12.0 Replaces the deprecated Markdown::printFooter() method.
+     *
+     * @return string
+     */
+    protected function getFormattedFooter()
+    {
+        // Turn off errors so we don't get timezone warnings if people
+        // don't have their timezone set.
+        $errorLevel = error_reporting(0);
+        $output     = PHP_EOL.'Documentation generated on '.date('r');
+        $output    .= ' by [PHP_CodeSniffer '.Config::VERSION.'](https://github.com/PHPCSStandards/PHP_CodeSniffer)'.PHP_EOL;
+        error_reporting($errorLevel);
+
+        return $output;
+
+    }//end getFormattedFooter()
+
+
+    /**
+     * Process the documentation for a single sniff.
+     *
+     * @param \DOMNode $doc The DOMNode object for the sniff.
+     *                      It represents the "documentation" tag in the XML
+     *                      standard file.
+     *
+     * @return void
+     */
+    protected function processSniff(DOMNode $doc)
+    {
+        $content = '';
+        foreach ($doc->childNodes as $node) {
+            if ($node->nodeName === 'standard') {
+                $content .= $this->getFormattedTextBlock($node);
+            } else if ($node->nodeName === 'code_comparison') {
+                $content .= $this->getFormattedCodeComparisonBlock($node);
+            }
+        }
+
+        if (trim($content) !== '') {
+            $title = $this->getTitle($doc);
+            echo PHP_EOL."## $title".PHP_EOL.PHP_EOL;
+            echo $content;
+        }
+
+    }//end processSniff()
+
+
+    /**
+     * Print a text block found in a standard.
+     *
+     * @param \DOMNode $node The DOMNode object for the text block.
+     *
+     * @deprecated 3.12.0 Use Markdown::getFormattedTextBlock() instead.
+     *
+     * @codeCoverageIgnore
+     *
+     * @return void
+     */
+    protected function printTextBlock(DOMNode $node)
+    {
+        trigger_error(
+            'The '.__METHOD__.'() method is deprecated. Use "echo '.__CLASS__.'::getFormattedTextBlock()" instead.',
+            E_USER_DEPRECATED
+        );
+
+        echo $this->getFormattedTextBlock($node);
+
+    }//end printTextBlock()
+
+
+    /**
+     * Format a text block found in a standard.
+     *
+     * @param \DOMNode $node The DOMNode object for the text block.
+     *
+     * @since 3.12.0 Replaces the deprecated Markdown::printTextBlock() method.
+     *
+     * @return string
+     */
+    protected function getFormattedTextBlock(DOMNode $node)
+    {
+        $content = $node->nodeValue;
+        if (empty($content) === true) {
+            return '';
+        }
+
+        $content = trim($content);
+        $content = htmlspecialchars($content, (ENT_QUOTES | ENT_SUBSTITUTE | ENT_HTML401));
+        $content = str_replace('&lt;em&gt;', '*', $content);
+        $content = str_replace('&lt;/em&gt;', '*', $content);
+
+        $nodeLines = explode("\n", $content);
+        $lineCount = count($nodeLines);
+        $lines     = [];
+
+        for ($i = 0; $i < $lineCount; $i++) {
+            $currentLine = trim($nodeLines[$i]);
+            if ($currentLine === '') {
+                // The text contained a blank line. Respect this.
+                $lines[] = '';
+                continue;
+            }
+
+            // Check if the _next_ line is blank.
+            if (isset($nodeLines[($i + 1)]) === false
+                || trim($nodeLines[($i + 1)]) === ''
+            ) {
+                // Next line is blank, just add the line.
+                $lines[] = $currentLine;
+            } else {
+                // Ensure that line breaks are respected in markdown.
+                $lines[] = $currentLine.'  ';
+            }
+        }
+
+        return implode(PHP_EOL, $lines).PHP_EOL;
+
+    }//end getFormattedTextBlock()
+
+
+    /**
+     * Print a code comparison block found in a standard.
+     *
+     * @param \DOMNode $node The DOMNode object for the code comparison block.
+     *
+     * @deprecated 3.12.0 Use Markdown::getFormattedCodeComparisonBlock() instead.
+     *
+     * @codeCoverageIgnore
+     *
+     * @return void
+     */
+    protected function printCodeComparisonBlock(DOMNode $node)
+    {
+        trigger_error(
+            'The '.__METHOD__.'() method is deprecated. Use "echo '.__CLASS__.'::getFormattedCodeComparisonBlock()" instead.',
+            E_USER_DEPRECATED
+        );
+
+        echo $this->getFormattedCodeComparisonBlock($node);
+
+    }//end printCodeComparisonBlock()
+
+
+    /**
+     * Format a code comparison block found in a standard.
+     *
+     * @param \DOMNode $node The DOMNode object for the code comparison block.
+     *
+     * @since 3.12.0 Replaces the deprecated Markdown::printCodeComparisonBlock() method.
+     *
+     * @return string
+     */
+    protected function getFormattedCodeComparisonBlock(DOMNode $node)
+    {
+        $codeBlocks    = $node->getElementsByTagName('code');
+        $firstCodeElm  = $codeBlocks->item(0);
+        $secondCodeElm = $codeBlocks->item(1);
+
+        if (isset($firstCodeElm, $secondCodeElm) === false) {
+            // Missing at least one code block.
+            return '';
+        }
+
+        $firstTitle = $this->formatCodeTitle($firstCodeElm);
+        $first      = $this->formatCodeSample($firstCodeElm);
+
+        $secondTitle = $this->formatCodeTitle($secondCodeElm);
+        $second      = $this->formatCodeSample($secondCodeElm);
+
+        $titleRow = '';
+        if ($firstTitle !== '' || $secondTitle !== '') {
+            $titleRow .= '   <tr>'.PHP_EOL;
+            $titleRow .= "    <th>$firstTitle</th>".PHP_EOL;
+            $titleRow .= "    <th>$secondTitle</th>".PHP_EOL;
+            $titleRow .= '   </tr>'.PHP_EOL;
+        }
+
+        $codeRow = '';
+        if ($first !== '' || $second !== '') {
+            $codeRow .= '   <tr>'.PHP_EOL;
+            $codeRow .= '<td>'.PHP_EOL.PHP_EOL;
+            $codeRow .= "    $first".PHP_EOL.PHP_EOL;
+            $codeRow .= '</td>'.PHP_EOL;
+            $codeRow .= '<td>'.PHP_EOL.PHP_EOL;
+            $codeRow .= "    $second".PHP_EOL.PHP_EOL;
+            $codeRow .= '</td>'.PHP_EOL;
+            $codeRow .= '   </tr>'.PHP_EOL;
+        }
+
+        $output = '';
+        if ($titleRow !== '' || $codeRow !== '') {
+            $output .= '  <table>'.PHP_EOL;
+            $output .= $titleRow;
+            $output .= $codeRow;
+            $output .= '  </table>'.PHP_EOL;
+        }
+
+        return $output;
+
+    }//end getFormattedCodeComparisonBlock()
+
+
+    /**
+     * Retrieve a code block title and prepare it for output as HTML.
+     *
+     * @param \DOMElement $codeElm The DOMElement object for a code block.
+     *
+     * @since 3.12.0
+     *
+     * @return string
+     */
+    private function formatCodeTitle(DOMElement $codeElm)
+    {
+        $title = trim($codeElm->getAttribute('title'));
+        return str_replace('  ', '&nbsp;&nbsp;', $title);
+
+    }//end formatCodeTitle()
+
+
+    /**
+     * Retrieve a code block contents and prepare it for output as HTML.
+     *
+     * @param \DOMElement $codeElm The DOMElement object for a code block.
+     *
+     * @since 3.12.0
+     *
+     * @return string
+     */
+    private function formatCodeSample(DOMElement $codeElm)
+    {
+        $code = (string) $codeElm->nodeValue;
+        $code = trim($code);
+        $code = str_replace("\n", PHP_EOL.'    ', $code);
+        $code = str_replace(['<em>', '</em>'], '', $code);
+
+        return $code;
+
+    }//end formatCodeSample()
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Generators/Text.php

@@ -0,0 +1,313 @@
+<?php
+/**
+ * A doc generator that outputs text-based documentation.
+ *
+ * Output is designed to be displayed in a terminal and is wrapped to 100 characters.
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @author    Juliette Reinders Folmer <phpcs_nospam@adviesenzo.nl>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @copyright 2024 PHPCSStandards and contributors
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Generators;
+
+use DOMElement;
+use DOMNode;
+
+class Text extends Generator
+{
+
+
+    /**
+     * Process the documentation for a single sniff.
+     *
+     * @param \DOMNode $doc The DOMNode object for the sniff.
+     *                      It represents the "documentation" tag in the XML
+     *                      standard file.
+     *
+     * @return void
+     */
+    public function processSniff(DOMNode $doc)
+    {
+        $content = '';
+        foreach ($doc->childNodes as $node) {
+            if ($node->nodeName === 'standard') {
+                $content .= $this->getFormattedTextBlock($node);
+            } else if ($node->nodeName === 'code_comparison') {
+                $content .= $this->getFormattedCodeComparisonBlock($node);
+            }
+        }
+
+        if (trim($content) !== '') {
+            echo $this->getFormattedTitle($doc), $content;
+        }
+
+    }//end processSniff()
+
+
+    /**
+     * Prints the title area for a single sniff.
+     *
+     * @param \DOMNode $doc The DOMNode object for the sniff.
+     *                      It represents the "documentation" tag in the XML
+     *                      standard file.
+     *
+     * @deprecated 3.12.0 Use Text::getFormattedTitle() instead.
+     *
+     * @codeCoverageIgnore
+     *
+     * @return void
+     */
+    protected function printTitle(DOMNode $doc)
+    {
+        trigger_error(
+            'The '.__METHOD__.'() method is deprecated. Use "echo '.__CLASS__.'::getFormattedTitle()" instead.',
+            E_USER_DEPRECATED
+        );
+
+        echo $this->getFormattedTitle($doc);
+
+    }//end printTitle()
+
+
+    /**
+     * Format the title area for a single sniff.
+     *
+     * @param \DOMNode $doc The DOMNode object for the sniff.
+     *                      It represents the "documentation" tag in the XML
+     *                      standard file.
+     *
+     * @since 3.12.0 Replaces the deprecated Text::printTitle() method.
+     *
+     * @return string
+     */
+    protected function getFormattedTitle(DOMNode $doc)
+    {
+        $title        = $this->getTitle($doc);
+        $standard     = $this->ruleset->name;
+        $displayTitle = "$standard CODING STANDARD: $title";
+        $titleLength  = strlen($displayTitle);
+
+        $output  = PHP_EOL;
+        $output .= str_repeat('-', ($titleLength + 4));
+        $output .= strtoupper(PHP_EOL."| $displayTitle |".PHP_EOL);
+        $output .= str_repeat('-', ($titleLength + 4));
+        $output .= PHP_EOL.PHP_EOL;
+
+        return $output;
+
+    }//end getFormattedTitle()
+
+
+    /**
+     * Print a text block found in a standard.
+     *
+     * @param \DOMNode $node The DOMNode object for the text block.
+     *
+     * @deprecated 3.12.0 Use Text::getFormattedTextBlock() instead.
+     *
+     * @codeCoverageIgnore
+     *
+     * @return void
+     */
+    protected function printTextBlock(DOMNode $node)
+    {
+        trigger_error(
+            'The '.__METHOD__.'() method is deprecated. Use "echo '.__CLASS__.'::getFormattedTextBlock()" instead.',
+            E_USER_DEPRECATED
+        );
+
+        echo $this->getFormattedTextBlock($node);
+
+    }//end printTextBlock()
+
+
+    /**
+     * Format a text block found in a standard.
+     *
+     * @param \DOMNode $node The DOMNode object for the text block.
+     *
+     * @since 3.12.0 Replaces the deprecated Text::printTextBlock() method.
+     *
+     * @return string
+     */
+    protected function getFormattedTextBlock(DOMNode $node)
+    {
+        $text = $node->nodeValue;
+        if (empty($text) === true) {
+            return '';
+        }
+
+        $text = trim($text);
+        $text = str_replace(['<em>', '</em>'], '*', $text);
+
+        $nodeLines = explode("\n", $text);
+        $nodeLines = array_map('trim', $nodeLines);
+        $text      = implode(PHP_EOL, $nodeLines);
+
+        return wordwrap($text, 100, PHP_EOL).PHP_EOL.PHP_EOL;
+
+    }//end getFormattedTextBlock()
+
+
+    /**
+     * Print a code comparison block found in a standard.
+     *
+     * @param \DOMNode $node The DOMNode object for the code comparison block.
+     *
+     * @deprecated 3.12.0 Use Text::getFormattedCodeComparisonBlock() instead.
+     *
+     * @codeCoverageIgnore
+     *
+     * @return void
+     */
+    protected function printCodeComparisonBlock(DOMNode $node)
+    {
+        trigger_error(
+            'The '.__METHOD__.'() method is deprecated. Use "echo '.__CLASS__.'::getFormattedCodeComparisonBlock()" instead.',
+            E_USER_DEPRECATED
+        );
+
+        echo $this->getFormattedCodeComparisonBlock($node);
+
+    }//end printCodeComparisonBlock()
+
+
+    /**
+     * Format a code comparison block found in a standard.
+     *
+     * @param \DOMNode $node The DOMNode object for the code comparison block.
+     *
+     * @since 3.12.0 Replaces the deprecated Text::printCodeComparisonBlock() method.
+     *
+     * @return string
+     */
+    protected function getFormattedCodeComparisonBlock(DOMNode $node)
+    {
+        $codeBlocks    = $node->getElementsByTagName('code');
+        $firstCodeElm  = $codeBlocks->item(0);
+        $secondCodeElm = $codeBlocks->item(1);
+
+        if (isset($firstCodeElm, $secondCodeElm) === false) {
+            // Missing at least one code block.
+            return '';
+        }
+
+        $firstTitleLines = $this->codeTitleToLines($firstCodeElm);
+        $firstLines      = $this->codeToLines($firstCodeElm);
+
+        $secondTitleLines = $this->codeTitleToLines($secondCodeElm);
+        $secondLines      = $this->codeToLines($secondCodeElm);
+
+        $titleRow = '';
+        if ($firstTitleLines !== [] || $secondTitleLines !== []) {
+            $titleRow  = $this->linesToTableRows($firstTitleLines, $secondTitleLines);
+            $titleRow .= str_repeat('-', 100).PHP_EOL;
+        }//end if
+
+        $codeRow = '';
+        if ($firstLines !== [] || $secondLines !== []) {
+            $codeRow  = $this->linesToTableRows($firstLines, $secondLines);
+            $codeRow .= str_repeat('-', 100).PHP_EOL.PHP_EOL;
+        }//end if
+
+        $output = '';
+        if ($titleRow !== '' || $codeRow !== '') {
+            $output  = str_repeat('-', 41);
+            $output .= ' CODE COMPARISON ';
+            $output .= str_repeat('-', 42).PHP_EOL;
+            $output .= $titleRow;
+            $output .= $codeRow;
+        }
+
+        return $output;
+
+    }//end getFormattedCodeComparisonBlock()
+
+
+    /**
+     * Retrieve a code block title and split it into lines for use in an ASCII table.
+     *
+     * @param \DOMElement $codeElm The DOMElement object for a code block.
+     *
+     * @since 3.12.0
+     *
+     * @return array<string>
+     */
+    private function codeTitleToLines(DOMElement $codeElm)
+    {
+        $title = trim($codeElm->getAttribute('title'));
+        if ($title === '') {
+            return [];
+        }
+
+        $title = wordwrap($title, 46, "\n");
+
+        return explode("\n", $title);
+
+    }//end codeTitleToLines()
+
+
+    /**
+     * Retrieve a code block contents and split it into lines for use in an ASCII table.
+     *
+     * @param \DOMElement $codeElm The DOMElement object for a code block.
+     *
+     * @since 3.12.0
+     *
+     * @return array<string>
+     */
+    private function codeToLines(DOMElement $codeElm)
+    {
+        $code = trim($codeElm->nodeValue);
+        if ($code === '') {
+            return [];
+        }
+
+        $code = str_replace(['<em>', '</em>'], '', $code);
+        return explode("\n", $code);
+
+    }//end codeToLines()
+
+
+    /**
+     * Transform two sets of text lines into rows for use in an ASCII table.
+     *
+     * The sets may not contains an equal amount of lines, while the resulting rows should.
+     *
+     * @param array<string> $column1Lines Lines of text to place in column 1.
+     * @param array<string> $column2Lines Lines of text to place in column 2.
+     *
+     * @return string
+     */
+    private function linesToTableRows(array $column1Lines, array $column2Lines)
+    {
+        $maxLines = max(count($column1Lines), count($column2Lines));
+
+        $rows = '';
+        for ($i = 0; $i < $maxLines; $i++) {
+            $column1Text = '';
+            if (isset($column1Lines[$i]) === true) {
+                $column1Text = $column1Lines[$i];
+            }
+
+            $column2Text = '';
+            if (isset($column2Lines[$i]) === true) {
+                $column2Text = $column2Lines[$i];
+            }
+
+            $rows .= '| ';
+            $rows .= $column1Text.str_repeat(' ', max(0, (47 - strlen($column1Text))));
+            $rows .= '| ';
+            $rows .= $column2Text.str_repeat(' ', max(0, (48 - strlen($column2Text))));
+            $rows .= '|'.PHP_EOL;
+        }//end for
+
+        return $rows;
+
+    }//end linesToTableRows()
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Reporter.php

@@ -0,0 +1,445 @@
+<?php
+/**
+ * Manages reporting of errors and warnings.
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer;
+
+use PHP_CodeSniffer\Exceptions\DeepExitException;
+use PHP_CodeSniffer\Exceptions\RuntimeException;
+use PHP_CodeSniffer\Files\File;
+use PHP_CodeSniffer\Reports\Report;
+use PHP_CodeSniffer\Util\Common;
+
+class Reporter
+{
+
+    /**
+     * The config data for the run.
+     *
+     * @var \PHP_CodeSniffer\Config
+     */
+    public $config = null;
+
+    /**
+     * Total number of files that contain errors or warnings.
+     *
+     * @var integer
+     */
+    public $totalFiles = 0;
+
+    /**
+     * Total number of errors found during the run.
+     *
+     * @var integer
+     */
+    public $totalErrors = 0;
+
+    /**
+     * Total number of warnings found during the run.
+     *
+     * @var integer
+     */
+    public $totalWarnings = 0;
+
+    /**
+     * Total number of errors/warnings that can be fixed.
+     *
+     * @var integer
+     */
+    public $totalFixable = 0;
+
+    /**
+     * Total number of errors/warnings that were fixed.
+     *
+     * @var integer
+     */
+    public $totalFixed = 0;
+
+    /**
+     * When the PHPCS run started.
+     *
+     * @var float
+     */
+    public static $startTime = 0;
+
+    /**
+     * A cache of report objects.
+     *
+     * @var array
+     */
+    private $reports = [];
+
+    /**
+     * A cache of opened temporary files.
+     *
+     * @var array
+     */
+    private $tmpFiles = [];
+
+
+    /**
+     * Initialise the reporter.
+     *
+     * All reports specified in the config will be created and their
+     * output file (or a temp file if none is specified) initialised by
+     * clearing the current contents.
+     *
+     * @param \PHP_CodeSniffer\Config $config The config data for the run.
+     *
+     * @return void
+     * @throws \PHP_CodeSniffer\Exceptions\DeepExitException If a custom report class could not be found.
+     * @throws \PHP_CodeSniffer\Exceptions\RuntimeException  If a report class is incorrectly set up.
+     */
+    public function __construct(Config $config)
+    {
+        $this->config = $config;
+
+        foreach ($config->reports as $type => $output) {
+            if ($output === null) {
+                $output = $config->reportFile;
+            }
+
+            $reportClassName = '';
+            if (strpos($type, '.') !== false) {
+                // This is a path to a custom report class.
+                $filename = realpath($type);
+                if ($filename === false) {
+                    $error = "ERROR: Custom report \"$type\" not found".PHP_EOL;
+                    throw new DeepExitException($error, 3);
+                }
+
+                $reportClassName = Autoload::loadFile($filename);
+            } else if (class_exists('PHP_CodeSniffer\Reports\\'.ucfirst($type)) === true) {
+                // PHPCS native report.
+                $reportClassName = 'PHP_CodeSniffer\Reports\\'.ucfirst($type);
+            } else if (class_exists($type) === true) {
+                // FQN of a custom report.
+                $reportClassName = $type;
+            } else {
+                // OK, so not a FQN, try and find the report using the registered namespaces.
+                $registeredNamespaces = Autoload::getSearchPaths();
+                $trimmedType          = ltrim($type, '\\');
+
+                foreach ($registeredNamespaces as $nsPrefix) {
+                    if ($nsPrefix === '') {
+                        continue;
+                    }
+
+                    if (class_exists($nsPrefix.'\\'.$trimmedType) === true) {
+                        $reportClassName = $nsPrefix.'\\'.$trimmedType;
+                        break;
+                    }
+                }
+            }//end if
+
+            if ($reportClassName === '') {
+                $error = "ERROR: Class file for report \"$type\" not found".PHP_EOL;
+                throw new DeepExitException($error, 3);
+            }
+
+            $reportClass = new $reportClassName();
+            if (($reportClass instanceof Report) === false) {
+                throw new RuntimeException('Class "'.$reportClassName.'" must implement the "PHP_CodeSniffer\Report" interface.');
+            }
+
+            $this->reports[$type] = [
+                'output' => $output,
+                'class'  => $reportClass,
+            ];
+
+            if ($output === null) {
+                // Using a temp file.
+                // This needs to be set in the constructor so that all
+                // child procs use the same report file when running in parallel.
+                $this->tmpFiles[$type] = tempnam(sys_get_temp_dir(), 'phpcs');
+                file_put_contents($this->tmpFiles[$type], '');
+            } else {
+                file_put_contents($output, '');
+            }
+        }//end foreach
+
+    }//end __construct()
+
+
+    /**
+     * Generates and prints final versions of all reports.
+     *
+     * Returns TRUE if any of the reports output content to the screen
+     * or FALSE if all reports were silently printed to a file.
+     *
+     * @return bool
+     */
+    public function printReports()
+    {
+        $toScreen = false;
+        foreach ($this->reports as $type => $report) {
+            if ($report['output'] === null) {
+                $toScreen = true;
+            }
+
+            $this->printReport($type);
+        }
+
+        return $toScreen;
+
+    }//end printReports()
+
+
+    /**
+     * Generates and prints a single final report.
+     *
+     * @param string $report The report type to print.
+     *
+     * @return void
+     */
+    public function printReport($report)
+    {
+        $reportClass = $this->reports[$report]['class'];
+        $reportFile  = $this->reports[$report]['output'];
+
+        if ($reportFile !== null) {
+            $filename = $reportFile;
+            $toScreen = false;
+        } else {
+            if (isset($this->tmpFiles[$report]) === true) {
+                $filename = $this->tmpFiles[$report];
+            } else {
+                $filename = null;
+            }
+
+            $toScreen = true;
+        }
+
+        $reportCache = '';
+        if ($filename !== null) {
+            $reportCache = file_get_contents($filename);
+        }
+
+        ob_start();
+        $reportClass->generate(
+            $reportCache,
+            $this->totalFiles,
+            $this->totalErrors,
+            $this->totalWarnings,
+            $this->totalFixable,
+            $this->config->showSources,
+            $this->config->reportWidth,
+            $this->config->interactive,
+            $toScreen
+        );
+        $generatedReport = ob_get_contents();
+        ob_end_clean();
+
+        if ($this->config->colors !== true || $reportFile !== null) {
+            $generatedReport = Common::stripColors($generatedReport);
+        }
+
+        if ($reportFile !== null) {
+            if (PHP_CODESNIFFER_VERBOSITY > 0) {
+                echo $generatedReport;
+            }
+
+            file_put_contents($reportFile, $generatedReport.PHP_EOL);
+        } else {
+            echo $generatedReport;
+            if ($filename !== null && file_exists($filename) === true) {
+                unlink($filename);
+                unset($this->tmpFiles[$report]);
+            }
+        }
+
+    }//end printReport()
+
+
+    /**
+     * Caches the result of a single processed file for all reports.
+     *
+     * The report content that is generated is appended to the output file
+     * assigned to each report. This content may be an intermediate report format
+     * and not reflect the final report output.
+     *
+     * @param \PHP_CodeSniffer\Files\File $phpcsFile The file that has been processed.
+     *
+     * @return void
+     */
+    public function cacheFileReport(File $phpcsFile)
+    {
+        if (isset($this->config->reports) === false) {
+            // This happens during unit testing, or any time someone just wants
+            // the error data and not the printed report.
+            return;
+        }
+
+        $reportData  = $this->prepareFileReport($phpcsFile);
+        $errorsShown = false;
+
+        foreach ($this->reports as $type => $report) {
+            $reportClass = $report['class'];
+
+            ob_start();
+            $result = $reportClass->generateFileReport($reportData, $phpcsFile, $this->config->showSources, $this->config->reportWidth);
+            if ($result === true) {
+                $errorsShown = true;
+            }
+
+            $generatedReport = ob_get_contents();
+            ob_end_clean();
+
+            if ($report['output'] === null) {
+                // Using a temp file.
+                if (isset($this->tmpFiles[$type]) === false) {
+                    // When running in interactive mode, the reporter prints the full
+                    // report many times, which will unlink the temp file. So we need
+                    // to create a new one if it doesn't exist.
+                    $this->tmpFiles[$type] = tempnam(sys_get_temp_dir(), 'phpcs');
+                    file_put_contents($this->tmpFiles[$type], '');
+                }
+
+                file_put_contents($this->tmpFiles[$type], $generatedReport, (FILE_APPEND | LOCK_EX));
+            } else {
+                file_put_contents($report['output'], $generatedReport, (FILE_APPEND | LOCK_EX));
+            }//end if
+        }//end foreach
+
+        if ($errorsShown === true || PHP_CODESNIFFER_CBF === true) {
+            $this->totalFiles++;
+            $this->totalErrors   += $reportData['errors'];
+            $this->totalWarnings += $reportData['warnings'];
+
+            // When PHPCBF is running, we need to use the fixable error values
+            // after the report has run and fixed what it can.
+            if (PHP_CODESNIFFER_CBF === true) {
+                $this->totalFixable += $phpcsFile->getFixableCount();
+                $this->totalFixed   += $phpcsFile->getFixedCount();
+            } else {
+                $this->totalFixable += $reportData['fixable'];
+            }
+        }
+
+    }//end cacheFileReport()
+
+
+    /**
+     * Generate summary information to be used during report generation.
+     *
+     * @param \PHP_CodeSniffer\Files\File $phpcsFile The file that has been processed.
+     *
+     * @return array<string, string|int|array> Prepared report data.
+     *                                         The format of prepared data is as follows:
+     *                                         ```
+     *                                         array(
+     *                                           'filename' => string The name of the current file.
+     *                                           'errors'   => int    The number of errors seen in the current file.
+     *                                           'warnings' => int    The number of warnings seen in the current file.
+     *                                           'fixable'  => int    The number of fixable issues seen in the current file.
+     *                                           'messages' => array(
+     *                                             int <Line number> => array(
+     *                                               int <Column number> => array(
+     *                                                 int <Message index> => array(
+     *                                                   'message'  => string The error/warning message.
+     *                                                   'source'   => string The full error code for the message.
+     *                                                   'severity' => int    The severity of the message.
+     *                                                   'fixable'  => bool   Whether this error/warning is auto-fixable.
+     *                                                   'type'     => string The type of message. Either 'ERROR' or 'WARNING'.
+     *                                                 )
+     *                                               )
+     *                                             )
+     *                                           )
+     *                                         )
+     *                                         ```
+     */
+    public function prepareFileReport(File $phpcsFile)
+    {
+        $report = [
+            'filename' => Common::stripBasepath($phpcsFile->getFilename(), $this->config->basepath),
+            'errors'   => $phpcsFile->getErrorCount(),
+            'warnings' => $phpcsFile->getWarningCount(),
+            'fixable'  => $phpcsFile->getFixableCount(),
+            'messages' => [],
+        ];
+
+        if ($report['errors'] === 0 && $report['warnings'] === 0) {
+            // Perfect score!
+            return $report;
+        }
+
+        if ($this->config->recordErrors === false) {
+            $message  = 'Errors are not being recorded but this report requires error messages. ';
+            $message .= 'This report will not show the correct information.';
+            $report['messages'][1][1] = [
+                [
+                    'message'  => $message,
+                    'source'   => 'Internal.RecordErrors',
+                    'severity' => 5,
+                    'fixable'  => false,
+                    'type'     => 'ERROR',
+                ],
+            ];
+            return $report;
+        }
+
+        $errors = [];
+
+        // Merge errors and warnings.
+        foreach ($phpcsFile->getErrors() as $line => $lineErrors) {
+            foreach ($lineErrors as $column => $colErrors) {
+                $newErrors = [];
+                foreach ($colErrors as $data) {
+                    $newErrors[] = [
+                        'message'  => $data['message'],
+                        'source'   => $data['source'],
+                        'severity' => $data['severity'],
+                        'fixable'  => $data['fixable'],
+                        'type'     => 'ERROR',
+                    ];
+                }
+
+                $errors[$line][$column] = $newErrors;
+            }
+
+            ksort($errors[$line]);
+        }//end foreach
+
+        foreach ($phpcsFile->getWarnings() as $line => $lineWarnings) {
+            foreach ($lineWarnings as $column => $colWarnings) {
+                $newWarnings = [];
+                foreach ($colWarnings as $data) {
+                    $newWarnings[] = [
+                        'message'  => $data['message'],
+                        'source'   => $data['source'],
+                        'severity' => $data['severity'],
+                        'fixable'  => $data['fixable'],
+                        'type'     => 'WARNING',
+                    ];
+                }
+
+                if (isset($errors[$line]) === false) {
+                    $errors[$line] = [];
+                }
+
+                if (isset($errors[$line][$column]) === true) {
+                    $errors[$line][$column] = array_merge(
+                        $newWarnings,
+                        $errors[$line][$column]
+                    );
+                } else {
+                    $errors[$line][$column] = $newWarnings;
+                }
+            }//end foreach
+
+            ksort($errors[$line]);
+        }//end foreach
+
+        ksort($errors);
+        $report['messages'] = $errors;
+        return $report;
+
+    }//end prepareFileReport()
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Reports/Cbf.php

@@ -0,0 +1,259 @@
+<?php
+/**
+ * CBF report for PHP_CodeSniffer.
+ *
+ * This report implements the various auto-fixing features of the
+ * PHPCBF script and is not intended (or allowed) to be selected as a
+ * report from the command line.
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Reports;
+
+use PHP_CodeSniffer\Exceptions\DeepExitException;
+use PHP_CodeSniffer\Files\File;
+use PHP_CodeSniffer\Util\Timing;
+
+class Cbf implements Report
+{
+
+
+    /**
+     * Generate a partial report for a single processed file.
+     *
+     * Function should return TRUE if it printed or stored data about the file
+     * and FALSE if it ignored the file. Returning TRUE indicates that the file and
+     * its data should be counted in the grand totals.
+     *
+     * @param array<string, string|int|array> $report      Prepared report data.
+     *                                                     See the {@see Report} interface for a detailed specification.
+     * @param \PHP_CodeSniffer\Files\File     $phpcsFile   The file being reported on.
+     * @param bool                            $showSources Show sources?
+     * @param int                             $width       Maximum allowed line width.
+     *
+     * @return bool
+     * @throws \PHP_CodeSniffer\Exceptions\DeepExitException
+     */
+    public function generateFileReport($report, File $phpcsFile, $showSources=false, $width=80)
+    {
+        $errors = $phpcsFile->getFixableCount();
+        if ($errors !== 0) {
+            if (PHP_CODESNIFFER_VERBOSITY > 0) {
+                ob_end_clean();
+                $startTime = microtime(true);
+                echo "\t=> Fixing file: $errors/$errors violations remaining";
+                if (PHP_CODESNIFFER_VERBOSITY > 1) {
+                    echo PHP_EOL;
+                }
+            }
+
+            $fixed = $phpcsFile->fixer->fixFile();
+        }
+
+        if ($phpcsFile->config->stdin === true) {
+            // Replacing STDIN, so output current file to STDOUT
+            // even if nothing was fixed. Exit here because we
+            // can't process any more than 1 file in this setup.
+            $fixedContent = $phpcsFile->fixer->getContents();
+            throw new DeepExitException($fixedContent, 1);
+        }
+
+        if ($errors === 0) {
+            return false;
+        }
+
+        if (PHP_CODESNIFFER_VERBOSITY > 0) {
+            if ($fixed === false) {
+                echo 'ERROR';
+            } else {
+                echo 'DONE';
+            }
+
+            $timeTaken = ((microtime(true) - $startTime) * 1000);
+            if ($timeTaken < 1000) {
+                $timeTaken = round($timeTaken);
+                echo " in {$timeTaken}ms".PHP_EOL;
+            } else {
+                $timeTaken = round(($timeTaken / 1000), 2);
+                echo " in $timeTaken secs".PHP_EOL;
+            }
+        }
+
+        if ($fixed === true) {
+            // The filename in the report may be truncated due to a basepath setting
+            // but we are using it for writing here and not display,
+            // so find the correct path if basepath is in use.
+            $newFilename = $report['filename'].$phpcsFile->config->suffix;
+            if ($phpcsFile->config->basepath !== null) {
+                $newFilename = $phpcsFile->config->basepath.DIRECTORY_SEPARATOR.$newFilename;
+            }
+
+            $newContent = $phpcsFile->fixer->getContents();
+            file_put_contents($newFilename, $newContent);
+
+            if (PHP_CODESNIFFER_VERBOSITY > 0) {
+                if ($newFilename === $report['filename']) {
+                    echo "\t=> File was overwritten".PHP_EOL;
+                } else {
+                    echo "\t=> Fixed file written to ".basename($newFilename).PHP_EOL;
+                }
+            }
+        }
+
+        if (PHP_CODESNIFFER_VERBOSITY > 0) {
+            ob_start();
+        }
+
+        $errorCount   = $phpcsFile->getErrorCount();
+        $warningCount = $phpcsFile->getWarningCount();
+        $fixableCount = $phpcsFile->getFixableCount();
+        $fixedCount   = ($errors - $fixableCount);
+        echo $report['filename'].">>$errorCount>>$warningCount>>$fixableCount>>$fixedCount".PHP_EOL;
+
+        return $fixed;
+
+    }//end generateFileReport()
+
+
+    /**
+     * Prints a summary of fixed files.
+     *
+     * @param string $cachedData    Any partial report data that was returned from
+     *                              generateFileReport during the run.
+     * @param int    $totalFiles    Total number of files processed during the run.
+     * @param int    $totalErrors   Total number of errors found during the run.
+     * @param int    $totalWarnings Total number of warnings found during the run.
+     * @param int    $totalFixable  Total number of problems that can be fixed.
+     * @param bool   $showSources   Show sources?
+     * @param int    $width         Maximum allowed line width.
+     * @param bool   $interactive   Are we running in interactive mode?
+     * @param bool   $toScreen      Is the report being printed to screen?
+     *
+     * @return void
+     */
+    public function generate(
+        $cachedData,
+        $totalFiles,
+        $totalErrors,
+        $totalWarnings,
+        $totalFixable,
+        $showSources=false,
+        $width=80,
+        $interactive=false,
+        $toScreen=true
+    ) {
+        $lines = explode(PHP_EOL, $cachedData);
+        array_pop($lines);
+
+        if (empty($lines) === true) {
+            if (($totalErrors + $totalWarnings) === 0) {
+                echo PHP_EOL.'No violations were found'.PHP_EOL;
+            } else {
+                echo PHP_EOL.'No fixable errors were found'.PHP_EOL;
+            }
+
+            return;
+        }
+
+        $reportFiles = [];
+        $maxLength   = 0;
+        $totalFixed  = 0;
+        $failures    = 0;
+
+        foreach ($lines as $line) {
+            $parts   = explode('>>', $line);
+            $fileLen = strlen($parts[0]);
+            $reportFiles[$parts[0]] = [
+                'errors'   => $parts[1],
+                'warnings' => $parts[2],
+                'fixable'  => $parts[3],
+                'fixed'    => $parts[4],
+                'strlen'   => $fileLen,
+            ];
+
+            $maxLength = max($maxLength, $fileLen);
+
+            $totalFixed += $parts[4];
+
+            if ($parts[3] > 0) {
+                $failures++;
+            }
+        }
+
+        $width = min($width, ($maxLength + 21));
+        $width = max($width, 70);
+
+        echo PHP_EOL."\033[1m".'PHPCBF RESULT SUMMARY'."\033[0m".PHP_EOL;
+        echo str_repeat('-', $width).PHP_EOL;
+        echo "\033[1m".'FILE'.str_repeat(' ', ($width - 20)).'FIXED  REMAINING'."\033[0m".PHP_EOL;
+        echo str_repeat('-', $width).PHP_EOL;
+
+        foreach ($reportFiles as $file => $data) {
+            $padding = ($width - 18 - $data['strlen']);
+            if ($padding < 0) {
+                $file    = '...'.substr($file, (($padding * -1) + 3));
+                $padding = 0;
+            }
+
+            echo $file.str_repeat(' ', $padding).'  ';
+
+            if ($data['fixable'] > 0) {
+                echo "\033[31mFAILED TO FIX\033[0m".PHP_EOL;
+                continue;
+            }
+
+            $remaining = ($data['errors'] + $data['warnings']);
+
+            if ($data['fixed'] !== 0) {
+                echo $data['fixed'];
+                echo str_repeat(' ', (7 - strlen((string) $data['fixed'])));
+            } else {
+                echo '0      ';
+            }
+
+            if ($remaining !== 0) {
+                echo $remaining;
+            } else {
+                echo '0';
+            }
+
+            echo PHP_EOL;
+        }//end foreach
+
+        echo str_repeat('-', $width).PHP_EOL;
+        echo "\033[1mA TOTAL OF $totalFixed ERROR";
+        if ($totalFixed !== 1) {
+            echo 'S';
+        }
+
+        $numFiles = count($reportFiles);
+        echo ' WERE FIXED IN '.$numFiles.' FILE';
+        if ($numFiles !== 1) {
+            echo 'S';
+        }
+
+        echo "\033[0m";
+
+        if ($failures > 0) {
+            echo PHP_EOL.str_repeat('-', $width).PHP_EOL;
+            echo "\033[1mPHPCBF FAILED TO FIX $failures FILE";
+            if ($failures !== 1) {
+                echo 'S';
+            }
+
+            echo "\033[0m";
+        }
+
+        echo PHP_EOL.str_repeat('-', $width).PHP_EOL.PHP_EOL;
+
+        if ($toScreen === true && $interactive === false) {
+            Timing::printRunTime();
+        }
+
+    }//end generate()
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Reports/Checkstyle.php

@@ -0,0 +1,111 @@
+<?php
+/**
+ * Checkstyle report for PHP_CodeSniffer.
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Reports;
+
+use PHP_CodeSniffer\Config;
+use PHP_CodeSniffer\Files\File;
+use XMLWriter;
+
+class Checkstyle implements Report
+{
+
+
+    /**
+     * Generate a partial report for a single processed file.
+     *
+     * Function should return TRUE if it printed or stored data about the file
+     * and FALSE if it ignored the file. Returning TRUE indicates that the file and
+     * its data should be counted in the grand totals.
+     *
+     * @param array<string, string|int|array> $report      Prepared report data.
+     *                                                     See the {@see Report} interface for a detailed specification.
+     * @param \PHP_CodeSniffer\Files\File     $phpcsFile   The file being reported on.
+     * @param bool                            $showSources Show sources?
+     * @param int                             $width       Maximum allowed line width.
+     *
+     * @return bool
+     */
+    public function generateFileReport($report, File $phpcsFile, $showSources=false, $width=80)
+    {
+        $out = new XMLWriter;
+        $out->openMemory();
+        $out->setIndent(true);
+
+        if ($report['errors'] === 0 && $report['warnings'] === 0) {
+            // Nothing to print.
+            return false;
+        }
+
+        $out->startElement('file');
+        $out->writeAttribute('name', $report['filename']);
+
+        foreach ($report['messages'] as $line => $lineErrors) {
+            foreach ($lineErrors as $column => $colErrors) {
+                foreach ($colErrors as $error) {
+                    $error['type'] = strtolower($error['type']);
+                    if ($phpcsFile->config->encoding !== 'utf-8') {
+                        $error['message'] = iconv($phpcsFile->config->encoding, 'utf-8', $error['message']);
+                    }
+
+                    $out->startElement('error');
+                    $out->writeAttribute('line', $line);
+                    $out->writeAttribute('column', $column);
+                    $out->writeAttribute('severity', $error['type']);
+                    $out->writeAttribute('message', $error['message']);
+                    $out->writeAttribute('source', $error['source']);
+                    $out->endElement();
+                }
+            }
+        }//end foreach
+
+        $out->endElement();
+        echo $out->flush();
+
+        return true;
+
+    }//end generateFileReport()
+
+
+    /**
+     * Prints all violations for processed files, in a Checkstyle format.
+     *
+     * @param string $cachedData    Any partial report data that was returned from
+     *                              generateFileReport during the run.
+     * @param int    $totalFiles    Total number of files processed during the run.
+     * @param int    $totalErrors   Total number of errors found during the run.
+     * @param int    $totalWarnings Total number of warnings found during the run.
+     * @param int    $totalFixable  Total number of problems that can be fixed.
+     * @param bool   $showSources   Show sources?
+     * @param int    $width         Maximum allowed line width.
+     * @param bool   $interactive   Are we running in interactive mode?
+     * @param bool   $toScreen      Is the report being printed to screen?
+     *
+     * @return void
+     */
+    public function generate(
+        $cachedData,
+        $totalFiles,
+        $totalErrors,
+        $totalWarnings,
+        $totalFixable,
+        $showSources=false,
+        $width=80,
+        $interactive=false,
+        $toScreen=true
+    ) {
+        echo '<?xml version="1.0" encoding="UTF-8"?>'.PHP_EOL;
+        echo '<checkstyle version="'.Config::VERSION.'">'.PHP_EOL;
+        echo $cachedData;
+        echo '</checkstyle>'.PHP_EOL;
+
+    }//end generate()
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Reports/Code.php

@@ -0,0 +1,369 @@
+<?php
+/**
+ * Full report for PHP_CodeSniffer.
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Reports;
+
+use Exception;
+use PHP_CodeSniffer\Files\File;
+use PHP_CodeSniffer\Util\Common;
+use PHP_CodeSniffer\Util\Timing;
+
+class Code implements Report
+{
+
+
+    /**
+     * Generate a partial report for a single processed file.
+     *
+     * Function should return TRUE if it printed or stored data about the file
+     * and FALSE if it ignored the file. Returning TRUE indicates that the file and
+     * its data should be counted in the grand totals.
+     *
+     * @param array<string, string|int|array> $report      Prepared report data.
+     *                                                     See the {@see Report} interface for a detailed specification.
+     * @param \PHP_CodeSniffer\Files\File     $phpcsFile   The file being reported on.
+     * @param bool                            $showSources Show sources?
+     * @param int                             $width       Maximum allowed line width.
+     *
+     * @return bool
+     */
+    public function generateFileReport($report, File $phpcsFile, $showSources=false, $width=80)
+    {
+        if ($report['errors'] === 0 && $report['warnings'] === 0) {
+            // Nothing to print.
+            return false;
+        }
+
+        // How many lines to show above and below the error line.
+        $surroundingLines = 2;
+
+        $file   = $report['filename'];
+        $tokens = $phpcsFile->getTokens();
+        if (empty($tokens) === true) {
+            if (PHP_CODESNIFFER_VERBOSITY === 1) {
+                $startTime = microtime(true);
+                echo 'CODE report is parsing '.basename($file).' ';
+            } else if (PHP_CODESNIFFER_VERBOSITY > 1) {
+                echo "CODE report is forcing parse of $file".PHP_EOL;
+            }
+
+            try {
+                $phpcsFile->parse();
+
+                // Make sure the fixer is aware of the reparsed file to prevent a race-condition
+                // with the Diff report also re-parsing the file.
+                $phpcsFile->fixer->startFile($phpcsFile);
+            } catch (Exception $e) {
+                // This is a second parse, so ignore exceptions.
+                // They would have been added to the file's error list already.
+            }
+
+            if (PHP_CODESNIFFER_VERBOSITY === 1) {
+                $timeTaken = ((microtime(true) - $startTime) * 1000);
+                if ($timeTaken < 1000) {
+                    $timeTaken = round($timeTaken);
+                    echo "DONE in {$timeTaken}ms";
+                } else {
+                    $timeTaken = round(($timeTaken / 1000), 2);
+                    echo "DONE in $timeTaken secs";
+                }
+
+                echo PHP_EOL;
+            }
+
+            $tokens = $phpcsFile->getTokens();
+        }//end if
+
+        // Create an array that maps lines to the first token on the line.
+        $lineTokens = [];
+        $lastLine   = 0;
+        $stackPtr   = 0;
+        foreach ($tokens as $stackPtr => $token) {
+            if ($token['line'] !== $lastLine) {
+                if ($lastLine > 0) {
+                    $lineTokens[$lastLine]['end'] = ($stackPtr - 1);
+                }
+
+                $lastLine++;
+                $lineTokens[$lastLine] = [
+                    'start' => $stackPtr,
+                    'end'   => null,
+                ];
+            }
+        }
+
+        // Make sure the last token in the file sits on an imaginary
+        // last line so it is easier to generate code snippets at the
+        // end of the file.
+        $lineTokens[$lastLine]['end'] = $stackPtr;
+
+        // Determine the longest code line we will be showing.
+        $maxSnippetLength = 0;
+        $eolLen           = strlen($phpcsFile->eolChar);
+        foreach ($report['messages'] as $line => $lineErrors) {
+            $startLine = max(($line - $surroundingLines), 1);
+            $endLine   = min(($line + $surroundingLines), $lastLine);
+
+            $maxLineNumLength = strlen($endLine);
+
+            for ($i = $startLine; $i <= $endLine; $i++) {
+                if ($i === 1) {
+                    continue;
+                }
+
+                $lineLength       = ($tokens[($lineTokens[$i]['start'] - 1)]['column'] + $tokens[($lineTokens[$i]['start'] - 1)]['length'] - $eolLen);
+                $maxSnippetLength = max($lineLength, $maxSnippetLength);
+            }
+        }
+
+        $maxSnippetLength += ($maxLineNumLength + 8);
+
+        // Determine the longest error message we will be showing.
+        $maxErrorLength = 0;
+        foreach ($report['messages'] as $lineErrors) {
+            foreach ($lineErrors as $colErrors) {
+                foreach ($colErrors as $error) {
+                    $length = strlen($error['message']);
+                    if ($showSources === true) {
+                        $length += (strlen($error['source']) + 3);
+                    }
+
+                    $maxErrorLength = max($maxErrorLength, ($length + 1));
+                }
+            }
+        }
+
+        // The padding that all lines will require that are printing an error message overflow.
+        if ($report['warnings'] > 0) {
+            $typeLength = 7;
+        } else {
+            $typeLength = 5;
+        }
+
+        $errorPadding  = str_repeat(' ', ($maxLineNumLength + 7));
+        $errorPadding .= str_repeat(' ', $typeLength);
+        $errorPadding .= ' ';
+        if ($report['fixable'] > 0) {
+            $errorPadding .= '    ';
+        }
+
+        $errorPaddingLength = strlen($errorPadding);
+
+        // The maximum amount of space an error message can use.
+        $maxErrorSpace = ($width - $errorPaddingLength);
+        if ($showSources === true) {
+            // Account for the chars used to print colors.
+            $maxErrorSpace += 8;
+        }
+
+        // Figure out the max report width we need and can use.
+        $fileLength = strlen($file);
+        $maxWidth   = max(($fileLength + 6), ($maxErrorLength + $errorPaddingLength));
+        $width      = max(min($width, $maxWidth), $maxSnippetLength);
+        if ($width < 70) {
+            $width = 70;
+        }
+
+        // Print the file header.
+        echo PHP_EOL."\033[1mFILE: ";
+        if ($fileLength <= ($width - 6)) {
+            echo $file;
+        } else {
+            echo '...'.substr($file, ($fileLength - ($width - 6)));
+        }
+
+        echo "\033[0m".PHP_EOL;
+        echo str_repeat('-', $width).PHP_EOL;
+
+        echo "\033[1m".'FOUND '.$report['errors'].' ERROR';
+        if ($report['errors'] !== 1) {
+            echo 'S';
+        }
+
+        if ($report['warnings'] > 0) {
+            echo ' AND '.$report['warnings'].' WARNING';
+            if ($report['warnings'] !== 1) {
+                echo 'S';
+            }
+        }
+
+        echo ' AFFECTING '.count($report['messages']).' LINE';
+        if (count($report['messages']) !== 1) {
+            echo 'S';
+        }
+
+        echo "\033[0m".PHP_EOL;
+
+        foreach ($report['messages'] as $line => $lineErrors) {
+            $startLine = max(($line - $surroundingLines), 1);
+            $endLine   = min(($line + $surroundingLines), $lastLine);
+
+            $snippet = '';
+            if (isset($lineTokens[$startLine]) === true) {
+                for ($i = $lineTokens[$startLine]['start']; $i <= $lineTokens[$endLine]['end']; $i++) {
+                    $snippetLine = $tokens[$i]['line'];
+                    if ($lineTokens[$snippetLine]['start'] === $i) {
+                        // Starting a new line.
+                        if ($snippetLine === $line) {
+                            $snippet .= "\033[1m".'>> ';
+                        } else {
+                            $snippet .= '   ';
+                        }
+
+                        $snippet .= str_repeat(' ', ($maxLineNumLength - strlen($snippetLine)));
+                        $snippet .= $snippetLine.':  ';
+                        if ($snippetLine === $line) {
+                            $snippet .= "\033[0m";
+                        }
+                    }
+
+                    if (isset($tokens[$i]['orig_content']) === true) {
+                        $tokenContent = $tokens[$i]['orig_content'];
+                    } else {
+                        $tokenContent = $tokens[$i]['content'];
+                    }
+
+                    if (strpos($tokenContent, "\t") !== false) {
+                        $token            = $tokens[$i];
+                        $token['content'] = $tokenContent;
+                        if (stripos(PHP_OS, 'WIN') === 0) {
+                            $tab = "\000";
+                        } else {
+                            $tab = "\033[30;1m»\033[0m";
+                        }
+
+                        $phpcsFile->tokenizer->replaceTabsInToken($token, $tab, "\000");
+                        $tokenContent = $token['content'];
+                    }
+
+                    $tokenContent = Common::prepareForOutput($tokenContent, ["\r", "\n", "\t"]);
+                    $tokenContent = str_replace("\000", ' ', $tokenContent);
+
+                    $underline = false;
+                    if ($snippetLine === $line && isset($lineErrors[$tokens[$i]['column']]) === true) {
+                        $underline = true;
+                    }
+
+                    // Underline invisible characters as well.
+                    if ($underline === true && trim($tokenContent) === '') {
+                        $snippet .= "\033[4m".' '."\033[0m".$tokenContent;
+                    } else {
+                        if ($underline === true) {
+                            $snippet .= "\033[4m";
+                        }
+
+                        $snippet .= $tokenContent;
+
+                        if ($underline === true) {
+                            $snippet .= "\033[0m";
+                        }
+                    }
+                }//end for
+            }//end if
+
+            echo str_repeat('-', $width).PHP_EOL;
+
+            foreach ($lineErrors as $colErrors) {
+                foreach ($colErrors as $error) {
+                    $padding = ($maxLineNumLength - strlen($line));
+                    echo 'LINE '.str_repeat(' ', $padding).$line.': ';
+
+                    if ($error['type'] === 'ERROR') {
+                        echo "\033[31mERROR\033[0m";
+                        if ($report['warnings'] > 0) {
+                            echo '  ';
+                        }
+                    } else {
+                        echo "\033[33mWARNING\033[0m";
+                    }
+
+                    echo ' ';
+                    if ($report['fixable'] > 0) {
+                        echo '[';
+                        if ($error['fixable'] === true) {
+                            echo 'x';
+                        } else {
+                            echo ' ';
+                        }
+
+                        echo '] ';
+                    }
+
+                    $message = $error['message'];
+                    $message = str_replace("\n", "\n".$errorPadding, $message);
+                    if ($showSources === true) {
+                        $message = "\033[1m".$message."\033[0m".' ('.$error['source'].')';
+                    }
+
+                    $errorMsg = wordwrap(
+                        $message,
+                        $maxErrorSpace,
+                        PHP_EOL.$errorPadding
+                    );
+
+                    echo $errorMsg.PHP_EOL;
+                }//end foreach
+            }//end foreach
+
+            echo str_repeat('-', $width).PHP_EOL;
+            echo rtrim($snippet).PHP_EOL;
+        }//end foreach
+
+        echo str_repeat('-', $width).PHP_EOL;
+        if ($report['fixable'] > 0) {
+            echo "\033[1m".'PHPCBF CAN FIX THE '.$report['fixable'].' MARKED SNIFF VIOLATIONS AUTOMATICALLY'."\033[0m".PHP_EOL;
+            echo str_repeat('-', $width).PHP_EOL;
+        }
+
+        return true;
+
+    }//end generateFileReport()
+
+
+    /**
+     * Prints all errors and warnings for each file processed.
+     *
+     * @param string $cachedData    Any partial report data that was returned from
+     *                              generateFileReport during the run.
+     * @param int    $totalFiles    Total number of files processed during the run.
+     * @param int    $totalErrors   Total number of errors found during the run.
+     * @param int    $totalWarnings Total number of warnings found during the run.
+     * @param int    $totalFixable  Total number of problems that can be fixed.
+     * @param bool   $showSources   Show sources?
+     * @param int    $width         Maximum allowed line width.
+     * @param bool   $interactive   Are we running in interactive mode?
+     * @param bool   $toScreen      Is the report being printed to screen?
+     *
+     * @return void
+     */
+    public function generate(
+        $cachedData,
+        $totalFiles,
+        $totalErrors,
+        $totalWarnings,
+        $totalFixable,
+        $showSources=false,
+        $width=80,
+        $interactive=false,
+        $toScreen=true
+    ) {
+        if ($cachedData === '') {
+            return;
+        }
+
+        echo $cachedData;
+
+        if ($toScreen === true && $interactive === false) {
+            Timing::printRunTime();
+        }
+
+    }//end generate()
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Reports/Csv.php

@@ -0,0 +1,92 @@
+<?php
+/**
+ * CSV report for PHP_CodeSniffer.
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Reports;
+
+use PHP_CodeSniffer\Files\File;
+
+class Csv implements Report
+{
+
+
+    /**
+     * Generate a partial report for a single processed file.
+     *
+     * Function should return TRUE if it printed or stored data about the file
+     * and FALSE if it ignored the file. Returning TRUE indicates that the file and
+     * its data should be counted in the grand totals.
+     *
+     * @param array<string, string|int|array> $report      Prepared report data.
+     *                                                     See the {@see Report} interface for a detailed specification.
+     * @param \PHP_CodeSniffer\Files\File     $phpcsFile   The file being reported on.
+     * @param bool                            $showSources Show sources?
+     * @param int                             $width       Maximum allowed line width.
+     *
+     * @return bool
+     */
+    public function generateFileReport($report, File $phpcsFile, $showSources=false, $width=80)
+    {
+        if ($report['errors'] === 0 && $report['warnings'] === 0) {
+            // Nothing to print.
+            return false;
+        }
+
+        foreach ($report['messages'] as $line => $lineErrors) {
+            foreach ($lineErrors as $column => $colErrors) {
+                foreach ($colErrors as $error) {
+                    $filename = str_replace('"', '\"', $report['filename']);
+                    $message  = str_replace('"', '\"', $error['message']);
+                    $type     = strtolower($error['type']);
+                    $source   = $error['source'];
+                    $severity = $error['severity'];
+                    $fixable  = (int) $error['fixable'];
+                    echo "\"$filename\",$line,$column,$type,\"$message\",$source,$severity,$fixable".PHP_EOL;
+                }
+            }
+        }
+
+        return true;
+
+    }//end generateFileReport()
+
+
+    /**
+     * Generates a csv report.
+     *
+     * @param string $cachedData    Any partial report data that was returned from
+     *                              generateFileReport during the run.
+     * @param int    $totalFiles    Total number of files processed during the run.
+     * @param int    $totalErrors   Total number of errors found during the run.
+     * @param int    $totalWarnings Total number of warnings found during the run.
+     * @param int    $totalFixable  Total number of problems that can be fixed.
+     * @param bool   $showSources   Show sources?
+     * @param int    $width         Maximum allowed line width.
+     * @param bool   $interactive   Are we running in interactive mode?
+     * @param bool   $toScreen      Is the report being printed to screen?
+     *
+     * @return void
+     */
+    public function generate(
+        $cachedData,
+        $totalFiles,
+        $totalErrors,
+        $totalWarnings,
+        $totalFixable,
+        $showSources=false,
+        $width=80,
+        $interactive=false,
+        $toScreen=true
+    ) {
+        echo 'File,Line,Column,Type,Message,Source,Severity,Fixable'.PHP_EOL;
+        echo $cachedData;
+
+    }//end generate()
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Reports/Diff.php

@@ -0,0 +1,131 @@
+<?php
+/**
+ * Diff report for PHP_CodeSniffer.
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Reports;
+
+use PHP_CodeSniffer\Files\File;
+
+class Diff implements Report
+{
+
+
+    /**
+     * Generate a partial report for a single processed file.
+     *
+     * Function should return TRUE if it printed or stored data about the file
+     * and FALSE if it ignored the file. Returning TRUE indicates that the file and
+     * its data should be counted in the grand totals.
+     *
+     * @param array<string, string|int|array> $report      Prepared report data.
+     *                                                     See the {@see Report} interface for a detailed specification.
+     * @param \PHP_CodeSniffer\Files\File     $phpcsFile   The file being reported on.
+     * @param bool                            $showSources Show sources?
+     * @param int                             $width       Maximum allowed line width.
+     *
+     * @return bool
+     */
+    public function generateFileReport($report, File $phpcsFile, $showSources=false, $width=80)
+    {
+        $errors = $phpcsFile->getFixableCount();
+        if ($errors === 0) {
+            return false;
+        }
+
+        $phpcsFile->disableCaching();
+        $tokens = $phpcsFile->getTokens();
+        if (empty($tokens) === true) {
+            if (PHP_CODESNIFFER_VERBOSITY === 1) {
+                $startTime = microtime(true);
+                echo 'DIFF report is parsing '.basename($report['filename']).' ';
+            } else if (PHP_CODESNIFFER_VERBOSITY > 1) {
+                echo 'DIFF report is forcing parse of '.$report['filename'].PHP_EOL;
+            }
+
+            $phpcsFile->parse();
+
+            if (PHP_CODESNIFFER_VERBOSITY === 1) {
+                $timeTaken = ((microtime(true) - $startTime) * 1000);
+                if ($timeTaken < 1000) {
+                    $timeTaken = round($timeTaken);
+                    echo "DONE in {$timeTaken}ms";
+                } else {
+                    $timeTaken = round(($timeTaken / 1000), 2);
+                    echo "DONE in $timeTaken secs";
+                }
+
+                echo PHP_EOL;
+            }
+
+            $phpcsFile->fixer->startFile($phpcsFile);
+        }//end if
+
+        if (PHP_CODESNIFFER_VERBOSITY > 1) {
+            ob_end_clean();
+            echo "\t*** START FILE FIXING ***".PHP_EOL;
+        }
+
+        $fixed = $phpcsFile->fixer->fixFile();
+
+        if (PHP_CODESNIFFER_VERBOSITY > 1) {
+            echo "\t*** END FILE FIXING ***".PHP_EOL;
+            ob_start();
+        }
+
+        if ($fixed === false) {
+            return false;
+        }
+
+        $diff = $phpcsFile->fixer->generateDiff();
+        if ($diff === '') {
+            // Nothing to print.
+            return false;
+        }
+
+        echo $diff.PHP_EOL;
+        return true;
+
+    }//end generateFileReport()
+
+
+    /**
+     * Prints all errors and warnings for each file processed.
+     *
+     * @param string $cachedData    Any partial report data that was returned from
+     *                              generateFileReport during the run.
+     * @param int    $totalFiles    Total number of files processed during the run.
+     * @param int    $totalErrors   Total number of errors found during the run.
+     * @param int    $totalWarnings Total number of warnings found during the run.
+     * @param int    $totalFixable  Total number of problems that can be fixed.
+     * @param bool   $showSources   Show sources?
+     * @param int    $width         Maximum allowed line width.
+     * @param bool   $interactive   Are we running in interactive mode?
+     * @param bool   $toScreen      Is the report being printed to screen?
+     *
+     * @return void
+     */
+    public function generate(
+        $cachedData,
+        $totalFiles,
+        $totalErrors,
+        $totalWarnings,
+        $totalFixable,
+        $showSources=false,
+        $width=80,
+        $interactive=false,
+        $toScreen=true
+    ) {
+        echo $cachedData;
+        if ($toScreen === true && $cachedData !== '') {
+            echo PHP_EOL;
+        }
+
+    }//end generate()
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Reports/Emacs.php

@@ -0,0 +1,91 @@
+<?php
+/**
+ * Emacs report for PHP_CodeSniffer.
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Reports;
+
+use PHP_CodeSniffer\Files\File;
+
+class Emacs implements Report
+{
+
+
+    /**
+     * Generate a partial report for a single processed file.
+     *
+     * Function should return TRUE if it printed or stored data about the file
+     * and FALSE if it ignored the file. Returning TRUE indicates that the file and
+     * its data should be counted in the grand totals.
+     *
+     * @param array<string, string|int|array> $report      Prepared report data.
+     *                                                     See the {@see Report} interface for a detailed specification.
+     * @param \PHP_CodeSniffer\Files\File     $phpcsFile   The file being reported on.
+     * @param bool                            $showSources Show sources?
+     * @param int                             $width       Maximum allowed line width.
+     *
+     * @return bool
+     */
+    public function generateFileReport($report, File $phpcsFile, $showSources=false, $width=80)
+    {
+        if ($report['errors'] === 0 && $report['warnings'] === 0) {
+            // Nothing to print.
+            return false;
+        }
+
+        foreach ($report['messages'] as $line => $lineErrors) {
+            foreach ($lineErrors as $column => $colErrors) {
+                foreach ($colErrors as $error) {
+                    $message = $error['message'];
+                    if ($showSources === true) {
+                        $message .= ' ('.$error['source'].')';
+                    }
+
+                    $type = strtolower($error['type']);
+                    echo $report['filename'].':'.$line.':'.$column.': '.$type.' - '.$message.PHP_EOL;
+                }
+            }
+        }
+
+        return true;
+
+    }//end generateFileReport()
+
+
+    /**
+     * Generates an emacs report.
+     *
+     * @param string $cachedData    Any partial report data that was returned from
+     *                              generateFileReport during the run.
+     * @param int    $totalFiles    Total number of files processed during the run.
+     * @param int    $totalErrors   Total number of errors found during the run.
+     * @param int    $totalWarnings Total number of warnings found during the run.
+     * @param int    $totalFixable  Total number of problems that can be fixed.
+     * @param bool   $showSources   Show sources?
+     * @param int    $width         Maximum allowed line width.
+     * @param bool   $interactive   Are we running in interactive mode?
+     * @param bool   $toScreen      Is the report being printed to screen?
+     *
+     * @return void
+     */
+    public function generate(
+        $cachedData,
+        $totalFiles,
+        $totalErrors,
+        $totalWarnings,
+        $totalFixable,
+        $showSources=false,
+        $width=80,
+        $interactive=false,
+        $toScreen=true
+    ) {
+        echo $cachedData;
+
+    }//end generate()
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Reports/Full.php

@@ -0,0 +1,260 @@
+<?php
+/**
+ * Full report for PHP_CodeSniffer.
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Reports;
+
+use PHP_CodeSniffer\Files\File;
+use PHP_CodeSniffer\Util\Timing;
+
+class Full implements Report
+{
+
+
+    /**
+     * Generate a partial report for a single processed file.
+     *
+     * Function should return TRUE if it printed or stored data about the file
+     * and FALSE if it ignored the file. Returning TRUE indicates that the file and
+     * its data should be counted in the grand totals.
+     *
+     * @param array<string, string|int|array> $report      Prepared report data.
+     *                                                     See the {@see Report} interface for a detailed specification.
+     * @param \PHP_CodeSniffer\Files\File     $phpcsFile   The file being reported on.
+     * @param bool                            $showSources Show sources?
+     * @param int                             $width       Maximum allowed line width.
+     *
+     * @return bool
+     */
+    public function generateFileReport($report, File $phpcsFile, $showSources=false, $width=80)
+    {
+        if ($report['errors'] === 0 && $report['warnings'] === 0) {
+            // Nothing to print.
+            return false;
+        }
+
+        // The length of the word ERROR or WARNING; used for padding.
+        if ($report['warnings'] > 0) {
+            $typeLength = 7;
+        } else {
+            $typeLength = 5;
+        }
+
+        // Work out the max line number length for formatting.
+        $maxLineNumLength = max(array_map('strlen', array_keys($report['messages'])));
+
+        // The padding that all lines will require that are
+        // printing an error message overflow.
+        $paddingLine2  = str_repeat(' ', ($maxLineNumLength + 1));
+        $paddingLine2 .= ' | ';
+        $paddingLine2 .= str_repeat(' ', $typeLength);
+        $paddingLine2 .= ' | ';
+        if ($report['fixable'] > 0) {
+            $paddingLine2 .= '    ';
+        }
+
+        $paddingLength = strlen($paddingLine2);
+
+        // Make sure the report width isn't too big.
+        $maxErrorLength = 0;
+        foreach ($report['messages'] as $lineErrors) {
+            foreach ($lineErrors as $colErrors) {
+                foreach ($colErrors as $error) {
+                    // Start with the presumption of a single line error message.
+                    $length    = strlen($error['message']);
+                    $srcLength = (strlen($error['source']) + 3);
+                    if ($showSources === true) {
+                        $length += $srcLength;
+                    }
+
+                    // ... but also handle multi-line messages correctly.
+                    if (strpos($error['message'], "\n") !== false) {
+                        $errorLines = explode("\n", $error['message']);
+                        $length     = max(array_map('strlen', $errorLines));
+
+                        if ($showSources === true) {
+                            $lastLine = array_pop($errorLines);
+                            $length   = max($length, (strlen($lastLine) + $srcLength));
+                        }
+                    }
+
+                    $maxErrorLength = max($maxErrorLength, ($length + 1));
+                }//end foreach
+            }//end foreach
+        }//end foreach
+
+        $file       = $report['filename'];
+        $fileLength = strlen($file);
+        $maxWidth   = max(($fileLength + 6), ($maxErrorLength + $paddingLength));
+        $width      = min($width, $maxWidth);
+        if ($width < 70) {
+            $width = 70;
+        }
+
+        echo PHP_EOL."\033[1mFILE: ";
+        if ($fileLength <= ($width - 6)) {
+            echo $file;
+        } else {
+            echo '...'.substr($file, ($fileLength - ($width - 6)));
+        }
+
+        echo "\033[0m".PHP_EOL;
+        echo str_repeat('-', $width).PHP_EOL;
+
+        echo "\033[1m".'FOUND '.$report['errors'].' ERROR';
+        if ($report['errors'] !== 1) {
+            echo 'S';
+        }
+
+        if ($report['warnings'] > 0) {
+            echo ' AND '.$report['warnings'].' WARNING';
+            if ($report['warnings'] !== 1) {
+                echo 'S';
+            }
+        }
+
+        echo ' AFFECTING '.count($report['messages']).' LINE';
+        if (count($report['messages']) !== 1) {
+            echo 'S';
+        }
+
+        echo "\033[0m".PHP_EOL;
+        echo str_repeat('-', $width).PHP_EOL;
+
+        // The maximum amount of space an error message can use.
+        $maxErrorSpace = ($width - $paddingLength - 1);
+
+        $beforeMsg = '';
+        $afterMsg  = '';
+        if ($showSources === true) {
+            $beforeMsg = "\033[1m";
+            $afterMsg  = "\033[0m";
+        }
+
+        $beforeAfterLength = strlen($beforeMsg.$afterMsg);
+
+        foreach ($report['messages'] as $line => $lineErrors) {
+            foreach ($lineErrors as $colErrors) {
+                foreach ($colErrors as $error) {
+                    $errorMsg = wordwrap(
+                        $error['message'],
+                        $maxErrorSpace
+                    );
+
+                    // Add the padding _after_ the wordwrap as the message itself may contain line breaks
+                    // and those lines will also need to receive padding.
+                    $errorMsg = str_replace("\n", $afterMsg.PHP_EOL.$paddingLine2.$beforeMsg, $errorMsg);
+                    $errorMsg = $beforeMsg.$errorMsg.$afterMsg;
+
+                    if ($showSources === true) {
+                        $lastMsg          = $errorMsg;
+                        $startPosLastLine = strrpos($errorMsg, PHP_EOL.$paddingLine2.$beforeMsg);
+                        if ($startPosLastLine !== false) {
+                            // Message is multiline. Grab the text of last line of the message, including the color codes.
+                            $lastMsg = substr($errorMsg, ($startPosLastLine + strlen(PHP_EOL.$paddingLine2)));
+                        }
+
+                        // When show sources is used, the message itself will be bolded, so we need to correct the length.
+                        $sourceSuffix = '('.$error['source'].')';
+
+                        $lastMsgPlusSourceLength = strlen($lastMsg);
+                        // Add space + source suffix length.
+                        $lastMsgPlusSourceLength += (1 + strlen($sourceSuffix));
+                        // Correct for the color codes.
+                        $lastMsgPlusSourceLength -= $beforeAfterLength;
+
+                        if ($lastMsgPlusSourceLength > $maxErrorSpace) {
+                            $errorMsg .= PHP_EOL.$paddingLine2.$sourceSuffix;
+                        } else {
+                            $errorMsg .= ' '.$sourceSuffix;
+                        }
+                    }//end if
+
+                    // The padding that goes on the front of the line.
+                    $padding = ($maxLineNumLength - strlen($line));
+
+                    echo ' '.str_repeat(' ', $padding).$line.' | ';
+                    if ($error['type'] === 'ERROR') {
+                        echo "\033[31mERROR\033[0m";
+                        if ($report['warnings'] > 0) {
+                            echo '  ';
+                        }
+                    } else {
+                        echo "\033[33mWARNING\033[0m";
+                    }
+
+                    echo ' | ';
+                    if ($report['fixable'] > 0) {
+                        echo '[';
+                        if ($error['fixable'] === true) {
+                            echo 'x';
+                        } else {
+                            echo ' ';
+                        }
+
+                        echo '] ';
+                    }
+
+                    echo $errorMsg.PHP_EOL;
+                }//end foreach
+            }//end foreach
+        }//end foreach
+
+        echo str_repeat('-', $width).PHP_EOL;
+        if ($report['fixable'] > 0) {
+            echo "\033[1m".'PHPCBF CAN FIX THE '.$report['fixable'].' MARKED SNIFF VIOLATIONS AUTOMATICALLY'."\033[0m".PHP_EOL;
+            echo str_repeat('-', $width).PHP_EOL;
+        }
+
+        echo PHP_EOL;
+        return true;
+
+    }//end generateFileReport()
+
+
+    /**
+     * Prints all errors and warnings for each file processed.
+     *
+     * @param string $cachedData    Any partial report data that was returned from
+     *                              generateFileReport during the run.
+     * @param int    $totalFiles    Total number of files processed during the run.
+     * @param int    $totalErrors   Total number of errors found during the run.
+     * @param int    $totalWarnings Total number of warnings found during the run.
+     * @param int    $totalFixable  Total number of problems that can be fixed.
+     * @param bool   $showSources   Show sources?
+     * @param int    $width         Maximum allowed line width.
+     * @param bool   $interactive   Are we running in interactive mode?
+     * @param bool   $toScreen      Is the report being printed to screen?
+     *
+     * @return void
+     */
+    public function generate(
+        $cachedData,
+        $totalFiles,
+        $totalErrors,
+        $totalWarnings,
+        $totalFixable,
+        $showSources=false,
+        $width=80,
+        $interactive=false,
+        $toScreen=true
+    ) {
+        if ($cachedData === '') {
+            return;
+        }
+
+        echo $cachedData;
+
+        if ($toScreen === true && $interactive === false) {
+            Timing::printRunTime();
+        }
+
+    }//end generate()
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Reports/Gitblame.php

@@ -0,0 +1,91 @@
+<?php
+/**
+ * Git blame report for PHP_CodeSniffer.
+ *
+ * @author    Ben Selby <benmatselby@gmail.com>
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Reports;
+
+use PHP_CodeSniffer\Exceptions\DeepExitException;
+
+class Gitblame extends VersionControl
+{
+
+    /**
+     * The name of the report we want in the output
+     *
+     * @var string
+     */
+    protected $reportName = 'GIT';
+
+
+    /**
+     * Extract the author from a blame line.
+     *
+     * @param string $line Line to parse.
+     *
+     * @return mixed string or false if impossible to recover.
+     */
+    protected function getAuthor($line)
+    {
+        $blameParts = [];
+        $line       = preg_replace('|\s+|', ' ', $line);
+        preg_match(
+            '|\(.+[0-9]{4}-[0-9]{2}-[0-9]{2}\s+[0-9]+\)|',
+            $line,
+            $blameParts
+        );
+
+        if (isset($blameParts[0]) === false) {
+            return false;
+        }
+
+        $parts = explode(' ', $blameParts[0]);
+
+        if (count($parts) < 2) {
+            return false;
+        }
+
+        $parts  = array_slice($parts, 0, (count($parts) - 2));
+        $author = preg_replace('|\(|', '', implode(' ', $parts));
+        return $author;
+
+    }//end getAuthor()
+
+
+    /**
+     * Gets the blame output.
+     *
+     * @param string $filename File to blame.
+     *
+     * @return array
+     * @throws \PHP_CodeSniffer\Exceptions\DeepExitException
+     */
+    protected function getBlameContent($filename)
+    {
+        $cwd = getcwd();
+
+        chdir(dirname($filename));
+        $command = 'git blame --date=short "'.basename($filename).'" 2>&1';
+        $handle  = popen($command, 'r');
+        if ($handle === false) {
+            $error = 'ERROR: Could not execute "'.$command.'"'.PHP_EOL.PHP_EOL;
+            throw new DeepExitException($error, 3);
+        }
+
+        $rawContent = stream_get_contents($handle);
+        pclose($handle);
+
+        $blames = explode("\n", $rawContent);
+        chdir($cwd);
+
+        return $blames;
+
+    }//end getBlameContent()
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Reports/Hgblame.php

@@ -0,0 +1,110 @@
+<?php
+/**
+ * Mercurial blame report for PHP_CodeSniffer.
+ *
+ * @author    Ben Selby <benmatselby@gmail.com>
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Reports;
+
+use PHP_CodeSniffer\Exceptions\DeepExitException;
+
+class Hgblame extends VersionControl
+{
+
+    /**
+     * The name of the report we want in the output
+     *
+     * @var string
+     */
+    protected $reportName = 'MERCURIAL';
+
+
+    /**
+     * Extract the author from a blame line.
+     *
+     * @param string $line Line to parse.
+     *
+     * @return string|false String or FALSE if impossible to recover.
+     */
+    protected function getAuthor($line)
+    {
+        $blameParts = [];
+        $line       = preg_replace('|\s+|', ' ', $line);
+
+        preg_match(
+            '|(.+[0-9]{2}:[0-9]{2}:[0-9]{2}\s[0-9]{4}\s.[0-9]{4}:)|',
+            $line,
+            $blameParts
+        );
+
+        if (isset($blameParts[0]) === false) {
+            return false;
+        }
+
+        $parts = explode(' ', $blameParts[0]);
+
+        if (count($parts) < 6) {
+            return false;
+        }
+
+        $parts = array_slice($parts, 0, (count($parts) - 6));
+
+        return trim(preg_replace('|<.+>|', '', implode(' ', $parts)));
+
+    }//end getAuthor()
+
+
+    /**
+     * Gets the blame output.
+     *
+     * @param string $filename File to blame.
+     *
+     * @return array
+     * @throws \PHP_CodeSniffer\Exceptions\DeepExitException
+     */
+    protected function getBlameContent($filename)
+    {
+        $cwd = getcwd();
+
+        $fileParts = explode(DIRECTORY_SEPARATOR, $filename);
+        $found     = false;
+        $location  = '';
+        while (empty($fileParts) === false) {
+            array_pop($fileParts);
+            $location = implode(DIRECTORY_SEPARATOR, $fileParts);
+            if (is_dir($location.DIRECTORY_SEPARATOR.'.hg') === true) {
+                $found = true;
+                break;
+            }
+        }
+
+        if ($found === true) {
+            chdir($location);
+        } else {
+            $error = 'ERROR: Could not locate .hg directory '.PHP_EOL.PHP_EOL;
+            throw new DeepExitException($error, 3);
+        }
+
+        $command = 'hg blame -u -d -v "'.$filename.'" 2>&1';
+        $handle  = popen($command, 'r');
+        if ($handle === false) {
+            $error = 'ERROR: Could not execute "'.$command.'"'.PHP_EOL.PHP_EOL;
+            throw new DeepExitException($error, 3);
+        }
+
+        $rawContent = stream_get_contents($handle);
+        pclose($handle);
+
+        $blames = explode("\n", $rawContent);
+        chdir($cwd);
+
+        return $blames;
+
+    }//end getBlameContent()
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Reports/Info.php

@@ -0,0 +1,173 @@
+<?php
+/**
+ * Info report for PHP_CodeSniffer.
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Reports;
+
+use PHP_CodeSniffer\Files\File;
+use PHP_CodeSniffer\Util\Timing;
+
+class Info implements Report
+{
+
+
+    /**
+     * Generate a partial report for a single processed file.
+     *
+     * Function should return TRUE if it printed or stored data about the file
+     * and FALSE if it ignored the file. Returning TRUE indicates that the file and
+     * its data should be counted in the grand totals.
+     *
+     * @param array<string, string|int|array> $report      Prepared report data.
+     *                                                     See the {@see Report} interface for a detailed specification.
+     * @param \PHP_CodeSniffer\Files\File     $phpcsFile   The file being reported on.
+     * @param bool                            $showSources Show sources?
+     * @param int                             $width       Maximum allowed line width.
+     *
+     * @return bool
+     */
+    public function generateFileReport($report, File $phpcsFile, $showSources=false, $width=80)
+    {
+        $metrics = $phpcsFile->getMetrics();
+        foreach ($metrics as $metric => $data) {
+            foreach ($data['values'] as $value => $count) {
+                echo "$metric>>$value>>$count".PHP_EOL;
+            }
+        }
+
+        return true;
+
+    }//end generateFileReport()
+
+
+    /**
+     * Prints the recorded metrics.
+     *
+     * @param string $cachedData    Any partial report data that was returned from
+     *                              generateFileReport during the run.
+     * @param int    $totalFiles    Total number of files processed during the run.
+     * @param int    $totalErrors   Total number of errors found during the run.
+     * @param int    $totalWarnings Total number of warnings found during the run.
+     * @param int    $totalFixable  Total number of problems that can be fixed.
+     * @param bool   $showSources   Show sources?
+     * @param int    $width         Maximum allowed line width.
+     * @param bool   $interactive   Are we running in interactive mode?
+     * @param bool   $toScreen      Is the report being printed to screen?
+     *
+     * @return void
+     */
+    public function generate(
+        $cachedData,
+        $totalFiles,
+        $totalErrors,
+        $totalWarnings,
+        $totalFixable,
+        $showSources=false,
+        $width=80,
+        $interactive=false,
+        $toScreen=true
+    ) {
+        $lines = explode(PHP_EOL, $cachedData);
+        array_pop($lines);
+
+        if (empty($lines) === true) {
+            return;
+        }
+
+        $metrics = [];
+        foreach ($lines as $line) {
+            $parts  = explode('>>', $line);
+            $metric = $parts[0];
+            $value  = $parts[1];
+            $count  = $parts[2];
+            if (isset($metrics[$metric]) === false) {
+                $metrics[$metric] = [];
+            }
+
+            if (isset($metrics[$metric][$value]) === false) {
+                $metrics[$metric][$value] = $count;
+            } else {
+                $metrics[$metric][$value] += $count;
+            }
+        }
+
+        ksort($metrics);
+
+        echo PHP_EOL."\033[1m".'PHP CODE SNIFFER INFORMATION REPORT'."\033[0m".PHP_EOL;
+        echo str_repeat('-', 70).PHP_EOL;
+
+        foreach ($metrics as $metric => $values) {
+            if (count($values) === 1) {
+                $count = reset($values);
+                $value = key($values);
+
+                echo "$metric: \033[4m$value\033[0m [$count/$count, 100%]".PHP_EOL;
+            } else {
+                $totalCount = 0;
+                $valueWidth = 0;
+                foreach ($values as $value => $count) {
+                    $totalCount += $count;
+                    $valueWidth  = max($valueWidth, strlen($value));
+                }
+
+                // Length of the total string, plus however many
+                // thousands separators there are.
+                $countWidth = strlen($totalCount);
+                $thousandSeparatorCount = floor($countWidth / 3);
+                $countWidth            += $thousandSeparatorCount;
+
+                // Account for 'total' line.
+                $valueWidth = max(5, $valueWidth);
+
+                echo "$metric:".PHP_EOL;
+
+                ksort($values, SORT_NATURAL);
+                arsort($values);
+
+                $percentPrefixWidth = 0;
+                $percentWidth       = 6;
+                foreach ($values as $value => $count) {
+                    $percent       = round(($count / $totalCount * 100), 2);
+                    $percentPrefix = '';
+                    if ($percent === 0.00) {
+                        $percent            = 0.01;
+                        $percentPrefix      = '<';
+                        $percentPrefixWidth = 2;
+                        $percentWidth       = 4;
+                    }
+
+                    printf(
+                        "\t%-{$valueWidth}s => %{$countWidth}s (%{$percentPrefixWidth}s%{$percentWidth}.2f%%)".PHP_EOL,
+                        $value,
+                        number_format($count),
+                        $percentPrefix,
+                        $percent
+                    );
+                }
+
+                echo "\t".str_repeat('-', ($valueWidth + $countWidth + 15)).PHP_EOL;
+                printf(
+                    "\t%-{$valueWidth}s => %{$countWidth}s (100.00%%)".PHP_EOL,
+                    'total',
+                    number_format($totalCount)
+                );
+            }//end if
+
+            echo PHP_EOL;
+        }//end foreach
+
+        echo str_repeat('-', 70).PHP_EOL;
+
+        if ($toScreen === true && $interactive === false) {
+            Timing::printRunTime();
+        }
+
+    }//end generate()
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Reports/Json.php

@@ -0,0 +1,107 @@
+<?php
+/**
+ * JSON report for PHP_CodeSniffer.
+ *
+ * @author    Jeffrey Fisher <jeffslofish@gmail.com>
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Reports;
+
+use PHP_CodeSniffer\Files\File;
+
+class Json implements Report
+{
+
+
+    /**
+     * Generate a partial report for a single processed file.
+     *
+     * Function should return TRUE if it printed or stored data about the file
+     * and FALSE if it ignored the file. Returning TRUE indicates that the file and
+     * its data should be counted in the grand totals.
+     *
+     * @param array<string, string|int|array> $report      Prepared report data.
+     *                                                     See the {@see Report} interface for a detailed specification.
+     * @param \PHP_CodeSniffer\Files\File     $phpcsFile   The file being reported on.
+     * @param bool                            $showSources Show sources?
+     * @param int                             $width       Maximum allowed line width.
+     *
+     * @return bool
+     */
+    public function generateFileReport($report, File $phpcsFile, $showSources=false, $width=80)
+    {
+        $filename = str_replace('\\', '\\\\', $report['filename']);
+        $filename = str_replace('"', '\"', $filename);
+        $filename = str_replace('/', '\/', $filename);
+        echo '"'.$filename.'":{';
+        echo '"errors":'.$report['errors'].',"warnings":'.$report['warnings'].',"messages":[';
+
+        $messages = '';
+        foreach ($report['messages'] as $line => $lineErrors) {
+            foreach ($lineErrors as $column => $colErrors) {
+                foreach ($colErrors as $error) {
+                    $error['message'] = str_replace("\n", '\n', $error['message']);
+                    $error['message'] = str_replace("\r", '\r', $error['message']);
+                    $error['message'] = str_replace("\t", '\t', $error['message']);
+
+                    $fixable = false;
+                    if ($error['fixable'] === true) {
+                        $fixable = true;
+                    }
+
+                    $messagesObject          = (object) $error;
+                    $messagesObject->line    = $line;
+                    $messagesObject->column  = $column;
+                    $messagesObject->fixable = $fixable;
+
+                    $messages .= json_encode($messagesObject).",";
+                }
+            }
+        }//end foreach
+
+        echo rtrim($messages, ',');
+        echo ']},';
+
+        return true;
+
+    }//end generateFileReport()
+
+
+    /**
+     * Generates a JSON report.
+     *
+     * @param string $cachedData    Any partial report data that was returned from
+     *                              generateFileReport during the run.
+     * @param int    $totalFiles    Total number of files processed during the run.
+     * @param int    $totalErrors   Total number of errors found during the run.
+     * @param int    $totalWarnings Total number of warnings found during the run.
+     * @param int    $totalFixable  Total number of problems that can be fixed.
+     * @param bool   $showSources   Show sources?
+     * @param int    $width         Maximum allowed line width.
+     * @param bool   $interactive   Are we running in interactive mode?
+     * @param bool   $toScreen      Is the report being printed to screen?
+     *
+     * @return void
+     */
+    public function generate(
+        $cachedData,
+        $totalFiles,
+        $totalErrors,
+        $totalWarnings,
+        $totalFixable,
+        $showSources=false,
+        $width=80,
+        $interactive=false,
+        $toScreen=true
+    ) {
+        echo '{"totals":{"errors":'.$totalErrors.',"warnings":'.$totalWarnings.',"fixable":'.$totalFixable.'},"files":{';
+        echo rtrim($cachedData, ',');
+        echo "}}".PHP_EOL;
+
+    }//end generate()
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Reports/Junit.php

@@ -0,0 +1,133 @@
+<?php
+/**
+ * JUnit report for PHP_CodeSniffer.
+ *
+ * @author    Oleg Lobach <oleg@lobach.info>
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Reports;
+
+use PHP_CodeSniffer\Config;
+use PHP_CodeSniffer\Files\File;
+use XMLWriter;
+
+class Junit implements Report
+{
+
+
+    /**
+     * Generate a partial report for a single processed file.
+     *
+     * Function should return TRUE if it printed or stored data about the file
+     * and FALSE if it ignored the file. Returning TRUE indicates that the file and
+     * its data should be counted in the grand totals.
+     *
+     * @param array<string, string|int|array> $report      Prepared report data.
+     *                                                     See the {@see Report} interface for a detailed specification.
+     * @param \PHP_CodeSniffer\Files\File     $phpcsFile   The file being reported on.
+     * @param bool                            $showSources Show sources?
+     * @param int                             $width       Maximum allowed line width.
+     *
+     * @return bool
+     */
+    public function generateFileReport($report, File $phpcsFile, $showSources=false, $width=80)
+    {
+        $out = new XMLWriter;
+        $out->openMemory();
+        $out->setIndent(true);
+
+        $out->startElement('testsuite');
+        $out->writeAttribute('name', $report['filename']);
+        $out->writeAttribute('errors', 0);
+
+        if (count($report['messages']) === 0) {
+            $out->writeAttribute('tests', 1);
+            $out->writeAttribute('failures', 0);
+
+            $out->startElement('testcase');
+            $out->writeAttribute('name', $report['filename']);
+            $out->endElement();
+        } else {
+            $failures = ($report['errors'] + $report['warnings']);
+            $out->writeAttribute('tests', $failures);
+            $out->writeAttribute('failures', $failures);
+
+            foreach ($report['messages'] as $line => $lineErrors) {
+                foreach ($lineErrors as $column => $colErrors) {
+                    foreach ($colErrors as $error) {
+                        $out->startElement('testcase');
+                        $out->writeAttribute('name', $error['source'].' at '.$report['filename']." ($line:$column)");
+
+                        $error['type'] = strtolower($error['type']);
+                        if ($phpcsFile->config->encoding !== 'utf-8') {
+                            $error['message'] = iconv($phpcsFile->config->encoding, 'utf-8', $error['message']);
+                        }
+
+                        $out->startElement('failure');
+                        $out->writeAttribute('type', $error['type']);
+                        $out->writeAttribute('message', $error['message']);
+                        $out->endElement();
+
+                        $out->endElement();
+                    }
+                }
+            }
+        }//end if
+
+        $out->endElement();
+        echo $out->flush();
+        return true;
+
+    }//end generateFileReport()
+
+
+    /**
+     * Prints all violations for processed files, in a proprietary XML format.
+     *
+     * @param string $cachedData    Any partial report data that was returned from
+     *                              generateFileReport during the run.
+     * @param int    $totalFiles    Total number of files processed during the run.
+     * @param int    $totalErrors   Total number of errors found during the run.
+     * @param int    $totalWarnings Total number of warnings found during the run.
+     * @param int    $totalFixable  Total number of problems that can be fixed.
+     * @param bool   $showSources   Show sources?
+     * @param int    $width         Maximum allowed line width.
+     * @param bool   $interactive   Are we running in interactive mode?
+     * @param bool   $toScreen      Is the report being printed to screen?
+     *
+     * @return void
+     */
+    public function generate(
+        $cachedData,
+        $totalFiles,
+        $totalErrors,
+        $totalWarnings,
+        $totalFixable,
+        $showSources=false,
+        $width=80,
+        $interactive=false,
+        $toScreen=true
+    ) {
+        // Figure out the total number of tests.
+        $tests   = 0;
+        $matches = [];
+        preg_match_all('/tests="([0-9]+)"/', $cachedData, $matches);
+        if (isset($matches[1]) === true) {
+            foreach ($matches[1] as $match) {
+                $tests += $match;
+            }
+        }
+
+        $failures = ($totalErrors + $totalWarnings);
+        echo '<?xml version="1.0" encoding="UTF-8"?>'.PHP_EOL;
+        echo '<testsuites name="PHP_CodeSniffer '.Config::VERSION.'" errors="0" tests="'.$tests.'" failures="'.$failures.'">'.PHP_EOL;
+        echo $cachedData;
+        echo '</testsuites>'.PHP_EOL;
+
+    }//end generate()
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Reports/Notifysend.php

@@ -0,0 +1,243 @@
+<?php
+/**
+ * Notify-send report for PHP_CodeSniffer.
+ *
+ * Supported configuration parameters:
+ * - notifysend_path    - Full path to notify-send cli command
+ * - notifysend_timeout - Timeout in milliseconds
+ * - notifysend_showok  - Show "ok, all fine" messages (0/1)
+ *
+ * @author    Christian Weiske <christian.weiske@netresearch.de>
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2012-2014 Christian Weiske
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Reports;
+
+use PHP_CodeSniffer\Config;
+use PHP_CodeSniffer\Files\File;
+use PHP_CodeSniffer\Util\Common;
+
+class Notifysend implements Report
+{
+
+    /**
+     * Notification timeout in milliseconds.
+     *
+     * @var integer
+     */
+    protected $timeout = 3000;
+
+    /**
+     * Path to notify-send command.
+     *
+     * @var string
+     */
+    protected $path = 'notify-send';
+
+    /**
+     * Show "ok, all fine" messages.
+     *
+     * @var boolean
+     */
+    protected $showOk = true;
+
+    /**
+     * Version of installed notify-send executable.
+     *
+     * @var string
+     */
+    protected $version = null;
+
+
+    /**
+     * Load configuration data.
+     */
+    public function __construct()
+    {
+        $path = Config::getExecutablePath('notifysend');
+        if ($path !== null) {
+            $this->path = Common::escapeshellcmd($path);
+        }
+
+        $timeout = Config::getConfigData('notifysend_timeout');
+        if ($timeout !== null) {
+            $this->timeout = (int) $timeout;
+        }
+
+        $showOk = Config::getConfigData('notifysend_showok');
+        if ($showOk !== null) {
+            $this->showOk = (bool) $showOk;
+        }
+
+        $this->version = str_replace(
+            'notify-send ',
+            '',
+            exec($this->path.' --version')
+        );
+
+    }//end __construct()
+
+
+    /**
+     * Generate a partial report for a single processed file.
+     *
+     * Function should return TRUE if it printed or stored data about the file
+     * and FALSE if it ignored the file. Returning TRUE indicates that the file and
+     * its data should be counted in the grand totals.
+     *
+     * @param array<string, string|int|array> $report      Prepared report data.
+     *                                                     See the {@see Report} interface for a detailed specification.
+     * @param \PHP_CodeSniffer\Files\File     $phpcsFile   The file being reported on.
+     * @param bool                            $showSources Show sources?
+     * @param int                             $width       Maximum allowed line width.
+     *
+     * @return bool
+     */
+    public function generateFileReport($report, File $phpcsFile, $showSources=false, $width=80)
+    {
+        echo $report['filename'].PHP_EOL;
+
+        // We want this file counted in the total number
+        // of checked files even if it has no errors.
+        return true;
+
+    }//end generateFileReport()
+
+
+    /**
+     * Generates a summary of errors and warnings for each file processed.
+     *
+     * @param string $cachedData    Any partial report data that was returned from
+     *                              generateFileReport during the run.
+     * @param int    $totalFiles    Total number of files processed during the run.
+     * @param int    $totalErrors   Total number of errors found during the run.
+     * @param int    $totalWarnings Total number of warnings found during the run.
+     * @param int    $totalFixable  Total number of problems that can be fixed.
+     * @param bool   $showSources   Show sources?
+     * @param int    $width         Maximum allowed line width.
+     * @param bool   $interactive   Are we running in interactive mode?
+     * @param bool   $toScreen      Is the report being printed to screen?
+     *
+     * @return void
+     */
+    public function generate(
+        $cachedData,
+        $totalFiles,
+        $totalErrors,
+        $totalWarnings,
+        $totalFixable,
+        $showSources=false,
+        $width=80,
+        $interactive=false,
+        $toScreen=true
+    ) {
+        $checkedFiles = explode(PHP_EOL, trim($cachedData));
+
+        $msg = $this->generateMessage($checkedFiles, $totalErrors, $totalWarnings);
+        if ($msg === null) {
+            if ($this->showOk === true) {
+                $this->notifyAllFine();
+            }
+        } else {
+            $this->notifyErrors($msg);
+        }
+
+    }//end generate()
+
+
+    /**
+     * Generate the error message to show to the user.
+     *
+     * @param string[] $checkedFiles  The files checked during the run.
+     * @param int      $totalErrors   Total number of errors found during the run.
+     * @param int      $totalWarnings Total number of warnings found during the run.
+     *
+     * @return string|null Error message or NULL if no error/warning found.
+     */
+    protected function generateMessage($checkedFiles, $totalErrors, $totalWarnings)
+    {
+        if ($totalErrors === 0 && $totalWarnings === 0) {
+            // Nothing to print.
+            return null;
+        }
+
+        $totalFiles = count($checkedFiles);
+
+        $msg = '';
+        if ($totalFiles > 1) {
+            $msg .= 'Checked '.$totalFiles.' files'.PHP_EOL;
+        } else {
+            $msg .= $checkedFiles[0].PHP_EOL;
+        }
+
+        if ($totalWarnings > 0) {
+            $msg .= $totalWarnings.' warnings'.PHP_EOL;
+        }
+
+        if ($totalErrors > 0) {
+            $msg .= $totalErrors.' errors'.PHP_EOL;
+        }
+
+        return $msg;
+
+    }//end generateMessage()
+
+
+    /**
+     * Tell the user that all is fine and no error/warning has been found.
+     *
+     * @return void
+     */
+    protected function notifyAllFine()
+    {
+        $cmd  = $this->getBasicCommand();
+        $cmd .= ' -i info';
+        $cmd .= ' "PHP CodeSniffer: Ok"';
+        $cmd .= ' "All fine"';
+        exec($cmd);
+
+    }//end notifyAllFine()
+
+
+    /**
+     * Tell the user that errors/warnings have been found.
+     *
+     * @param string $msg Message to display.
+     *
+     * @return void
+     */
+    protected function notifyErrors($msg)
+    {
+        $cmd  = $this->getBasicCommand();
+        $cmd .= ' -i error';
+        $cmd .= ' "PHP CodeSniffer: Error"';
+        $cmd .= ' '.escapeshellarg(trim($msg));
+        exec($cmd);
+
+    }//end notifyErrors()
+
+
+    /**
+     * Generate and return the basic notify-send command string to execute.
+     *
+     * @return string Shell command with common parameters.
+     */
+    protected function getBasicCommand()
+    {
+        $cmd  = $this->path;
+        $cmd .= ' --category dev.validate';
+        $cmd .= ' -h int:transient:1';
+        $cmd .= ' -t '.(int) $this->timeout;
+        if (version_compare($this->version, '0.7.3', '>=') === true) {
+            $cmd .= ' -a phpcs';
+        }
+
+        return $cmd;
+
+    }//end getBasicCommand()
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Reports/Performance.php

@@ -0,0 +1,161 @@
+<?php
+/**
+ * Performance report for PHP_CodeSniffer.
+ *
+ * @author    Juliette Reinders Folmer <phpcs_nospam@adviesenzo.nl>
+ * @copyright 2023 Juliette Reinders Folmer. All rights reserved.
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Reports;
+
+use PHP_CodeSniffer\Files\File;
+use PHP_CodeSniffer\Util\Common;
+use PHP_CodeSniffer\Util\Timing;
+
+class Performance implements Report
+{
+
+
+    /**
+     * Generate a partial report for a single processed file.
+     *
+     * Function should return TRUE if it printed or stored data about the file
+     * and FALSE if it ignored the file. Returning TRUE indicates that the file and
+     * its data should be counted in the grand totals.
+     *
+     * @param array<string, string|int|array> $report      Prepared report data.
+     *                                                     See the {@see Report} interface for a detailed specification.
+     * @param \PHP_CodeSniffer\Files\File     $phpcsFile   The file being reported on.
+     * @param bool                            $showSources Show sources?
+     * @param int                             $width       Maximum allowed line width.
+     *
+     * @return bool
+     */
+    public function generateFileReport($report, File $phpcsFile, $showSources=false, $width=80)
+    {
+        $times = $phpcsFile->getListenerTimes();
+        foreach ($times as $sniff => $time) {
+            echo "$sniff>>$time".PHP_EOL;
+        }
+
+        return true;
+
+    }//end generateFileReport()
+
+
+    /**
+     * Prints the sniff performance report.
+     *
+     * @param string $cachedData    Any partial report data that was returned from
+     *                              generateFileReport during the run.
+     * @param int    $totalFiles    Total number of files processed during the run.
+     * @param int    $totalErrors   Total number of errors found during the run.
+     * @param int    $totalWarnings Total number of warnings found during the run.
+     * @param int    $totalFixable  Total number of problems that can be fixed.
+     * @param bool   $showSources   Show sources?
+     * @param int    $width         Maximum allowed line width.
+     * @param bool   $interactive   Are we running in interactive mode?
+     * @param bool   $toScreen      Is the report being printed to screen?
+     *
+     * @return void
+     */
+    public function generate(
+        $cachedData,
+        $totalFiles,
+        $totalErrors,
+        $totalWarnings,
+        $totalFixable,
+        $showSources=false,
+        $width=80,
+        $interactive=false,
+        $toScreen=true
+    ) {
+        $lines = explode(PHP_EOL, $cachedData);
+        array_pop($lines);
+
+        if (empty($lines) === true) {
+            return;
+        }
+
+        // First collect the accumulated timings.
+        $timings        = [];
+        $totalSniffTime = 0;
+        foreach ($lines as $line) {
+            $parts      = explode('>>', $line);
+            $sniffClass = $parts[0];
+            $time       = $parts[1];
+
+            if (isset($timings[$sniffClass]) === false) {
+                $timings[$sniffClass] = 0;
+            }
+
+            $timings[$sniffClass] += $time;
+            $totalSniffTime       += $time;
+        }
+
+        // Next, tidy up the sniff names and determine max needed column width.
+        $totalTimes   = [];
+        $maxNameWidth = 0;
+        foreach ($timings as $sniffClass => $secs) {
+            $sniffCode    = Common::getSniffCode($sniffClass);
+            $maxNameWidth = max($maxNameWidth, strlen($sniffCode));
+            $totalTimes[$sniffCode] = $secs;
+        }
+
+        // Leading space + up to 12 chars for the number.
+        $maxTimeWidth = 13;
+        // Leading space, open parenthesis, up to 5 chars for the number, space + % and close parenthesis.
+        $maxPercWidth = 10;
+        // Calculate the maximum width available for the sniff name.
+        $maxNameWidth = min(($width - $maxTimeWidth - $maxPercWidth), max(($width - $maxTimeWidth - $maxPercWidth), $maxNameWidth));
+
+        arsort($totalTimes);
+
+        echo PHP_EOL."\033[1m".'PHP CODE SNIFFER SNIFF PERFORMANCE REPORT'."\033[0m".PHP_EOL;
+        echo str_repeat('-', $width).PHP_EOL;
+        echo "\033[1m".'SNIFF'.str_repeat(' ', ($width - 31)).'TIME TAKEN (SECS)     (%)'."\033[0m".PHP_EOL;
+        echo str_repeat('-', $width).PHP_EOL;
+
+        // Mark sniffs which take more than twice as long as the average processing time per sniff
+        // in orange and when they take more than three times as long as the average,
+        // mark them in red.
+        $avgSniffTime       = ($totalSniffTime / count($totalTimes));
+        $doubleAvgSniffTime = (2 * $avgSniffTime);
+        $tripleAvgSniffTime = (3 * $avgSniffTime);
+
+        $format        = "%- {$maxNameWidth}.{$maxNameWidth}s % 12.6f (% 5.1f %%)".PHP_EOL;
+        $formatBold    = "\033[1m%- {$maxNameWidth}.{$maxNameWidth}s % 12.6f (% 5.1f %%)\033[0m".PHP_EOL;
+        $formatWarning = "%- {$maxNameWidth}.{$maxNameWidth}s \033[33m% 12.6f (% 5.1f %%)\033[0m".PHP_EOL;
+        $formatError   = "%- {$maxNameWidth}.{$maxNameWidth}s \033[31m% 12.6f (% 5.1f %%)\033[0m".PHP_EOL;
+
+        foreach ($totalTimes as $sniff => $time) {
+            $percent = round((($time / $totalSniffTime) * 100), 1);
+
+            if ($time > $tripleAvgSniffTime) {
+                printf($formatError, $sniff, $time, $percent);
+            } else if ($time > $doubleAvgSniffTime) {
+                printf($formatWarning, $sniff, $time, $percent);
+            } else {
+                printf($format, $sniff, $time, $percent);
+            }
+        }
+
+        echo str_repeat('-', $width).PHP_EOL;
+        printf($formatBold, 'TOTAL SNIFF PROCESSING TIME', $totalSniffTime, 100);
+
+        $runTime   = (Timing::getDuration() / 1000);
+        $phpcsTime = ($runTime - $totalSniffTime);
+
+        echo PHP_EOL.str_repeat('-', $width).PHP_EOL;
+        printf($format, 'Time taken by sniffs', $totalSniffTime, round((($totalSniffTime / $runTime) * 100), 1));
+        printf($format, 'Time taken by PHPCS runner', $phpcsTime, round((($phpcsTime / $runTime) * 100), 1));
+
+        echo str_repeat('-', $width).PHP_EOL;
+        printf($formatBold, 'TOTAL RUN TIME', $runTime, 100);
+        echo str_repeat('-', $width).PHP_EOL;
+
+    }//end generate()
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Reports/Report.php

@@ -0,0 +1,87 @@
+<?php
+/**
+ * An interface that PHP_CodeSniffer reports must implement.
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Reports;
+
+use PHP_CodeSniffer\Files\File;
+
+interface Report
+{
+
+
+    /**
+     * Generate a partial report for a single processed file.
+     *
+     * Function should return TRUE if it printed or stored data about the file
+     * and FALSE if it ignored the file. Returning TRUE indicates that the file and
+     * its data should be counted in the grand totals.
+     *
+     * The format of the `$report` parameter the function receives is as follows:
+     * ```
+     * array(
+     *   'filename' => string The name of the current file.
+     *   'errors'   => int    The number of errors seen in the current file.
+     *   'warnings' => int    The number of warnings seen in the current file.
+     *   'fixable'  => int    The number of fixable issues seen in the current file.
+     *   'messages' => array(
+     *     int <Line number> => array(
+     *       int <Column number> => array(
+     *         int <Message index> => array(
+     *           'message'  => string The error/warning message.
+     *           'source'   => string The full error code for the message.
+     *           'severity' => int    The severity of the message.
+     *           'fixable'  => bool   Whether this error/warning is auto-fixable.
+     *           'type'     => string The type of message. Either 'ERROR' or 'WARNING'.
+     *         )
+     *       )
+     *     )
+     *   )
+     * )
+     * ```
+     *
+     * @param array<string, string|int|array> $report      Prepared report data.
+     * @param \PHP_CodeSniffer\Files\File     $phpcsFile   The file being reported on.
+     * @param bool                            $showSources Show sources?
+     * @param int                             $width       Maximum allowed line width.
+     *
+     * @return bool
+     */
+    public function generateFileReport($report, File $phpcsFile, $showSources=false, $width=80);
+
+
+    /**
+     * Generate the actual report.
+     *
+     * @param string $cachedData    Any partial report data that was returned from
+     *                              generateFileReport during the run.
+     * @param int    $totalFiles    Total number of files processed during the run.
+     * @param int    $totalErrors   Total number of errors found during the run.
+     * @param int    $totalWarnings Total number of warnings found during the run.
+     * @param int    $totalFixable  Total number of problems that can be fixed.
+     * @param bool   $showSources   Show sources?
+     * @param int    $width         Maximum allowed line width.
+     * @param bool   $interactive   Are we running in interactive mode?
+     * @param bool   $toScreen      Is the report being printed to screen?
+     *
+     * @return void
+     */
+    public function generate(
+        $cachedData,
+        $totalFiles,
+        $totalErrors,
+        $totalWarnings,
+        $totalFixable,
+        $showSources=false,
+        $width=80,
+        $interactive=false,
+        $toScreen=true
+    );
+
+
+}//end interface

vendor/squizlabs/php_codesniffer/src/Reports/Source.php

@@ -0,0 +1,337 @@
+<?php
+/**
+ * Source report for PHP_CodeSniffer.
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Reports;
+
+use PHP_CodeSniffer\Files\File;
+use PHP_CodeSniffer\Util\Timing;
+
+class Source implements Report
+{
+
+
+    /**
+     * Generate a partial report for a single processed file.
+     *
+     * Function should return TRUE if it printed or stored data about the file
+     * and FALSE if it ignored the file. Returning TRUE indicates that the file and
+     * its data should be counted in the grand totals.
+     *
+     * @param array<string, string|int|array> $report      Prepared report data.
+     *                                                     See the {@see Report} interface for a detailed specification.
+     * @param \PHP_CodeSniffer\Files\File     $phpcsFile   The file being reported on.
+     * @param bool                            $showSources Show sources?
+     * @param int                             $width       Maximum allowed line width.
+     *
+     * @return bool
+     */
+    public function generateFileReport($report, File $phpcsFile, $showSources=false, $width=80)
+    {
+        if ($report['errors'] === 0 && $report['warnings'] === 0) {
+            // Nothing to print.
+            return false;
+        }
+
+        $sources = [];
+
+        foreach ($report['messages'] as $lineErrors) {
+            foreach ($lineErrors as $colErrors) {
+                foreach ($colErrors as $error) {
+                    $src = $error['source'];
+                    if (isset($sources[$src]) === false) {
+                        $sources[$src] = [
+                            'fixable' => (int) $error['fixable'],
+                            'count'   => 1,
+                        ];
+                    } else {
+                        $sources[$src]['count']++;
+                    }
+                }
+            }
+        }
+
+        foreach ($sources as $source => $data) {
+            echo $source.'>>'.$data['fixable'].'>>'.$data['count'].PHP_EOL;
+        }
+
+        return true;
+
+    }//end generateFileReport()
+
+
+    /**
+     * Prints the source of all errors and warnings.
+     *
+     * @param string $cachedData    Any partial report data that was returned from
+     *                              generateFileReport during the run.
+     * @param int    $totalFiles    Total number of files processed during the run.
+     * @param int    $totalErrors   Total number of errors found during the run.
+     * @param int    $totalWarnings Total number of warnings found during the run.
+     * @param int    $totalFixable  Total number of problems that can be fixed.
+     * @param bool   $showSources   Show sources?
+     * @param int    $width         Maximum allowed line width.
+     * @param bool   $interactive   Are we running in interactive mode?
+     * @param bool   $toScreen      Is the report being printed to screen?
+     *
+     * @return void
+     */
+    public function generate(
+        $cachedData,
+        $totalFiles,
+        $totalErrors,
+        $totalWarnings,
+        $totalFixable,
+        $showSources=false,
+        $width=80,
+        $interactive=false,
+        $toScreen=true
+    ) {
+        $lines = explode(PHP_EOL, $cachedData);
+        array_pop($lines);
+
+        if (empty($lines) === true) {
+            return;
+        }
+
+        $sources   = [];
+        $maxLength = 0;
+
+        foreach ($lines as $line) {
+            $parts   = explode('>>', $line);
+            $source  = $parts[0];
+            $fixable = (bool) $parts[1];
+            $count   = $parts[2];
+
+            if (isset($sources[$source]) === false) {
+                if ($showSources === true) {
+                    $parts = null;
+                    $sniff = $source;
+                } else {
+                    $parts = explode('.', $source);
+                    if ($parts[0] === 'Internal') {
+                        $parts[2] = $parts[1];
+                        $parts[1] = '';
+                    }
+
+                    $parts[1] = $this->makeFriendlyName($parts[1]);
+
+                    $sniff = $this->makeFriendlyName($parts[2]);
+                    if (isset($parts[3]) === true) {
+                        $name    = $this->makeFriendlyName($parts[3]);
+                        $name[0] = strtolower($name[0]);
+                        $sniff  .= ' '.$name;
+                        unset($parts[3]);
+                    }
+
+                    $parts[2] = $sniff;
+                }//end if
+
+                $maxLength = max($maxLength, strlen($sniff));
+
+                $sources[$source] = [
+                    'count'   => $count,
+                    'fixable' => $fixable,
+                    'parts'   => $parts,
+                ];
+            } else {
+                $sources[$source]['count'] += $count;
+            }//end if
+        }//end foreach
+
+        if ($showSources === true) {
+            $width = min($width, ($maxLength + 11));
+        } else {
+            $width = min($width, ($maxLength + 41));
+        }
+
+        $width = max($width, 70);
+
+        // Sort the data based on counts and source code.
+        $sourceCodes = array_keys($sources);
+        $counts      = [];
+        foreach ($sources as $source => $data) {
+            $counts[$source] = $data['count'];
+        }
+
+        array_multisort($counts, SORT_DESC, $sourceCodes, SORT_ASC, SORT_NATURAL, $sources);
+
+        echo PHP_EOL."\033[1mPHP CODE SNIFFER VIOLATION SOURCE SUMMARY\033[0m".PHP_EOL;
+        echo str_repeat('-', $width).PHP_EOL."\033[1m";
+        if ($showSources === true) {
+            if ($totalFixable > 0) {
+                echo '    SOURCE'.str_repeat(' ', ($width - 15)).'COUNT'.PHP_EOL;
+            } else {
+                echo 'SOURCE'.str_repeat(' ', ($width - 11)).'COUNT'.PHP_EOL;
+            }
+        } else {
+            if ($totalFixable > 0) {
+                echo '    STANDARD  CATEGORY            SNIFF'.str_repeat(' ', ($width - 44)).'COUNT'.PHP_EOL;
+            } else {
+                echo 'STANDARD  CATEGORY            SNIFF'.str_repeat(' ', ($width - 40)).'COUNT'.PHP_EOL;
+            }
+        }
+
+        echo "\033[0m".str_repeat('-', $width).PHP_EOL;
+
+        $fixableSources = 0;
+
+        if ($showSources === true) {
+            $maxSniffWidth = ($width - 7);
+        } else {
+            $maxSniffWidth = ($width - 37);
+        }
+
+        if ($totalFixable > 0) {
+            $maxSniffWidth -= 4;
+        }
+
+        foreach ($sources as $source => $sourceData) {
+            if ($totalFixable > 0) {
+                echo '[';
+                if ($sourceData['fixable'] === true) {
+                    echo 'x';
+                    $fixableSources++;
+                } else {
+                    echo ' ';
+                }
+
+                echo '] ';
+            }
+
+            if ($showSources === true) {
+                if (strlen($source) > $maxSniffWidth) {
+                    $source = substr($source, 0, $maxSniffWidth);
+                }
+
+                echo $source;
+                if ($totalFixable > 0) {
+                    echo str_repeat(' ', ($width - 9 - strlen($source)));
+                } else {
+                    echo str_repeat(' ', ($width - 5 - strlen($source)));
+                }
+            } else {
+                $parts = $sourceData['parts'];
+
+                if (strlen($parts[0]) > 8) {
+                    $parts[0] = substr($parts[0], 0, ((strlen($parts[0]) - 8) * -1));
+                }
+
+                echo $parts[0].str_repeat(' ', (10 - strlen($parts[0])));
+
+                $category = $parts[1];
+                if (strlen($category) > 18) {
+                    $category = substr($category, 0, ((strlen($category) - 18) * -1));
+                }
+
+                echo $category.str_repeat(' ', (20 - strlen($category)));
+
+                $sniff = $parts[2];
+                if (strlen($sniff) > $maxSniffWidth) {
+                    $sniff = substr($sniff, 0, $maxSniffWidth);
+                }
+
+                if ($totalFixable > 0) {
+                    echo $sniff.str_repeat(' ', ($width - 39 - strlen($sniff)));
+                } else {
+                    echo $sniff.str_repeat(' ', ($width - 35 - strlen($sniff)));
+                }
+            }//end if
+
+            echo $sourceData['count'].PHP_EOL;
+        }//end foreach
+
+        echo str_repeat('-', $width).PHP_EOL;
+        echo "\033[1m".'A TOTAL OF '.($totalErrors + $totalWarnings).' SNIFF VIOLATION';
+        if (($totalErrors + $totalWarnings) > 1) {
+            echo 'S';
+        }
+
+        echo ' WERE FOUND IN '.count($sources).' SOURCE';
+        if (count($sources) !== 1) {
+            echo 'S';
+        }
+
+        echo "\033[0m";
+
+        if ($totalFixable > 0) {
+            echo PHP_EOL.str_repeat('-', $width).PHP_EOL;
+            echo "\033[1mPHPCBF CAN FIX THE $fixableSources MARKED SOURCES AUTOMATICALLY ($totalFixable VIOLATIONS IN TOTAL)\033[0m";
+        }
+
+        echo PHP_EOL.str_repeat('-', $width).PHP_EOL.PHP_EOL;
+
+        if ($toScreen === true && $interactive === false) {
+            Timing::printRunTime();
+        }
+
+    }//end generate()
+
+
+    /**
+     * Converts a camel caps name into a readable string.
+     *
+     * @param string $name The camel caps name to convert.
+     *
+     * @return string
+     */
+    public function makeFriendlyName($name)
+    {
+        if (trim($name) === '') {
+            return '';
+        }
+
+        $friendlyName = '';
+        $length       = strlen($name);
+
+        $lastWasUpper   = false;
+        $lastWasNumeric = false;
+        for ($i = 0; $i < $length; $i++) {
+            if (is_numeric($name[$i]) === true) {
+                if ($lastWasNumeric === false) {
+                    $friendlyName .= ' ';
+                }
+
+                $lastWasUpper   = false;
+                $lastWasNumeric = true;
+            } else {
+                $lastWasNumeric = false;
+
+                $char = strtolower($name[$i]);
+                if ($char === $name[$i]) {
+                    // Lowercase.
+                    $lastWasUpper = false;
+                } else {
+                    // Uppercase.
+                    if ($lastWasUpper === false) {
+                        $friendlyName .= ' ';
+                        if ($i < ($length - 1)) {
+                            $next = $name[($i + 1)];
+                            if (strtolower($next) === $next) {
+                                // Next char is lowercase so it is a word boundary.
+                                $name[$i] = strtolower($name[$i]);
+                            }
+                        }
+                    }
+
+                    $lastWasUpper = true;
+                }
+            }//end if
+
+            $friendlyName .= $name[$i];
+        }//end for
+
+        $friendlyName    = trim($friendlyName);
+        $friendlyName[0] = strtoupper($friendlyName[0]);
+
+        return $friendlyName;
+
+    }//end makeFriendlyName()
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Reports/Summary.php

@@ -0,0 +1,184 @@
+<?php
+/**
+ * Summary report for PHP_CodeSniffer.
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Reports;
+
+use PHP_CodeSniffer\Files\File;
+use PHP_CodeSniffer\Util\Timing;
+
+class Summary implements Report
+{
+
+
+    /**
+     * Generate a partial report for a single processed file.
+     *
+     * Function should return TRUE if it printed or stored data about the file
+     * and FALSE if it ignored the file. Returning TRUE indicates that the file and
+     * its data should be counted in the grand totals.
+     *
+     * @param array<string, string|int|array> $report      Prepared report data.
+     *                                                     See the {@see Report} interface for a detailed specification.
+     * @param \PHP_CodeSniffer\Files\File     $phpcsFile   The file being reported on.
+     * @param bool                            $showSources Show sources?
+     * @param int                             $width       Maximum allowed line width.
+     *
+     * @return bool
+     */
+    public function generateFileReport($report, File $phpcsFile, $showSources=false, $width=80)
+    {
+        if (PHP_CODESNIFFER_VERBOSITY === 0
+            && $report['errors'] === 0
+            && $report['warnings'] === 0
+        ) {
+            // Nothing to print.
+            return false;
+        }
+
+        echo $report['filename'].'>>'.$report['errors'].'>>'.$report['warnings'].PHP_EOL;
+        return true;
+
+    }//end generateFileReport()
+
+
+    /**
+     * Generates a summary of errors and warnings for each file processed.
+     *
+     * @param string $cachedData    Any partial report data that was returned from
+     *                              generateFileReport during the run.
+     * @param int    $totalFiles    Total number of files processed during the run.
+     * @param int    $totalErrors   Total number of errors found during the run.
+     * @param int    $totalWarnings Total number of warnings found during the run.
+     * @param int    $totalFixable  Total number of problems that can be fixed.
+     * @param bool   $showSources   Show sources?
+     * @param int    $width         Maximum allowed line width.
+     * @param bool   $interactive   Are we running in interactive mode?
+     * @param bool   $toScreen      Is the report being printed to screen?
+     *
+     * @return void
+     */
+    public function generate(
+        $cachedData,
+        $totalFiles,
+        $totalErrors,
+        $totalWarnings,
+        $totalFixable,
+        $showSources=false,
+        $width=80,
+        $interactive=false,
+        $toScreen=true
+    ) {
+        $lines = explode(PHP_EOL, $cachedData);
+        array_pop($lines);
+
+        if (empty($lines) === true) {
+            return;
+        }
+
+        $reportFiles = [];
+        $maxLength   = 0;
+
+        foreach ($lines as $line) {
+            $parts   = explode('>>', $line);
+            $fileLen = strlen($parts[0]);
+            $reportFiles[$parts[0]] = [
+                'errors'   => $parts[1],
+                'warnings' => $parts[2],
+                'strlen'   => $fileLen,
+            ];
+
+            $maxLength = max($maxLength, $fileLen);
+        }
+
+        uksort(
+            $reportFiles,
+            function ($keyA, $keyB) {
+                $pathPartsA = explode(DIRECTORY_SEPARATOR, $keyA);
+                $pathPartsB = explode(DIRECTORY_SEPARATOR, $keyB);
+
+                do {
+                    $partA = array_shift($pathPartsA);
+                    $partB = array_shift($pathPartsB);
+                } while ($partA === $partB && empty($pathPartsA) === false && empty($pathPartsB) === false);
+
+                if (empty($pathPartsA) === false && empty($pathPartsB) === true) {
+                    return 1;
+                } else if (empty($pathPartsA) === true && empty($pathPartsB) === false) {
+                    return -1;
+                } else {
+                    return strcasecmp($partA, $partB);
+                }
+            }
+        );
+
+        $width = min($width, ($maxLength + 21));
+        $width = max($width, 70);
+
+        echo PHP_EOL."\033[1m".'PHP CODE SNIFFER REPORT SUMMARY'."\033[0m".PHP_EOL;
+        echo str_repeat('-', $width).PHP_EOL;
+        echo "\033[1m".'FILE'.str_repeat(' ', ($width - 20)).'ERRORS  WARNINGS'."\033[0m".PHP_EOL;
+        echo str_repeat('-', $width).PHP_EOL;
+
+        foreach ($reportFiles as $file => $data) {
+            $padding = ($width - 18 - $data['strlen']);
+            if ($padding < 0) {
+                $file    = '...'.substr($file, (($padding * -1) + 3));
+                $padding = 0;
+            }
+
+            echo $file.str_repeat(' ', $padding).'  ';
+            if ($data['errors'] !== 0) {
+                echo "\033[31m".$data['errors']."\033[0m";
+                echo str_repeat(' ', (8 - strlen((string) $data['errors'])));
+            } else {
+                echo '0       ';
+            }
+
+            if ($data['warnings'] !== 0) {
+                echo "\033[33m".$data['warnings']."\033[0m";
+            } else {
+                echo '0';
+            }
+
+            echo PHP_EOL;
+        }//end foreach
+
+        echo str_repeat('-', $width).PHP_EOL;
+        echo "\033[1mA TOTAL OF $totalErrors ERROR";
+        if ($totalErrors !== 1) {
+            echo 'S';
+        }
+
+        echo ' AND '.$totalWarnings.' WARNING';
+        if ($totalWarnings !== 1) {
+            echo 'S';
+        }
+
+        echo ' WERE FOUND IN '.$totalFiles.' FILE';
+        if ($totalFiles !== 1) {
+            echo 'S';
+        }
+
+        echo "\033[0m";
+
+        if ($totalFixable > 0) {
+            echo PHP_EOL.str_repeat('-', $width).PHP_EOL;
+            echo "\033[1mPHPCBF CAN FIX $totalFixable OF THESE SNIFF VIOLATIONS AUTOMATICALLY\033[0m";
+        }
+
+        echo PHP_EOL.str_repeat('-', $width).PHP_EOL.PHP_EOL;
+
+        if ($toScreen === true && $interactive === false) {
+            Timing::printRunTime();
+        }
+
+    }//end generate()
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Reports/Svnblame.php

@@ -0,0 +1,73 @@
+<?php
+/**
+ * SVN blame report for PHP_CodeSniffer.
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Reports;
+
+use PHP_CodeSniffer\Exceptions\DeepExitException;
+
+class Svnblame extends VersionControl
+{
+
+    /**
+     * The name of the report we want in the output
+     *
+     * @var string
+     */
+    protected $reportName = 'SVN';
+
+
+    /**
+     * Extract the author from a blame line.
+     *
+     * @param string $line Line to parse.
+     *
+     * @return mixed string or false if impossible to recover.
+     */
+    protected function getAuthor($line)
+    {
+        $blameParts = [];
+        preg_match('|\s*([^\s]+)\s+([^\s]+)|', $line, $blameParts);
+
+        if (isset($blameParts[2]) === false) {
+            return false;
+        }
+
+        return $blameParts[2];
+
+    }//end getAuthor()
+
+
+    /**
+     * Gets the blame output.
+     *
+     * @param string $filename File to blame.
+     *
+     * @return array
+     * @throws \PHP_CodeSniffer\Exceptions\DeepExitException
+     */
+    protected function getBlameContent($filename)
+    {
+        $command = 'svn blame "'.$filename.'" 2>&1';
+        $handle  = popen($command, 'r');
+        if ($handle === false) {
+            $error = 'ERROR: Could not execute "'.$command.'"'.PHP_EOL.PHP_EOL;
+            throw new DeepExitException($error, 3);
+        }
+
+        $rawContent = stream_get_contents($handle);
+        pclose($handle);
+
+        $blames = explode("\n", $rawContent);
+
+        return $blames;
+
+    }//end getBlameContent()
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Reports/VersionControl.php

@@ -0,0 +1,377 @@
+<?php
+/**
+ * Version control report base class for PHP_CodeSniffer.
+ *
+ * @author    Ben Selby <benmatselby@gmail.com>
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Reports;
+
+use PHP_CodeSniffer\Files\File;
+use PHP_CodeSniffer\Util\Timing;
+
+abstract class VersionControl implements Report
+{
+
+    /**
+     * The name of the report we want in the output.
+     *
+     * @var string
+     */
+    protected $reportName = 'VERSION CONTROL';
+
+
+    /**
+     * Generate a partial report for a single processed file.
+     *
+     * Function should return TRUE if it printed or stored data about the file
+     * and FALSE if it ignored the file. Returning TRUE indicates that the file and
+     * its data should be counted in the grand totals.
+     *
+     * @param array<string, string|int|array> $report      Prepared report data.
+     *                                                     See the {@see Report} interface for a detailed specification.
+     * @param \PHP_CodeSniffer\Files\File     $phpcsFile   The file being reported on.
+     * @param bool                            $showSources Show sources?
+     * @param int                             $width       Maximum allowed line width.
+     *
+     * @return bool
+     */
+    public function generateFileReport($report, File $phpcsFile, $showSources=false, $width=80)
+    {
+        $blames = $this->getBlameContent($phpcsFile->getFilename());
+
+        $authorCache = [];
+        $praiseCache = [];
+        $sourceCache = [];
+
+        foreach ($report['messages'] as $line => $lineErrors) {
+            $author = 'Unknown';
+            if (isset($blames[($line - 1)]) === true) {
+                $blameAuthor = $this->getAuthor($blames[($line - 1)]);
+                if ($blameAuthor !== false) {
+                    $author = $blameAuthor;
+                }
+            }
+
+            if (isset($authorCache[$author]) === false) {
+                $authorCache[$author] = 0;
+                $praiseCache[$author] = [
+                    'good' => 0,
+                    'bad'  => 0,
+                ];
+            }
+
+            $praiseCache[$author]['bad']++;
+
+            foreach ($lineErrors as $colErrors) {
+                foreach ($colErrors as $error) {
+                    $authorCache[$author]++;
+
+                    if ($showSources === true) {
+                        $source = $error['source'];
+                        if (isset($sourceCache[$author][$source]) === false) {
+                            $sourceCache[$author][$source] = [
+                                'count'   => 1,
+                                'fixable' => $error['fixable'],
+                            ];
+                        } else {
+                            $sourceCache[$author][$source]['count']++;
+                        }
+                    }
+                }
+            }
+
+            unset($blames[($line - 1)]);
+        }//end foreach
+
+        // Now go through and give the authors some credit for
+        // all the lines that do not have errors.
+        foreach ($blames as $line) {
+            $author = $this->getAuthor($line);
+            if ($author === false) {
+                $author = 'Unknown';
+            }
+
+            if (isset($authorCache[$author]) === false) {
+                // This author doesn't have any errors.
+                if (PHP_CODESNIFFER_VERBOSITY === 0) {
+                    continue;
+                }
+
+                $authorCache[$author] = 0;
+                $praiseCache[$author] = [
+                    'good' => 0,
+                    'bad'  => 0,
+                ];
+            }
+
+            $praiseCache[$author]['good']++;
+        }//end foreach
+
+        foreach ($authorCache as $author => $errors) {
+            echo "AUTHOR>>$author>>$errors".PHP_EOL;
+        }
+
+        foreach ($praiseCache as $author => $praise) {
+            echo "PRAISE>>$author>>".$praise['good'].'>>'.$praise['bad'].PHP_EOL;
+        }
+
+        foreach ($sourceCache as $author => $sources) {
+            foreach ($sources as $source => $sourceData) {
+                $count   = $sourceData['count'];
+                $fixable = (int) $sourceData['fixable'];
+                echo "SOURCE>>$author>>$source>>$count>>$fixable".PHP_EOL;
+            }
+        }
+
+        return true;
+
+    }//end generateFileReport()
+
+
+    /**
+     * Prints the author of all errors and warnings, as given by "version control blame".
+     *
+     * @param string $cachedData    Any partial report data that was returned from
+     *                              generateFileReport during the run.
+     * @param int    $totalFiles    Total number of files processed during the run.
+     * @param int    $totalErrors   Total number of errors found during the run.
+     * @param int    $totalWarnings Total number of warnings found during the run.
+     * @param int    $totalFixable  Total number of problems that can be fixed.
+     * @param bool   $showSources   Show sources?
+     * @param int    $width         Maximum allowed line width.
+     * @param bool   $interactive   Are we running in interactive mode?
+     * @param bool   $toScreen      Is the report being printed to screen?
+     *
+     * @return void
+     */
+    public function generate(
+        $cachedData,
+        $totalFiles,
+        $totalErrors,
+        $totalWarnings,
+        $totalFixable,
+        $showSources=false,
+        $width=80,
+        $interactive=false,
+        $toScreen=true
+    ) {
+        $errorsShown = ($totalErrors + $totalWarnings);
+        if ($errorsShown === 0) {
+            // Nothing to show.
+            return;
+        }
+
+        $lines = explode(PHP_EOL, $cachedData);
+        array_pop($lines);
+
+        if (empty($lines) === true) {
+            return;
+        }
+
+        $authorCache = [];
+        $praiseCache = [];
+        $sourceCache = [];
+
+        foreach ($lines as $line) {
+            $parts = explode('>>', $line);
+            switch ($parts[0]) {
+            case 'AUTHOR':
+                if (isset($authorCache[$parts[1]]) === false) {
+                    $authorCache[$parts[1]] = $parts[2];
+                } else {
+                    $authorCache[$parts[1]] += $parts[2];
+                }
+                break;
+            case 'PRAISE':
+                if (isset($praiseCache[$parts[1]]) === false) {
+                    $praiseCache[$parts[1]] = [
+                        'good' => $parts[2],
+                        'bad'  => $parts[3],
+                    ];
+                } else {
+                    $praiseCache[$parts[1]]['good'] += $parts[2];
+                    $praiseCache[$parts[1]]['bad']  += $parts[3];
+                }
+                break;
+            case 'SOURCE':
+                if (isset($praiseCache[$parts[1]]) === false) {
+                    $praiseCache[$parts[1]] = [];
+                }
+
+                if (isset($sourceCache[$parts[1]][$parts[2]]) === false) {
+                    $sourceCache[$parts[1]][$parts[2]] = [
+                        'count'   => $parts[3],
+                        'fixable' => (bool) $parts[4],
+                    ];
+                } else {
+                    $sourceCache[$parts[1]][$parts[2]]['count'] += $parts[3];
+                }
+                break;
+            default:
+                break;
+            }//end switch
+        }//end foreach
+
+        // Make sure the report width isn't too big.
+        $maxLength = 0;
+        foreach ($authorCache as $author => $count) {
+            $maxLength = max($maxLength, strlen($author));
+            if ($showSources === true && isset($sourceCache[$author]) === true) {
+                foreach ($sourceCache[$author] as $source => $sourceData) {
+                    if ($source === 'count') {
+                        continue;
+                    }
+
+                    $maxLength = max($maxLength, (strlen($source) + 9));
+                }
+            }
+        }
+
+        $width = min($width, ($maxLength + 30));
+        $width = max($width, 70);
+        arsort($authorCache);
+
+        echo PHP_EOL."\033[1m".'PHP CODE SNIFFER '.$this->reportName.' BLAME SUMMARY'."\033[0m".PHP_EOL;
+        echo str_repeat('-', $width).PHP_EOL."\033[1m";
+        if ($showSources === true) {
+            echo 'AUTHOR   SOURCE'.str_repeat(' ', ($width - 43)).'(Author %) (Overall %) COUNT'.PHP_EOL;
+            echo str_repeat('-', $width).PHP_EOL;
+        } else {
+            echo 'AUTHOR'.str_repeat(' ', ($width - 34)).'(Author %) (Overall %) COUNT'.PHP_EOL;
+            echo str_repeat('-', $width).PHP_EOL;
+        }
+
+        echo "\033[0m";
+
+        if ($showSources === true) {
+            $maxSniffWidth = ($width - 15);
+
+            if ($totalFixable > 0) {
+                $maxSniffWidth -= 4;
+            }
+        }
+
+        $fixableSources = 0;
+
+        foreach ($authorCache as $author => $count) {
+            if ($praiseCache[$author]['good'] === 0) {
+                $percent = 0;
+            } else {
+                $total   = ($praiseCache[$author]['bad'] + $praiseCache[$author]['good']);
+                $percent = round(($praiseCache[$author]['bad'] / $total * 100), 2);
+            }
+
+            $overallPercent = '('.round((($count / $errorsShown) * 100), 2).')';
+            $authorPercent  = '('.$percent.')';
+            $line           = str_repeat(' ', (6 - strlen($count))).$count;
+            $line           = str_repeat(' ', (12 - strlen($overallPercent))).$overallPercent.$line;
+            $line           = str_repeat(' ', (11 - strlen($authorPercent))).$authorPercent.$line;
+            $line           = $author.str_repeat(' ', ($width - strlen($author) - strlen($line))).$line;
+
+            if ($showSources === true) {
+                $line = "\033[1m$line\033[0m";
+            }
+
+            echo $line.PHP_EOL;
+
+            if ($showSources === true && isset($sourceCache[$author]) === true) {
+                $errors = $sourceCache[$author];
+                asort($errors);
+                $errors = array_reverse($errors);
+
+                foreach ($errors as $source => $sourceData) {
+                    if ($source === 'count') {
+                        continue;
+                    }
+
+                    $count = $sourceData['count'];
+
+                    $srcLength = strlen($source);
+                    if ($srcLength > $maxSniffWidth) {
+                        $source = substr($source, 0, $maxSniffWidth);
+                    }
+
+                    $line = str_repeat(' ', (5 - strlen($count))).$count;
+
+                    echo '         ';
+                    if ($totalFixable > 0) {
+                        echo '[';
+                        if ($sourceData['fixable'] === true) {
+                            echo 'x';
+                            $fixableSources++;
+                        } else {
+                            echo ' ';
+                        }
+
+                        echo '] ';
+                    }
+
+                    echo $source;
+                    if ($totalFixable > 0) {
+                        echo str_repeat(' ', ($width - 18 - strlen($source)));
+                    } else {
+                        echo str_repeat(' ', ($width - 14 - strlen($source)));
+                    }
+
+                    echo $line.PHP_EOL;
+                }//end foreach
+            }//end if
+        }//end foreach
+
+        echo str_repeat('-', $width).PHP_EOL;
+        echo "\033[1m".'A TOTAL OF '.$errorsShown.' SNIFF VIOLATION';
+        if ($errorsShown !== 1) {
+            echo 'S';
+        }
+
+        echo ' WERE COMMITTED BY '.count($authorCache).' AUTHOR';
+        if (count($authorCache) !== 1) {
+            echo 'S';
+        }
+
+        echo "\033[0m";
+
+        if ($totalFixable > 0) {
+            if ($showSources === true) {
+                echo PHP_EOL.str_repeat('-', $width).PHP_EOL;
+                echo "\033[1mPHPCBF CAN FIX THE $fixableSources MARKED SOURCES AUTOMATICALLY ($totalFixable VIOLATIONS IN TOTAL)\033[0m";
+            } else {
+                echo PHP_EOL.str_repeat('-', $width).PHP_EOL;
+                echo "\033[1mPHPCBF CAN FIX $totalFixable OF THESE SNIFF VIOLATIONS AUTOMATICALLY\033[0m";
+            }
+        }
+
+        echo PHP_EOL.str_repeat('-', $width).PHP_EOL.PHP_EOL;
+
+        if ($toScreen === true && $interactive === false) {
+            Timing::printRunTime();
+        }
+
+    }//end generate()
+
+
+    /**
+     * Extract the author from a blame line.
+     *
+     * @param string $line Line to parse.
+     *
+     * @return mixed string or false if impossible to recover.
+     */
+    abstract protected function getAuthor($line);
+
+
+    /**
+     * Gets the blame output.
+     *
+     * @param string $filename File to blame.
+     *
+     * @return array
+     */
+    abstract protected function getBlameContent($filename);
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Reports/Xml.php

@@ -0,0 +1,128 @@
+<?php
+/**
+ * XML report for PHP_CodeSniffer.
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Reports;
+
+use PHP_CodeSniffer\Config;
+use PHP_CodeSniffer\Files\File;
+use XMLWriter;
+
+class Xml implements Report
+{
+
+
+    /**
+     * Generate a partial report for a single processed file.
+     *
+     * Function should return TRUE if it printed or stored data about the file
+     * and FALSE if it ignored the file. Returning TRUE indicates that the file and
+     * its data should be counted in the grand totals.
+     *
+     * @param array<string, string|int|array> $report      Prepared report data.
+     *                                                     See the {@see Report} interface for a detailed specification.
+     * @param \PHP_CodeSniffer\Files\File     $phpcsFile   The file being reported on.
+     * @param bool                            $showSources Show sources?
+     * @param int                             $width       Maximum allowed line width.
+     *
+     * @return bool
+     */
+    public function generateFileReport($report, File $phpcsFile, $showSources=false, $width=80)
+    {
+        $out = new XMLWriter;
+        $out->openMemory();
+        $out->setIndent(true);
+        $out->setIndentString('    ');
+        $out->startDocument('1.0', 'UTF-8');
+
+        if ($report['errors'] === 0 && $report['warnings'] === 0) {
+            // Nothing to print.
+            return false;
+        }
+
+        $out->startElement('file');
+        $out->writeAttribute('name', $report['filename']);
+        $out->writeAttribute('errors', $report['errors']);
+        $out->writeAttribute('warnings', $report['warnings']);
+        $out->writeAttribute('fixable', $report['fixable']);
+
+        foreach ($report['messages'] as $line => $lineErrors) {
+            foreach ($lineErrors as $column => $colErrors) {
+                foreach ($colErrors as $error) {
+                    $error['type'] = strtolower($error['type']);
+                    if ($phpcsFile->config->encoding !== 'utf-8') {
+                        $error['message'] = iconv($phpcsFile->config->encoding, 'utf-8', $error['message']);
+                    }
+
+                    $out->startElement($error['type']);
+                    $out->writeAttribute('line', $line);
+                    $out->writeAttribute('column', $column);
+                    $out->writeAttribute('source', $error['source']);
+                    $out->writeAttribute('severity', $error['severity']);
+                    $out->writeAttribute('fixable', (int) $error['fixable']);
+                    $out->text($error['message']);
+                    $out->endElement();
+                }
+            }
+        }//end foreach
+
+        $out->endElement();
+
+        // Remove the start of the document because we will
+        // add that manually later. We only have it in here to
+        // properly set the encoding.
+        $content = $out->flush();
+        if (strpos($content, PHP_EOL) !== false) {
+            $content = substr($content, (strpos($content, PHP_EOL) + strlen(PHP_EOL)));
+        } else if (strpos($content, "\n") !== false) {
+            $content = substr($content, (strpos($content, "\n") + 1));
+        }
+
+        echo $content;
+
+        return true;
+
+    }//end generateFileReport()
+
+
+    /**
+     * Prints all violations for processed files, in a proprietary XML format.
+     *
+     * @param string $cachedData    Any partial report data that was returned from
+     *                              generateFileReport during the run.
+     * @param int    $totalFiles    Total number of files processed during the run.
+     * @param int    $totalErrors   Total number of errors found during the run.
+     * @param int    $totalWarnings Total number of warnings found during the run.
+     * @param int    $totalFixable  Total number of problems that can be fixed.
+     * @param bool   $showSources   Show sources?
+     * @param int    $width         Maximum allowed line width.
+     * @param bool   $interactive   Are we running in interactive mode?
+     * @param bool   $toScreen      Is the report being printed to screen?
+     *
+     * @return void
+     */
+    public function generate(
+        $cachedData,
+        $totalFiles,
+        $totalErrors,
+        $totalWarnings,
+        $totalFixable,
+        $showSources=false,
+        $width=80,
+        $interactive=false,
+        $toScreen=true
+    ) {
+        echo '<?xml version="1.0" encoding="UTF-8"?>'.PHP_EOL;
+        echo '<phpcs version="'.Config::VERSION.'">'.PHP_EOL;
+        echo $cachedData;
+        echo '</phpcs>'.PHP_EOL;
+
+    }//end generate()
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Runner.php

@@ -0,0 +1,986 @@
+<?php
+/**
+ * Responsible for running PHPCS and PHPCBF.
+ *
+ * After creating an object of this class, you probably just want to
+ * call runPHPCS() or runPHPCBF().
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer;
+
+use Exception;
+use InvalidArgumentException;
+use PHP_CodeSniffer\Exceptions\DeepExitException;
+use PHP_CodeSniffer\Exceptions\RuntimeException;
+use PHP_CodeSniffer\Files\DummyFile;
+use PHP_CodeSniffer\Files\File;
+use PHP_CodeSniffer\Files\FileList;
+use PHP_CodeSniffer\Util\Cache;
+use PHP_CodeSniffer\Util\Common;
+use PHP_CodeSniffer\Util\Standards;
+use PHP_CodeSniffer\Util\Timing;
+use PHP_CodeSniffer\Util\Tokens;
+
+class Runner
+{
+
+    /**
+     * The config data for the run.
+     *
+     * @var \PHP_CodeSniffer\Config
+     */
+    public $config = null;
+
+    /**
+     * The ruleset used for the run.
+     *
+     * @var \PHP_CodeSniffer\Ruleset
+     */
+    public $ruleset = null;
+
+    /**
+     * The reporter used for generating reports after the run.
+     *
+     * @var \PHP_CodeSniffer\Reporter
+     */
+    public $reporter = null;
+
+
+    /**
+     * Run the PHPCS script.
+     *
+     * @return int
+     */
+    public function runPHPCS()
+    {
+        $this->registerOutOfMemoryShutdownMessage('phpcs');
+
+        try {
+            Timing::startTiming();
+            Runner::checkRequirements();
+
+            if (defined('PHP_CODESNIFFER_CBF') === false) {
+                define('PHP_CODESNIFFER_CBF', false);
+            }
+
+            // Creating the Config object populates it with all required settings
+            // based on the CLI arguments provided to the script and any config
+            // values the user has set.
+            $this->config = new Config();
+
+            // Init the run and load the rulesets to set additional config vars.
+            $this->init();
+
+            // Print a list of sniffs in each of the supplied standards.
+            // We fudge the config here so that each standard is explained in isolation.
+            if ($this->config->explain === true) {
+                $standards = $this->config->standards;
+                foreach ($standards as $standard) {
+                    $this->config->standards = [$standard];
+                    $ruleset = new Ruleset($this->config);
+                    $ruleset->explain();
+                }
+
+                return 0;
+            }
+
+            // Generate documentation for each of the supplied standards.
+            if ($this->config->generator !== null) {
+                $standards = $this->config->standards;
+                foreach ($standards as $standard) {
+                    $this->config->standards = [$standard];
+                    $ruleset   = new Ruleset($this->config);
+                    $class     = 'PHP_CodeSniffer\Generators\\'.$this->config->generator;
+                    $generator = new $class($ruleset);
+                    $generator->generate();
+                }
+
+                return 0;
+            }
+
+            // Other report formats don't really make sense in interactive mode
+            // so we hard-code the full report here and when outputting.
+            // We also ensure parallel processing is off because we need to do one file at a time.
+            if ($this->config->interactive === true) {
+                $this->config->reports      = ['full' => null];
+                $this->config->parallel     = 1;
+                $this->config->showProgress = false;
+            }
+
+            // Disable caching if we are processing STDIN as we can't be 100%
+            // sure where the file came from or if it will change in the future.
+            if ($this->config->stdin === true) {
+                $this->config->cache = false;
+            }
+
+            $numErrors = $this->run();
+
+            // Print all the reports for this run.
+            $toScreen = $this->reporter->printReports();
+
+            // Only print timer output if no reports were
+            // printed to the screen so we don't put additional output
+            // in something like an XML report. If we are printing to screen,
+            // the report types would have already worked out who should
+            // print the timer info.
+            if ($this->config->interactive === false
+                && ($toScreen === false
+                || (($this->reporter->totalErrors + $this->reporter->totalWarnings) === 0 && $this->config->showProgress === true))
+            ) {
+                Timing::printRunTime();
+            }
+        } catch (DeepExitException $e) {
+            echo $e->getMessage();
+            return $e->getCode();
+        }//end try
+
+        if ($numErrors === 0) {
+            // No errors found.
+            return 0;
+        } else if ($this->reporter->totalFixable === 0) {
+            // Errors found, but none of them can be fixed by PHPCBF.
+            return 1;
+        } else {
+            // Errors found, and some can be fixed by PHPCBF.
+            return 2;
+        }
+
+    }//end runPHPCS()
+
+
+    /**
+     * Run the PHPCBF script.
+     *
+     * @return int
+     */
+    public function runPHPCBF()
+    {
+        $this->registerOutOfMemoryShutdownMessage('phpcbf');
+
+        if (defined('PHP_CODESNIFFER_CBF') === false) {
+            define('PHP_CODESNIFFER_CBF', true);
+        }
+
+        try {
+            Timing::startTiming();
+            Runner::checkRequirements();
+
+            // Creating the Config object populates it with all required settings
+            // based on the CLI arguments provided to the script and any config
+            // values the user has set.
+            $this->config = new Config();
+
+            // When processing STDIN, we can't output anything to the screen
+            // or it will end up mixed in with the file output.
+            if ($this->config->stdin === true) {
+                $this->config->verbosity = 0;
+            }
+
+            // Init the run and load the rulesets to set additional config vars.
+            $this->init();
+
+            // When processing STDIN, we only process one file at a time and
+            // we don't process all the way through, so we can't use the parallel
+            // running system.
+            if ($this->config->stdin === true) {
+                $this->config->parallel = 1;
+            }
+
+            // Override some of the command line settings that might break the fixes.
+            $this->config->generator    = null;
+            $this->config->explain      = false;
+            $this->config->interactive  = false;
+            $this->config->cache        = false;
+            $this->config->showSources  = false;
+            $this->config->recordErrors = false;
+            $this->config->reportFile   = null;
+
+            // Only use the "Cbf" report, but allow for the Performance report as well.
+            $originalReports = array_change_key_case($this->config->reports, CASE_LOWER);
+            $newReports      = ['cbf' => null];
+            if (array_key_exists('performance', $originalReports) === true) {
+                $newReports['performance'] = $originalReports['performance'];
+            }
+
+            $this->config->reports = $newReports;
+
+            // If a standard tries to set command line arguments itself, some
+            // may be blocked because PHPCBF is running, so stop the script
+            // dying if any are found.
+            $this->config->dieOnUnknownArg = false;
+
+            $this->run();
+            $this->reporter->printReports();
+
+            echo PHP_EOL;
+            Timing::printRunTime();
+        } catch (DeepExitException $e) {
+            echo $e->getMessage();
+            return $e->getCode();
+        }//end try
+
+        if ($this->reporter->totalFixed === 0) {
+            // Nothing was fixed by PHPCBF.
+            if ($this->reporter->totalFixable === 0) {
+                // Nothing found that could be fixed.
+                return 0;
+            } else {
+                // Something failed to fix.
+                return 2;
+            }
+        }
+
+        if ($this->reporter->totalFixable === 0) {
+            // PHPCBF fixed all fixable errors.
+            return 1;
+        }
+
+        // PHPCBF fixed some fixable errors, but others failed to fix.
+        return 2;
+
+    }//end runPHPCBF()
+
+
+    /**
+     * Exits if the minimum requirements of PHP_CodeSniffer are not met.
+     *
+     * @return void
+     * @throws \PHP_CodeSniffer\Exceptions\DeepExitException If the requirements are not met.
+     */
+    public function checkRequirements()
+    {
+        // Check the PHP version.
+        if (PHP_VERSION_ID < 50400) {
+            $error = 'ERROR: PHP_CodeSniffer requires PHP version 5.4.0 or greater.'.PHP_EOL;
+            throw new DeepExitException($error, 3);
+        }
+
+        $requiredExtensions = [
+            'tokenizer',
+            'xmlwriter',
+            'SimpleXML',
+        ];
+        $missingExtensions  = [];
+
+        foreach ($requiredExtensions as $extension) {
+            if (extension_loaded($extension) === false) {
+                $missingExtensions[] = $extension;
+            }
+        }
+
+        if (empty($missingExtensions) === false) {
+            $last      = array_pop($requiredExtensions);
+            $required  = implode(', ', $requiredExtensions);
+            $required .= ' and '.$last;
+
+            if (count($missingExtensions) === 1) {
+                $missing = $missingExtensions[0];
+            } else {
+                $last     = array_pop($missingExtensions);
+                $missing  = implode(', ', $missingExtensions);
+                $missing .= ' and '.$last;
+            }
+
+            $error = 'ERROR: PHP_CodeSniffer requires the %s extensions to be enabled. Please enable %s.'.PHP_EOL;
+            $error = sprintf($error, $required, $missing);
+            throw new DeepExitException($error, 3);
+        }
+
+    }//end checkRequirements()
+
+
+    /**
+     * Init the rulesets and other high-level settings.
+     *
+     * @return void
+     * @throws \PHP_CodeSniffer\Exceptions\DeepExitException If a referenced standard is not installed.
+     */
+    public function init()
+    {
+        if (defined('PHP_CODESNIFFER_CBF') === false) {
+            define('PHP_CODESNIFFER_CBF', false);
+        }
+
+        // Ensure this option is enabled or else line endings will not always
+        // be detected properly for files created on a Mac with the /r line ending.
+        @ini_set('auto_detect_line_endings', true);
+
+        // Disable the PCRE JIT as this caused issues with parallel running.
+        ini_set('pcre.jit', false);
+
+        // Check that the standards are valid.
+        foreach ($this->config->standards as $standard) {
+            if (Standards::isInstalledStandard($standard) === false) {
+                // They didn't select a valid coding standard, so help them
+                // out by letting them know which standards are installed.
+                $error = 'ERROR: the "'.$standard.'" coding standard is not installed. ';
+                ob_start();
+                Standards::printInstalledStandards();
+                $error .= ob_get_contents();
+                ob_end_clean();
+                throw new DeepExitException($error, 3);
+            }
+        }
+
+        // Saves passing the Config object into other objects that only need
+        // the verbosity flag for debug output.
+        if (defined('PHP_CODESNIFFER_VERBOSITY') === false) {
+            define('PHP_CODESNIFFER_VERBOSITY', $this->config->verbosity);
+        }
+
+        // Create this class so it is autoloaded and sets up a bunch
+        // of PHP_CodeSniffer-specific token type constants.
+        new Tokens();
+
+        // Allow autoloading of custom files inside installed standards.
+        $installedStandards = Standards::getInstalledStandardDetails();
+        foreach ($installedStandards as $details) {
+            Autoload::addSearchPath($details['path'], $details['namespace']);
+        }
+
+        // The ruleset contains all the information about how the files
+        // should be checked and/or fixed.
+        try {
+            $this->ruleset = new Ruleset($this->config);
+
+            if ($this->ruleset->hasSniffDeprecations() === true) {
+                $this->ruleset->showSniffDeprecations();
+            }
+        } catch (RuntimeException $e) {
+            $error  = rtrim($e->getMessage(), "\r\n").PHP_EOL.PHP_EOL;
+            $error .= $this->config->printShortUsage(true);
+            throw new DeepExitException($error, 3);
+        }
+
+    }//end init()
+
+
+    /**
+     * Performs the run.
+     *
+     * @return int The number of errors and warnings found.
+     * @throws \PHP_CodeSniffer\Exceptions\DeepExitException
+     * @throws \PHP_CodeSniffer\Exceptions\RuntimeException
+     */
+    private function run()
+    {
+        // The class that manages all reporters for the run.
+        $this->reporter = new Reporter($this->config);
+
+        // Include bootstrap files.
+        foreach ($this->config->bootstrap as $bootstrap) {
+            include $bootstrap;
+        }
+
+        if ($this->config->stdin === true) {
+            $fileContents = $this->config->stdinContent;
+            if ($fileContents === null) {
+                $handle = fopen('php://stdin', 'r');
+                stream_set_blocking($handle, true);
+                $fileContents = stream_get_contents($handle);
+                fclose($handle);
+            }
+
+            $todo  = new FileList($this->config, $this->ruleset);
+            $dummy = new DummyFile($fileContents, $this->ruleset, $this->config);
+            $todo->addFile($dummy->path, $dummy);
+        } else {
+            if (empty($this->config->files) === true) {
+                $error  = 'ERROR: You must supply at least one file or directory to process.'.PHP_EOL.PHP_EOL;
+                $error .= $this->config->printShortUsage(true);
+                throw new DeepExitException($error, 3);
+            }
+
+            if (PHP_CODESNIFFER_VERBOSITY > 0) {
+                echo 'Creating file list... ';
+            }
+
+            $todo = new FileList($this->config, $this->ruleset);
+
+            if (PHP_CODESNIFFER_VERBOSITY > 0) {
+                $numFiles = count($todo);
+                echo "DONE ($numFiles files in queue)".PHP_EOL;
+            }
+
+            if ($this->config->cache === true) {
+                if (PHP_CODESNIFFER_VERBOSITY > 0) {
+                    echo 'Loading cache... ';
+                }
+
+                Cache::load($this->ruleset, $this->config);
+
+                if (PHP_CODESNIFFER_VERBOSITY > 0) {
+                    $size = Cache::getSize();
+                    echo "DONE ($size files in cache)".PHP_EOL;
+                }
+            }
+        }//end if
+
+        // Turn all sniff errors into exceptions.
+        set_error_handler([$this, 'handleErrors']);
+
+        // If verbosity is too high, turn off parallelism so the
+        // debug output is clean.
+        if (PHP_CODESNIFFER_VERBOSITY > 1) {
+            $this->config->parallel = 1;
+        }
+
+        // If the PCNTL extension isn't installed, we can't fork.
+        if (function_exists('pcntl_fork') === false) {
+            $this->config->parallel = 1;
+        }
+
+        $lastDir  = '';
+        $numFiles = count($todo);
+
+        if ($this->config->parallel === 1) {
+            // Running normally.
+            $numProcessed = 0;
+            foreach ($todo as $path => $file) {
+                if ($file->ignored === false) {
+                    $currDir = dirname($path);
+                    if ($lastDir !== $currDir) {
+                        if (PHP_CODESNIFFER_VERBOSITY > 0) {
+                            echo 'Changing into directory '.Common::stripBasepath($currDir, $this->config->basepath).PHP_EOL;
+                        }
+
+                        $lastDir = $currDir;
+                    }
+
+                    $this->processFile($file);
+                } else if (PHP_CODESNIFFER_VERBOSITY > 0) {
+                    echo 'Skipping '.basename($file->path).PHP_EOL;
+                }
+
+                $numProcessed++;
+                $this->printProgress($file, $numFiles, $numProcessed);
+            }
+        } else {
+            // Batching and forking.
+            $childProcs  = [];
+            $numPerBatch = ceil($numFiles / $this->config->parallel);
+
+            for ($batch = 0; $batch < $this->config->parallel; $batch++) {
+                $startAt = ($batch * $numPerBatch);
+                if ($startAt >= $numFiles) {
+                    break;
+                }
+
+                $endAt = ($startAt + $numPerBatch);
+                if ($endAt > $numFiles) {
+                    $endAt = $numFiles;
+                }
+
+                $childOutFilename = tempnam(sys_get_temp_dir(), 'phpcs-child');
+                $pid = pcntl_fork();
+                if ($pid === -1) {
+                    throw new RuntimeException('Failed to create child process');
+                } else if ($pid !== 0) {
+                    $childProcs[$pid] = $childOutFilename;
+                } else {
+                    // Move forward to the start of the batch.
+                    $todo->rewind();
+                    for ($i = 0; $i < $startAt; $i++) {
+                        $todo->next();
+                    }
+
+                    // Reset the reporter to make sure only figures from this
+                    // file batch are recorded.
+                    $this->reporter->totalFiles    = 0;
+                    $this->reporter->totalErrors   = 0;
+                    $this->reporter->totalWarnings = 0;
+                    $this->reporter->totalFixable  = 0;
+                    $this->reporter->totalFixed    = 0;
+
+                    // Process the files.
+                    $pathsProcessed = [];
+                    ob_start();
+                    for ($i = $startAt; $i < $endAt; $i++) {
+                        $path = $todo->key();
+                        $file = $todo->current();
+
+                        if ($file->ignored === true) {
+                            $todo->next();
+                            continue;
+                        }
+
+                        $currDir = dirname($path);
+                        if ($lastDir !== $currDir) {
+                            if (PHP_CODESNIFFER_VERBOSITY > 0) {
+                                echo 'Changing into directory '.Common::stripBasepath($currDir, $this->config->basepath).PHP_EOL;
+                            }
+
+                            $lastDir = $currDir;
+                        }
+
+                        $this->processFile($file);
+
+                        $pathsProcessed[] = $path;
+                        $todo->next();
+                    }//end for
+
+                    $debugOutput = ob_get_contents();
+                    ob_end_clean();
+
+                    // Write information about the run to the filesystem
+                    // so it can be picked up by the main process.
+                    $childOutput = [
+                        'totalFiles'    => $this->reporter->totalFiles,
+                        'totalErrors'   => $this->reporter->totalErrors,
+                        'totalWarnings' => $this->reporter->totalWarnings,
+                        'totalFixable'  => $this->reporter->totalFixable,
+                        'totalFixed'    => $this->reporter->totalFixed,
+                    ];
+
+                    $output  = '<'.'?php'."\n".' $childOutput = ';
+                    $output .= var_export($childOutput, true);
+                    $output .= ";\n\$debugOutput = ";
+                    $output .= var_export($debugOutput, true);
+
+                    if ($this->config->cache === true) {
+                        $childCache = [];
+                        foreach ($pathsProcessed as $path) {
+                            $childCache[$path] = Cache::get($path);
+                        }
+
+                        $output .= ";\n\$childCache = ";
+                        $output .= var_export($childCache, true);
+                    }
+
+                    $output .= ";\n?".'>';
+                    file_put_contents($childOutFilename, $output);
+                    exit();
+                }//end if
+            }//end for
+
+            $success = $this->processChildProcs($childProcs);
+            if ($success === false) {
+                throw new RuntimeException('One or more child processes failed to run');
+            }
+        }//end if
+
+        restore_error_handler();
+
+        if (PHP_CODESNIFFER_VERBOSITY === 0
+            && $this->config->interactive === false
+            && $this->config->showProgress === true
+        ) {
+            echo PHP_EOL.PHP_EOL;
+        }
+
+        if ($this->config->cache === true) {
+            Cache::save();
+        }
+
+        $ignoreWarnings = Config::getConfigData('ignore_warnings_on_exit');
+        $ignoreErrors   = Config::getConfigData('ignore_errors_on_exit');
+
+        $return = ($this->reporter->totalErrors + $this->reporter->totalWarnings);
+        if ($ignoreErrors !== null) {
+            $ignoreErrors = (bool) $ignoreErrors;
+            if ($ignoreErrors === true) {
+                $return -= $this->reporter->totalErrors;
+            }
+        }
+
+        if ($ignoreWarnings !== null) {
+            $ignoreWarnings = (bool) $ignoreWarnings;
+            if ($ignoreWarnings === true) {
+                $return -= $this->reporter->totalWarnings;
+            }
+        }
+
+        return $return;
+
+    }//end run()
+
+
+    /**
+     * Converts all PHP errors into exceptions.
+     *
+     * This method forces a sniff to stop processing if it is not
+     * able to handle a specific piece of code, instead of continuing
+     * and potentially getting into a loop.
+     *
+     * @param int    $code    The level of error raised.
+     * @param string $message The error message.
+     * @param string $file    The path of the file that raised the error.
+     * @param int    $line    The line number the error was raised at.
+     *
+     * @return bool
+     * @throws \PHP_CodeSniffer\Exceptions\RuntimeException
+     */
+    public function handleErrors($code, $message, $file, $line)
+    {
+        if ((error_reporting() & $code) === 0) {
+            // This type of error is being muted.
+            return true;
+        }
+
+        throw new RuntimeException("$message in $file on line $line");
+
+    }//end handleErrors()
+
+
+    /**
+     * Processes a single file, including checking and fixing.
+     *
+     * @param \PHP_CodeSniffer\Files\File $file The file to be processed.
+     *
+     * @return void
+     * @throws \PHP_CodeSniffer\Exceptions\DeepExitException
+     */
+    public function processFile($file)
+    {
+        if (PHP_CODESNIFFER_VERBOSITY > 0) {
+            $startTime = microtime(true);
+            echo 'Processing '.basename($file->path).' ';
+            if (PHP_CODESNIFFER_VERBOSITY > 1) {
+                echo PHP_EOL;
+            }
+        }
+
+        try {
+            $file->process();
+
+            if (PHP_CODESNIFFER_VERBOSITY > 0) {
+                $timeTaken = ((microtime(true) - $startTime) * 1000);
+                if ($timeTaken < 1000) {
+                    $timeTaken = round($timeTaken);
+                    echo "DONE in {$timeTaken}ms";
+                } else {
+                    $timeTaken = round(($timeTaken / 1000), 2);
+                    echo "DONE in $timeTaken secs";
+                }
+
+                if (PHP_CODESNIFFER_CBF === true) {
+                    $errors = $file->getFixableCount();
+                    echo " ($errors fixable violations)".PHP_EOL;
+                } else {
+                    $errors   = $file->getErrorCount();
+                    $warnings = $file->getWarningCount();
+                    echo " ($errors errors, $warnings warnings)".PHP_EOL;
+                }
+            }
+        } catch (Exception $e) {
+            $error = 'An error occurred during processing; checking has been aborted. The error message was: '.$e->getMessage();
+
+            // Determine which sniff caused the error.
+            $sniffStack = null;
+            $nextStack  = null;
+            foreach ($e->getTrace() as $step) {
+                if (isset($step['file']) === false) {
+                    continue;
+                }
+
+                if (empty($sniffStack) === false) {
+                    $nextStack = $step;
+                    break;
+                }
+
+                if (substr($step['file'], -9) === 'Sniff.php') {
+                    $sniffStack = $step;
+                    continue;
+                }
+            }
+
+            if (empty($sniffStack) === false) {
+                $sniffCode = '';
+                try {
+                    if (empty($nextStack) === false
+                        && isset($nextStack['class']) === true
+                        && substr($nextStack['class'], -5) === 'Sniff'
+                    ) {
+                        $sniffCode = 'the '.Common::getSniffCode($nextStack['class']).' sniff';
+                    }
+                } catch (InvalidArgumentException $e) {
+                    // Sniff code could not be determined. This may be an abstract sniff class.
+                }
+
+                if ($sniffCode === '') {
+                    $sniffCode = substr(strrchr(str_replace('\\', '/', $sniffStack['file']), '/'), 1);
+                }
+
+                $error .= sprintf(PHP_EOL.'The error originated in %s on line %s.', $sniffCode, $sniffStack['line']);
+            }
+
+            $file->addErrorOnLine($error, 1, 'Internal.Exception');
+        }//end try
+
+        $this->reporter->cacheFileReport($file);
+
+        if ($this->config->interactive === true) {
+            /*
+                Running interactively.
+                Print the error report for the current file and then wait for user input.
+            */
+
+            // Get current violations and then clear the list to make sure
+            // we only print violations for a single file each time.
+            $numErrors = null;
+            while ($numErrors !== 0) {
+                $numErrors = ($file->getErrorCount() + $file->getWarningCount());
+                if ($numErrors === 0) {
+                    continue;
+                }
+
+                $this->reporter->printReport('full');
+
+                echo '<ENTER> to recheck, [s] to skip or [q] to quit : ';
+                $input = fgets(STDIN);
+                $input = trim($input);
+
+                switch ($input) {
+                case 's':
+                    break(2);
+                case 'q':
+                    throw new DeepExitException('', 0);
+                default:
+                    // Repopulate the sniffs because some of them save their state
+                    // and only clear it when the file changes, but we are rechecking
+                    // the same file.
+                    $file->ruleset->populateTokenListeners();
+                    $file->reloadContent();
+                    $file->process();
+                    $this->reporter->cacheFileReport($file);
+                    break;
+                }
+            }//end while
+        }//end if
+
+        // Clean up the file to save (a lot of) memory.
+        $file->cleanUp();
+
+    }//end processFile()
+
+
+    /**
+     * Waits for child processes to complete and cleans up after them.
+     *
+     * The reporting information returned by each child process is merged
+     * into the main reporter class.
+     *
+     * @param array<int, string> $childProcs An array of child processes to wait for.
+     *
+     * @return bool
+     */
+    private function processChildProcs($childProcs)
+    {
+        $numProcessed = 0;
+        $totalBatches = count($childProcs);
+
+        $success = true;
+
+        while (count($childProcs) > 0) {
+            $pid = pcntl_waitpid(0, $status);
+            if ($pid <= 0 || isset($childProcs[$pid]) === false) {
+                // No child or a child with an unmanaged PID was returned.
+                continue;
+            }
+
+            $childProcessStatus = pcntl_wexitstatus($status);
+            if ($childProcessStatus !== 0) {
+                $success = false;
+            }
+
+            $out = $childProcs[$pid];
+            unset($childProcs[$pid]);
+            if (file_exists($out) === false) {
+                continue;
+            }
+
+            include $out;
+            unlink($out);
+
+            $numProcessed++;
+
+            if (isset($childOutput) === false) {
+                // The child process died, so the run has failed.
+                $file = new DummyFile('', $this->ruleset, $this->config);
+                $file->setErrorCounts(1, 0, 0, 0);
+                $this->printProgress($file, $totalBatches, $numProcessed);
+                $success = false;
+                continue;
+            }
+
+            $this->reporter->totalFiles    += $childOutput['totalFiles'];
+            $this->reporter->totalErrors   += $childOutput['totalErrors'];
+            $this->reporter->totalWarnings += $childOutput['totalWarnings'];
+            $this->reporter->totalFixable  += $childOutput['totalFixable'];
+            $this->reporter->totalFixed    += $childOutput['totalFixed'];
+
+            if (isset($debugOutput) === true) {
+                echo $debugOutput;
+            }
+
+            if (isset($childCache) === true) {
+                foreach ($childCache as $path => $cache) {
+                    Cache::set($path, $cache);
+                }
+            }
+
+            // Fake a processed file so we can print progress output for the batch.
+            $file = new DummyFile('', $this->ruleset, $this->config);
+            $file->setErrorCounts(
+                $childOutput['totalErrors'],
+                $childOutput['totalWarnings'],
+                $childOutput['totalFixable'],
+                $childOutput['totalFixed']
+            );
+            $this->printProgress($file, $totalBatches, $numProcessed);
+        }//end while
+
+        return $success;
+
+    }//end processChildProcs()
+
+
+    /**
+     * Print progress information for a single processed file.
+     *
+     * @param \PHP_CodeSniffer\Files\File $file         The file that was processed.
+     * @param int                         $numFiles     The total number of files to process.
+     * @param int                         $numProcessed The number of files that have been processed,
+     *                                                  including this one.
+     *
+     * @return void
+     */
+    public function printProgress(File $file, $numFiles, $numProcessed)
+    {
+        if (PHP_CODESNIFFER_VERBOSITY > 0
+            || $this->config->showProgress === false
+        ) {
+            return;
+        }
+
+        $showColors  = $this->config->colors;
+        $colorOpen   = '';
+        $progressDot = '.';
+        $colorClose  = '';
+
+        // Show progress information.
+        if ($file->ignored === true) {
+            $progressDot = 'S';
+        } else {
+            $errors   = $file->getErrorCount();
+            $warnings = $file->getWarningCount();
+            $fixable  = $file->getFixableCount();
+            $fixed    = $file->getFixedCount();
+
+            if (PHP_CODESNIFFER_CBF === true) {
+                // Files with fixed errors or warnings are F (green).
+                // Files with unfixable errors or warnings are E (red).
+                // Files with no errors or warnings are . (black).
+                if ($fixable > 0) {
+                    $progressDot = 'E';
+
+                    if ($showColors === true) {
+                        $colorOpen  = "\033[31m";
+                        $colorClose = "\033[0m";
+                    }
+                } else if ($fixed > 0) {
+                    $progressDot = 'F';
+
+                    if ($showColors === true) {
+                        $colorOpen  = "\033[32m";
+                        $colorClose = "\033[0m";
+                    }
+                }//end if
+            } else {
+                // Files with errors are E (red).
+                // Files with fixable errors are E (green).
+                // Files with warnings are W (yellow).
+                // Files with fixable warnings are W (green).
+                // Files with no errors or warnings are . (black).
+                if ($errors > 0) {
+                    $progressDot = 'E';
+
+                    if ($showColors === true) {
+                        if ($fixable > 0) {
+                            $colorOpen = "\033[32m";
+                        } else {
+                            $colorOpen = "\033[31m";
+                        }
+
+                        $colorClose = "\033[0m";
+                    }
+                } else if ($warnings > 0) {
+                    $progressDot = 'W';
+
+                    if ($showColors === true) {
+                        if ($fixable > 0) {
+                            $colorOpen = "\033[32m";
+                        } else {
+                            $colorOpen = "\033[33m";
+                        }
+
+                        $colorClose = "\033[0m";
+                    }
+                }//end if
+            }//end if
+        }//end if
+
+        echo $colorOpen.$progressDot.$colorClose;
+
+        $numPerLine = 60;
+        if ($numProcessed !== $numFiles && ($numProcessed % $numPerLine) !== 0) {
+            return;
+        }
+
+        $percent = round(($numProcessed / $numFiles) * 100);
+        $padding = (strlen($numFiles) - strlen($numProcessed));
+        if ($numProcessed === $numFiles
+            && $numFiles > $numPerLine
+            && ($numProcessed % $numPerLine) !== 0
+        ) {
+            $padding += ($numPerLine - ($numFiles - (floor($numFiles / $numPerLine) * $numPerLine)));
+        }
+
+        echo str_repeat(' ', $padding)." $numProcessed / $numFiles ($percent%)".PHP_EOL;
+
+    }//end printProgress()
+
+
+    /**
+     * Registers a PHP shutdown function to provide a more informative out of memory error.
+     *
+     * @param string $command The command which was used to initiate the PHPCS run.
+     *
+     * @return void
+     */
+    private function registerOutOfMemoryShutdownMessage($command)
+    {
+        // Allocate all needed memory beforehand as much as possible.
+        $errorMsg    = PHP_EOL.'The PHP_CodeSniffer "%1$s" command ran out of memory.'.PHP_EOL;
+        $errorMsg   .= 'Either raise the "memory_limit" of PHP in the php.ini file or raise the memory limit at runtime'.PHP_EOL;
+        $errorMsg   .= 'using `%1$s -d memory_limit=512M` (replace 512M with the desired memory limit).'.PHP_EOL;
+        $errorMsg    = sprintf($errorMsg, $command);
+        $memoryError = 'Allowed memory size of';
+        $errorArray  = [
+            'type'    => 42,
+            'message' => 'Some random dummy string to take up memory and take up some more memory and some more',
+            'file'    => 'Another random string, which would be a filename this time. Should be relatively long to allow for deeply nested files',
+            'line'    => 31427,
+        ];
+
+        register_shutdown_function(
+            static function () use (
+                $errorMsg,
+                $memoryError,
+                $errorArray
+            ) {
+                $errorArray = error_get_last();
+                if (is_array($errorArray) === true && strpos($errorArray['message'], $memoryError) !== false) {
+                    echo $errorMsg;
+                }
+            }
+        );
+
+    }//end registerOutOfMemoryShutdownMessage()
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Sniffs/AbstractArraySniff.php

@@ -0,0 +1,172 @@
+<?php
+/**
+ * Processes single and multi-line arrays.
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Sniffs;
+
+use PHP_CodeSniffer\Files\File;
+use PHP_CodeSniffer\Util\Tokens;
+
+abstract class AbstractArraySniff implements Sniff
+{
+
+
+    /**
+     * Returns an array of tokens this test wants to listen for.
+     *
+     * @return array<int|string>
+     */
+    final public function register()
+    {
+        return [
+            T_ARRAY,
+            T_OPEN_SHORT_ARRAY,
+        ];
+
+    }//end register()
+
+
+    /**
+     * Processes this sniff, when one of its tokens is encountered.
+     *
+     * @param \PHP_CodeSniffer\Files\File $phpcsFile The current file being checked.
+     * @param int                         $stackPtr  The position of the current token in
+     *                                               the stack passed in $tokens.
+     *
+     * @return void
+     */
+    public function process(File $phpcsFile, $stackPtr)
+    {
+        $tokens = $phpcsFile->getTokens();
+
+        if ($tokens[$stackPtr]['code'] === T_ARRAY) {
+            $phpcsFile->recordMetric($stackPtr, 'Short array syntax used', 'no');
+
+            $arrayStart = $tokens[$stackPtr]['parenthesis_opener'];
+            if (isset($tokens[$arrayStart]['parenthesis_closer']) === false) {
+                // Incomplete array.
+                return;
+            }
+
+            $arrayEnd = $tokens[$arrayStart]['parenthesis_closer'];
+        } else {
+            $phpcsFile->recordMetric($stackPtr, 'Short array syntax used', 'yes');
+            $arrayStart = $stackPtr;
+            $arrayEnd   = $tokens[$stackPtr]['bracket_closer'];
+        }
+
+        $lastContent = $phpcsFile->findPrevious(Tokens::$emptyTokens, ($arrayEnd - 1), null, true);
+        if ($tokens[$lastContent]['code'] === T_COMMA) {
+            // Last array item ends with a comma.
+            $phpcsFile->recordMetric($stackPtr, 'Array end comma', 'yes');
+        } else {
+            $phpcsFile->recordMetric($stackPtr, 'Array end comma', 'no');
+        }
+
+        $indices = [];
+
+        $current = $arrayStart;
+        while (($next = $phpcsFile->findNext(Tokens::$emptyTokens, ($current + 1), $arrayEnd, true)) !== false) {
+            $end = $this->getNext($phpcsFile, $next, $arrayEnd);
+
+            if ($tokens[$end]['code'] === T_DOUBLE_ARROW) {
+                $indexEnd   = $phpcsFile->findPrevious(T_WHITESPACE, ($end - 1), null, true);
+                $valueStart = $phpcsFile->findNext(Tokens::$emptyTokens, ($end + 1), null, true);
+
+                $indices[] = [
+                    'index_start' => $next,
+                    'index_end'   => $indexEnd,
+                    'arrow'       => $end,
+                    'value_start' => $valueStart,
+                ];
+            } else {
+                $valueStart = $next;
+                $indices[]  = ['value_start' => $valueStart];
+            }
+
+            $current = $this->getNext($phpcsFile, $valueStart, $arrayEnd);
+        }
+
+        if ($tokens[$arrayStart]['line'] === $tokens[$arrayEnd]['line']) {
+            $this->processSingleLineArray($phpcsFile, $stackPtr, $arrayStart, $arrayEnd, $indices);
+        } else {
+            $this->processMultiLineArray($phpcsFile, $stackPtr, $arrayStart, $arrayEnd, $indices);
+        }
+
+    }//end process()
+
+
+    /**
+     * Find next separator in array - either: comma or double arrow.
+     *
+     * @param \PHP_CodeSniffer\Files\File $phpcsFile The current file being checked.
+     * @param int                         $ptr       The position of current token.
+     * @param int                         $arrayEnd  The token that ends the array definition.
+     *
+     * @return int
+     */
+    private function getNext(File $phpcsFile, $ptr, $arrayEnd)
+    {
+        $tokens = $phpcsFile->getTokens();
+
+        while ($ptr < $arrayEnd) {
+            if (isset($tokens[$ptr]['scope_closer']) === true) {
+                $ptr = $tokens[$ptr]['scope_closer'];
+            } else if (isset($tokens[$ptr]['parenthesis_closer']) === true) {
+                $ptr = $tokens[$ptr]['parenthesis_closer'];
+            } else if (isset($tokens[$ptr]['bracket_closer']) === true) {
+                $ptr = $tokens[$ptr]['bracket_closer'];
+            }
+
+            if ($tokens[$ptr]['code'] === T_COMMA
+                || $tokens[$ptr]['code'] === T_DOUBLE_ARROW
+            ) {
+                return $ptr;
+            }
+
+            ++$ptr;
+        }
+
+        return $ptr;
+
+    }//end getNext()
+
+
+    /**
+     * Processes a single-line array definition.
+     *
+     * @param \PHP_CodeSniffer\Files\File $phpcsFile  The current file being checked.
+     * @param int                         $stackPtr   The position of the current token
+     *                                                in the stack passed in $tokens.
+     * @param int                         $arrayStart The token that starts the array definition.
+     * @param int                         $arrayEnd   The token that ends the array definition.
+     * @param array                       $indices    An array of token positions for the array keys,
+     *                                                double arrows, and values.
+     *
+     * @return void
+     */
+    abstract protected function processSingleLineArray($phpcsFile, $stackPtr, $arrayStart, $arrayEnd, $indices);
+
+
+    /**
+     * Processes a multi-line array definition.
+     *
+     * @param \PHP_CodeSniffer\Files\File $phpcsFile  The current file being checked.
+     * @param int                         $stackPtr   The position of the current token
+     *                                                in the stack passed in $tokens.
+     * @param int                         $arrayStart The token that starts the array definition.
+     * @param int                         $arrayEnd   The token that ends the array definition.
+     * @param array                       $indices    An array of token positions for the array keys,
+     *                                                double arrows, and values.
+     *
+     * @return void
+     */
+    abstract protected function processMultiLineArray($phpcsFile, $stackPtr, $arrayStart, $arrayEnd, $indices);
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Sniffs/AbstractPatternSniff.php

@@ -0,0 +1,941 @@
+<?php
+/**
+ * Processes pattern strings and checks that the code conforms to the pattern.
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Sniffs;
+
+use PHP_CodeSniffer\Exceptions\RuntimeException;
+use PHP_CodeSniffer\Files\File;
+use PHP_CodeSniffer\Tokenizers\PHP;
+use PHP_CodeSniffer\Util\Tokens;
+
+abstract class AbstractPatternSniff implements Sniff
+{
+
+    /**
+     * If true, comments will be ignored if they are found in the code.
+     *
+     * @var boolean
+     */
+    public $ignoreComments = false;
+
+    /**
+     * The current file being checked.
+     *
+     * @var string
+     */
+    protected $currFile = '';
+
+    /**
+     * The parsed patterns array.
+     *
+     * @var array
+     */
+    private $parsedPatterns = [];
+
+    /**
+     * Tokens that this sniff wishes to process outside of the patterns.
+     *
+     * @var int[]
+     * @see registerSupplementary()
+     * @see processSupplementary()
+     */
+    private $supplementaryTokens = [];
+
+    /**
+     * Positions in the stack where errors have occurred.
+     *
+     * @var array<int, bool>
+     */
+    private $errorPos = [];
+
+
+    /**
+     * Constructs a AbstractPatternSniff.
+     *
+     * @param boolean $ignoreComments If true, comments will be ignored.
+     */
+    public function __construct($ignoreComments=null)
+    {
+        // This is here for backwards compatibility.
+        if ($ignoreComments !== null) {
+            $this->ignoreComments = $ignoreComments;
+        }
+
+        $this->supplementaryTokens = $this->registerSupplementary();
+
+    }//end __construct()
+
+
+    /**
+     * Registers the tokens to listen to.
+     *
+     * Classes extending <i>AbstractPatternTest</i> should implement the
+     * <i>getPatterns()</i> method to register the patterns they wish to test.
+     *
+     * @return array<int|string>
+     * @see    process()
+     */
+    final public function register()
+    {
+        $listenTypes = [];
+        $patterns    = $this->getPatterns();
+
+        foreach ($patterns as $pattern) {
+            $parsedPattern = $this->parse($pattern);
+
+            // Find a token position in the pattern that we can use
+            // for a listener token.
+            $pos           = $this->getListenerTokenPos($parsedPattern);
+            $tokenType     = $parsedPattern[$pos]['token'];
+            $listenTypes[] = $tokenType;
+
+            $patternArray = [
+                'listen_pos'   => $pos,
+                'pattern'      => $parsedPattern,
+                'pattern_code' => $pattern,
+            ];
+
+            if (isset($this->parsedPatterns[$tokenType]) === false) {
+                $this->parsedPatterns[$tokenType] = [];
+            }
+
+            $this->parsedPatterns[$tokenType][] = $patternArray;
+        }//end foreach
+
+        return array_unique(array_merge($listenTypes, $this->supplementaryTokens));
+
+    }//end register()
+
+
+    /**
+     * Returns the token types that the specified pattern is checking for.
+     *
+     * Returned array is in the format:
+     * <code>
+     *   array(
+     *      T_WHITESPACE => 0, // 0 is the position where the T_WHITESPACE token
+     *                         // should occur in the pattern.
+     *   );
+     * </code>
+     *
+     * @param array $pattern The parsed pattern to find the acquire the token
+     *                       types from.
+     *
+     * @return array<int, int>
+     */
+    private function getPatternTokenTypes($pattern)
+    {
+        $tokenTypes = [];
+        foreach ($pattern as $pos => $patternInfo) {
+            if ($patternInfo['type'] === 'token') {
+                if (isset($tokenTypes[$patternInfo['token']]) === false) {
+                    $tokenTypes[$patternInfo['token']] = $pos;
+                }
+            }
+        }
+
+        return $tokenTypes;
+
+    }//end getPatternTokenTypes()
+
+
+    /**
+     * Returns the position in the pattern that this test should register as
+     * a listener for the pattern.
+     *
+     * @param array $pattern The pattern to acquire the listener for.
+     *
+     * @return int The position in the pattern that this test should register
+     *             as the listener.
+     * @throws \PHP_CodeSniffer\Exceptions\RuntimeException If we could not determine a token to listen for.
+     */
+    private function getListenerTokenPos($pattern)
+    {
+        $tokenTypes = $this->getPatternTokenTypes($pattern);
+        $tokenCodes = array_keys($tokenTypes);
+        $token      = Tokens::getHighestWeightedToken($tokenCodes);
+
+        // If we could not get a token.
+        if ($token === false) {
+            $error = 'Could not determine a token to listen for';
+            throw new RuntimeException($error);
+        }
+
+        return $tokenTypes[$token];
+
+    }//end getListenerTokenPos()
+
+
+    /**
+     * Processes the test.
+     *
+     * @param \PHP_CodeSniffer\Files\File $phpcsFile The PHP_CodeSniffer file where the
+     *                                               token occurred.
+     * @param int                         $stackPtr  The position in the tokens stack
+     *                                               where the listening token type
+     *                                               was found.
+     *
+     * @return void
+     * @see    register()
+     */
+    final public function process(File $phpcsFile, $stackPtr)
+    {
+        $file = $phpcsFile->getFilename();
+        if ($this->currFile !== $file) {
+            // We have changed files, so clean up.
+            $this->errorPos = [];
+            $this->currFile = $file;
+        }
+
+        $tokens = $phpcsFile->getTokens();
+
+        if (in_array($tokens[$stackPtr]['code'], $this->supplementaryTokens, true) === true) {
+            $this->processSupplementary($phpcsFile, $stackPtr);
+        }
+
+        $type = $tokens[$stackPtr]['code'];
+
+        // If the type is not set, then it must have been a token registered
+        // with registerSupplementary().
+        if (isset($this->parsedPatterns[$type]) === false) {
+            return;
+        }
+
+        $allErrors = [];
+
+        // Loop over each pattern that is listening to the current token type
+        // that we are processing.
+        foreach ($this->parsedPatterns[$type] as $patternInfo) {
+            // If processPattern returns false, then the pattern that we are
+            // checking the code with must not be designed to check that code.
+            $errors = $this->processPattern($patternInfo, $phpcsFile, $stackPtr);
+            if ($errors === false) {
+                // The pattern didn't match.
+                continue;
+            } else if (empty($errors) === true) {
+                // The pattern matched, but there were no errors.
+                break;
+            }
+
+            foreach ($errors as $stackPtr => $error) {
+                if (isset($this->errorPos[$stackPtr]) === false) {
+                    $this->errorPos[$stackPtr] = true;
+                    $allErrors[$stackPtr]      = $error;
+                }
+            }
+        }
+
+        foreach ($allErrors as $stackPtr => $error) {
+            $phpcsFile->addError($error, $stackPtr, 'Found');
+        }
+
+    }//end process()
+
+
+    /**
+     * Processes the pattern and verifies the code at $stackPtr.
+     *
+     * @param array                       $patternInfo Information about the pattern used
+     *                                                 for checking, which includes are
+     *                                                 parsed token representation of the
+     *                                                 pattern.
+     * @param \PHP_CodeSniffer\Files\File $phpcsFile   The PHP_CodeSniffer file where the
+     *                                                 token occurred.
+     * @param int                         $stackPtr    The position in the tokens stack where
+     *                                                 the listening token type was found.
+     *
+     * @return array|false
+     */
+    protected function processPattern($patternInfo, File $phpcsFile, $stackPtr)
+    {
+        $tokens      = $phpcsFile->getTokens();
+        $pattern     = $patternInfo['pattern'];
+        $patternCode = $patternInfo['pattern_code'];
+        $errors      = [];
+        $found       = '';
+
+        $ignoreTokens = [T_WHITESPACE => T_WHITESPACE];
+        if ($this->ignoreComments === true) {
+            $ignoreTokens += Tokens::$commentTokens;
+        }
+
+        $origStackPtr = $stackPtr;
+        $hasError     = false;
+
+        if ($patternInfo['listen_pos'] > 0) {
+            $stackPtr--;
+
+            for ($i = ($patternInfo['listen_pos'] - 1); $i >= 0; $i--) {
+                if ($pattern[$i]['type'] === 'token') {
+                    if ($pattern[$i]['token'] === T_WHITESPACE) {
+                        if ($tokens[$stackPtr]['code'] === T_WHITESPACE) {
+                            $found = $tokens[$stackPtr]['content'].$found;
+                        }
+
+                        // Only check the size of the whitespace if this is not
+                        // the first token. We don't care about the size of
+                        // leading whitespace, just that there is some.
+                        if ($i !== 0) {
+                            if ($tokens[$stackPtr]['content'] !== $pattern[$i]['value']) {
+                                $hasError = true;
+                            }
+                        }
+                    } else {
+                        // Check to see if this important token is the same as the
+                        // previous important token in the pattern. If it is not,
+                        // then the pattern cannot be for this piece of code.
+                        $prev = $phpcsFile->findPrevious(
+                            $ignoreTokens,
+                            $stackPtr,
+                            null,
+                            true
+                        );
+
+                        if ($prev === false
+                            || $tokens[$prev]['code'] !== $pattern[$i]['token']
+                        ) {
+                            return false;
+                        }
+
+                        // If we skipped past some whitespace tokens, then add them
+                        // to the found string.
+                        $tokenContent = $phpcsFile->getTokensAsString(
+                            ($prev + 1),
+                            ($stackPtr - $prev - 1)
+                        );
+
+                        $found = $tokens[$prev]['content'].$tokenContent.$found;
+
+                        if (isset($pattern[($i - 1)]) === true
+                            && $pattern[($i - 1)]['type'] === 'skip'
+                        ) {
+                            $stackPtr = $prev;
+                        } else {
+                            $stackPtr = ($prev - 1);
+                        }
+                    }//end if
+                } else if ($pattern[$i]['type'] === 'skip') {
+                    // Skip to next piece of relevant code.
+                    if ($pattern[$i]['to'] === 'parenthesis_closer') {
+                        $to = 'parenthesis_opener';
+                    } else {
+                        $to = 'scope_opener';
+                    }
+
+                    // Find the previous opener.
+                    $next = $phpcsFile->findPrevious(
+                        $ignoreTokens,
+                        $stackPtr,
+                        null,
+                        true
+                    );
+
+                    if ($next === false || isset($tokens[$next][$to]) === false) {
+                        // If there was not opener, then we must be
+                        // using the wrong pattern.
+                        return false;
+                    }
+
+                    if ($to === 'parenthesis_opener') {
+                        $found = '{'.$found;
+                    } else {
+                        $found = '('.$found;
+                    }
+
+                    $found = '...'.$found;
+
+                    // Skip to the opening token.
+                    $stackPtr = ($tokens[$next][$to] - 1);
+                } else if ($pattern[$i]['type'] === 'string') {
+                    $found = 'abc';
+                } else if ($pattern[$i]['type'] === 'newline') {
+                    if ($this->ignoreComments === true
+                        && isset(Tokens::$commentTokens[$tokens[$stackPtr]['code']]) === true
+                    ) {
+                        $startComment = $phpcsFile->findPrevious(
+                            Tokens::$commentTokens,
+                            ($stackPtr - 1),
+                            null,
+                            true
+                        );
+
+                        if ($tokens[$startComment]['line'] !== $tokens[($startComment + 1)]['line']) {
+                            $startComment++;
+                        }
+
+                        $tokenContent = $phpcsFile->getTokensAsString(
+                            $startComment,
+                            ($stackPtr - $startComment + 1)
+                        );
+
+                        $found    = $tokenContent.$found;
+                        $stackPtr = ($startComment - 1);
+                    }
+
+                    if ($tokens[$stackPtr]['code'] === T_WHITESPACE) {
+                        if ($tokens[$stackPtr]['content'] !== $phpcsFile->eolChar) {
+                            $found = $tokens[$stackPtr]['content'].$found;
+
+                            // This may just be an indent that comes after a newline
+                            // so check the token before to make sure. If it is a newline, we
+                            // can ignore the error here.
+                            if (($tokens[($stackPtr - 1)]['content'] !== $phpcsFile->eolChar)
+                                && ($this->ignoreComments === true
+                                && isset(Tokens::$commentTokens[$tokens[($stackPtr - 1)]['code']]) === false)
+                            ) {
+                                $hasError = true;
+                            } else {
+                                $stackPtr--;
+                            }
+                        } else {
+                            $found = 'EOL'.$found;
+                        }
+                    } else {
+                        $found    = $tokens[$stackPtr]['content'].$found;
+                        $hasError = true;
+                    }//end if
+
+                    if ($hasError === false && $pattern[($i - 1)]['type'] !== 'newline') {
+                        // Make sure they only have 1 newline.
+                        $prev = $phpcsFile->findPrevious($ignoreTokens, ($stackPtr - 1), null, true);
+                        if ($prev !== false && $tokens[$prev]['line'] !== $tokens[$stackPtr]['line']) {
+                            $hasError = true;
+                        }
+                    }
+                }//end if
+            }//end for
+        }//end if
+
+        $stackPtr          = $origStackPtr;
+        $lastAddedStackPtr = null;
+        $patternLen        = count($pattern);
+
+        if (($stackPtr + $patternLen - $patternInfo['listen_pos']) > $phpcsFile->numTokens) {
+            // Pattern can never match as there are not enough tokens left in the file.
+            return false;
+        }
+
+        for ($i = $patternInfo['listen_pos']; $i < $patternLen; $i++) {
+            if (isset($tokens[$stackPtr]) === false) {
+                break;
+            }
+
+            if ($pattern[$i]['type'] === 'token') {
+                if ($pattern[$i]['token'] === T_WHITESPACE) {
+                    if ($this->ignoreComments === true) {
+                        // If we are ignoring comments, check to see if this current
+                        // token is a comment. If so skip it.
+                        if (isset(Tokens::$commentTokens[$tokens[$stackPtr]['code']]) === true) {
+                            continue;
+                        }
+
+                        // If the next token is a comment, the we need to skip the
+                        // current token as we should allow a space before a
+                        // comment for readability.
+                        if (isset($tokens[($stackPtr + 1)]) === true
+                            && isset(Tokens::$commentTokens[$tokens[($stackPtr + 1)]['code']]) === true
+                        ) {
+                            continue;
+                        }
+                    }
+
+                    $tokenContent = '';
+                    if ($tokens[$stackPtr]['code'] === T_WHITESPACE) {
+                        if (isset($pattern[($i + 1)]) === false) {
+                            // This is the last token in the pattern, so just compare
+                            // the next token of content.
+                            $tokenContent = $tokens[$stackPtr]['content'];
+                        } else {
+                            // Get all the whitespace to the next token.
+                            $next = $phpcsFile->findNext(
+                                Tokens::$emptyTokens,
+                                $stackPtr,
+                                null,
+                                true
+                            );
+
+                            $tokenContent = $phpcsFile->getTokensAsString(
+                                $stackPtr,
+                                ($next - $stackPtr)
+                            );
+
+                            $lastAddedStackPtr = $stackPtr;
+                            $stackPtr          = $next;
+                        }//end if
+
+                        if ($stackPtr !== $lastAddedStackPtr) {
+                            $found .= $tokenContent;
+                        }
+                    } else {
+                        if ($stackPtr !== $lastAddedStackPtr) {
+                            $found            .= $tokens[$stackPtr]['content'];
+                            $lastAddedStackPtr = $stackPtr;
+                        }
+                    }//end if
+
+                    if (isset($pattern[($i + 1)]) === true
+                        && $pattern[($i + 1)]['type'] === 'skip'
+                    ) {
+                        // The next token is a skip token, so we just need to make
+                        // sure the whitespace we found has *at least* the
+                        // whitespace required.
+                        if (strpos($tokenContent, $pattern[$i]['value']) !== 0) {
+                            $hasError = true;
+                        }
+                    } else {
+                        if ($tokenContent !== $pattern[$i]['value']) {
+                            $hasError = true;
+                        }
+                    }
+                } else {
+                    // Check to see if this important token is the same as the
+                    // next important token in the pattern. If it is not, then
+                    // the pattern cannot be for this piece of code.
+                    $next = $phpcsFile->findNext(
+                        $ignoreTokens,
+                        $stackPtr,
+                        null,
+                        true
+                    );
+
+                    if ($next === false
+                        || $tokens[$next]['code'] !== $pattern[$i]['token']
+                    ) {
+                        // The next important token did not match the pattern.
+                        return false;
+                    }
+
+                    if ($lastAddedStackPtr !== null) {
+                        if (($tokens[$next]['code'] === T_OPEN_CURLY_BRACKET
+                            || $tokens[$next]['code'] === T_CLOSE_CURLY_BRACKET)
+                            && isset($tokens[$next]['scope_condition']) === true
+                            && $tokens[$next]['scope_condition'] > $lastAddedStackPtr
+                        ) {
+                            // This is a brace, but the owner of it is after the current
+                            // token, which means it does not belong to any token in
+                            // our pattern. This means the pattern is not for us.
+                            return false;
+                        }
+
+                        if (($tokens[$next]['code'] === T_OPEN_PARENTHESIS
+                            || $tokens[$next]['code'] === T_CLOSE_PARENTHESIS)
+                            && isset($tokens[$next]['parenthesis_owner']) === true
+                            && $tokens[$next]['parenthesis_owner'] > $lastAddedStackPtr
+                        ) {
+                            // This is a bracket, but the owner of it is after the current
+                            // token, which means it does not belong to any token in
+                            // our pattern. This means the pattern is not for us.
+                            return false;
+                        }
+                    }//end if
+
+                    // If we skipped past some whitespace tokens, then add them
+                    // to the found string.
+                    if (($next - $stackPtr) > 0) {
+                        $hasComment = false;
+                        for ($j = $stackPtr; $j < $next; $j++) {
+                            $found .= $tokens[$j]['content'];
+                            if (isset(Tokens::$commentTokens[$tokens[$j]['code']]) === true) {
+                                $hasComment = true;
+                            }
+                        }
+
+                        // If we are not ignoring comments, this additional
+                        // whitespace or comment is not allowed. If we are
+                        // ignoring comments, there needs to be at least one
+                        // comment for this to be allowed.
+                        if ($this->ignoreComments === false
+                            || ($this->ignoreComments === true
+                            && $hasComment === false)
+                        ) {
+                            $hasError = true;
+                        }
+
+                        // Even when ignoring comments, we are not allowed to include
+                        // newlines without the pattern specifying them, so
+                        // everything should be on the same line.
+                        if ($tokens[$next]['line'] !== $tokens[$stackPtr]['line']) {
+                            $hasError = true;
+                        }
+                    }//end if
+
+                    if ($next !== $lastAddedStackPtr) {
+                        $found            .= $tokens[$next]['content'];
+                        $lastAddedStackPtr = $next;
+                    }
+
+                    if (isset($pattern[($i + 1)]) === true
+                        && $pattern[($i + 1)]['type'] === 'skip'
+                    ) {
+                        $stackPtr = $next;
+                    } else {
+                        $stackPtr = ($next + 1);
+                    }
+                }//end if
+            } else if ($pattern[$i]['type'] === 'skip') {
+                if ($pattern[$i]['to'] === 'unknown') {
+                    $next = $phpcsFile->findNext(
+                        $pattern[($i + 1)]['token'],
+                        $stackPtr
+                    );
+
+                    if ($next === false) {
+                        // Couldn't find the next token, so we must
+                        // be using the wrong pattern.
+                        return false;
+                    }
+
+                    $found   .= '...';
+                    $stackPtr = $next;
+                } else {
+                    // Find the previous opener.
+                    $next = $phpcsFile->findPrevious(
+                        Tokens::$blockOpeners,
+                        $stackPtr
+                    );
+
+                    if ($next === false
+                        || isset($tokens[$next][$pattern[$i]['to']]) === false
+                    ) {
+                        // If there was not opener, then we must
+                        // be using the wrong pattern.
+                        return false;
+                    }
+
+                    $found .= '...';
+                    if ($pattern[$i]['to'] === 'parenthesis_closer') {
+                        $found .= ')';
+                    } else {
+                        $found .= '}';
+                    }
+
+                    // Skip to the closing token.
+                    $stackPtr = ($tokens[$next][$pattern[$i]['to']] + 1);
+                }//end if
+            } else if ($pattern[$i]['type'] === 'string') {
+                if ($tokens[$stackPtr]['code'] !== T_STRING) {
+                    $hasError = true;
+                }
+
+                if ($stackPtr !== $lastAddedStackPtr) {
+                    $found            .= 'abc';
+                    $lastAddedStackPtr = $stackPtr;
+                }
+
+                $stackPtr++;
+            } else if ($pattern[$i]['type'] === 'newline') {
+                // Find the next token that contains a newline character.
+                $newline = 0;
+                for ($j = $stackPtr; $j < $phpcsFile->numTokens; $j++) {
+                    if (strpos($tokens[$j]['content'], $phpcsFile->eolChar) !== false) {
+                        $newline = $j;
+                        break;
+                    }
+                }
+
+                if ($newline === 0) {
+                    // We didn't find a newline character in the rest of the file.
+                    $next     = ($phpcsFile->numTokens - 1);
+                    $hasError = true;
+                } else {
+                    if ($this->ignoreComments === false) {
+                        // The newline character cannot be part of a comment.
+                        if (isset(Tokens::$commentTokens[$tokens[$newline]['code']]) === true) {
+                            $hasError = true;
+                        }
+                    }
+
+                    if ($newline === $stackPtr) {
+                        $next = ($stackPtr + 1);
+                    } else {
+                        // Check that there were no significant tokens that we
+                        // skipped over to find our newline character.
+                        $next = $phpcsFile->findNext(
+                            $ignoreTokens,
+                            $stackPtr,
+                            null,
+                            true
+                        );
+
+                        if ($next < $newline) {
+                            // We skipped a non-ignored token.
+                            $hasError = true;
+                        } else {
+                            $next = ($newline + 1);
+                        }
+                    }
+                }//end if
+
+                if ($stackPtr !== $lastAddedStackPtr) {
+                    $found .= $phpcsFile->getTokensAsString(
+                        $stackPtr,
+                        ($next - $stackPtr)
+                    );
+
+                    $lastAddedStackPtr = ($next - 1);
+                }
+
+                $stackPtr = $next;
+            }//end if
+        }//end for
+
+        if ($hasError === true) {
+            $error = $this->prepareError($found, $patternCode);
+            $errors[$origStackPtr] = $error;
+        }
+
+        return $errors;
+
+    }//end processPattern()
+
+
+    /**
+     * Prepares an error for the specified patternCode.
+     *
+     * @param string $found       The actual found string in the code.
+     * @param string $patternCode The expected pattern code.
+     *
+     * @return string The error message.
+     */
+    protected function prepareError($found, $patternCode)
+    {
+        $found    = str_replace("\r\n", '\n', $found);
+        $found    = str_replace("\n", '\n', $found);
+        $found    = str_replace("\r", '\n', $found);
+        $found    = str_replace("\t", '\t', $found);
+        $found    = str_replace('EOL', '\n', $found);
+        $expected = str_replace('EOL', '\n', $patternCode);
+
+        $error = "Expected \"$expected\"; found \"$found\"";
+
+        return $error;
+
+    }//end prepareError()
+
+
+    /**
+     * Returns the patterns that should be checked.
+     *
+     * @return string[]
+     */
+    abstract protected function getPatterns();
+
+
+    /**
+     * Registers any supplementary tokens that this test might wish to process.
+     *
+     * A sniff may wish to register supplementary tests when it wishes to group
+     * an arbitrary validation that cannot be performed using a pattern, with
+     * other pattern tests.
+     *
+     * @return int[]
+     * @see    processSupplementary()
+     */
+    protected function registerSupplementary()
+    {
+        return [];
+
+    }//end registerSupplementary()
+
+
+     /**
+      * Processes any tokens registered with registerSupplementary().
+      *
+      * @param \PHP_CodeSniffer\Files\File $phpcsFile The PHP_CodeSniffer file where to
+      *                                               process the skip.
+      * @param int                         $stackPtr  The position in the tokens stack to
+      *                                               process.
+      *
+      * @return void
+      * @see    registerSupplementary()
+      */
+    protected function processSupplementary(File $phpcsFile, $stackPtr)
+    {
+
+    }//end processSupplementary()
+
+
+    /**
+     * Parses a pattern string into an array of pattern steps.
+     *
+     * @param string $pattern The pattern to parse.
+     *
+     * @return array The parsed pattern array.
+     * @see    createSkipPattern()
+     * @see    createTokenPattern()
+     */
+    private function parse($pattern)
+    {
+        $patterns   = [];
+        $length     = strlen($pattern);
+        $lastToken  = 0;
+        $firstToken = 0;
+
+        for ($i = 0; $i < $length; $i++) {
+            $specialPattern = false;
+            $isLastChar     = ($i === ($length - 1));
+            $oldFirstToken  = $firstToken;
+
+            if (substr($pattern, $i, 3) === '...') {
+                // It's a skip pattern. The skip pattern requires the
+                // content of the token in the "from" position and the token
+                // to skip to.
+                $specialPattern = $this->createSkipPattern($pattern, ($i - 1));
+                $lastToken      = ($i - $firstToken);
+                $firstToken     = ($i + 3);
+                $i += 2;
+
+                if ($specialPattern['to'] !== 'unknown') {
+                    $firstToken++;
+                }
+            } else if (substr($pattern, $i, 3) === 'abc') {
+                $specialPattern = ['type' => 'string'];
+                $lastToken      = ($i - $firstToken);
+                $firstToken     = ($i + 3);
+                $i += 2;
+            } else if (substr($pattern, $i, 3) === 'EOL') {
+                $specialPattern = ['type' => 'newline'];
+                $lastToken      = ($i - $firstToken);
+                $firstToken     = ($i + 3);
+                $i += 2;
+            }//end if
+
+            if ($specialPattern !== false || $isLastChar === true) {
+                // If we are at the end of the string, don't worry about a limit.
+                if ($isLastChar === true) {
+                    // Get the string from the end of the last skip pattern, if any,
+                    // to the end of the pattern string.
+                    $str = substr($pattern, $oldFirstToken);
+                } else {
+                    // Get the string from the end of the last special pattern,
+                    // if any, to the start of this special pattern.
+                    if ($lastToken === 0) {
+                        // Note that if the last special token was zero characters ago,
+                        // there will be nothing to process so we can skip this bit.
+                        // This happens if you have something like: EOL... in your pattern.
+                        $str = '';
+                    } else {
+                        $str = substr($pattern, $oldFirstToken, $lastToken);
+                    }
+                }
+
+                if ($str !== '') {
+                    $tokenPatterns = $this->createTokenPattern($str);
+                    foreach ($tokenPatterns as $tokenPattern) {
+                        $patterns[] = $tokenPattern;
+                    }
+                }
+
+                // Make sure we don't skip the last token.
+                if ($isLastChar === false && $i === ($length - 1)) {
+                    $i--;
+                }
+            }//end if
+
+            // Add the skip pattern *after* we have processed
+            // all the tokens from the end of the last skip pattern
+            // to the start of this skip pattern.
+            if ($specialPattern !== false) {
+                $patterns[] = $specialPattern;
+            }
+        }//end for
+
+        return $patterns;
+
+    }//end parse()
+
+
+    /**
+     * Creates a skip pattern.
+     *
+     * @param string $pattern The pattern being parsed.
+     * @param int    $from    The token position that the skip pattern starts from.
+     *
+     * @return array The pattern step.
+     * @see    createTokenPattern()
+     * @see    parse()
+     */
+    private function createSkipPattern($pattern, $from)
+    {
+        $skip = ['type' => 'skip'];
+
+        $nestedParenthesis = 0;
+        $nestedBraces      = 0;
+        for ($start = $from; $start >= 0; $start--) {
+            switch ($pattern[$start]) {
+            case '(':
+                if ($nestedParenthesis === 0) {
+                    $skip['to'] = 'parenthesis_closer';
+                }
+
+                $nestedParenthesis--;
+                break;
+            case '{':
+                if ($nestedBraces === 0) {
+                    $skip['to'] = 'scope_closer';
+                }
+
+                $nestedBraces--;
+                break;
+            case '}':
+                $nestedBraces++;
+                break;
+            case ')':
+                $nestedParenthesis++;
+                break;
+            }//end switch
+
+            if (isset($skip['to']) === true) {
+                break;
+            }
+        }//end for
+
+        if (isset($skip['to']) === false) {
+            $skip['to'] = 'unknown';
+        }
+
+        return $skip;
+
+    }//end createSkipPattern()
+
+
+    /**
+     * Creates a token pattern.
+     *
+     * @param string $str The tokens string that the pattern should match.
+     *
+     * @return array The pattern step.
+     * @see    createSkipPattern()
+     * @see    parse()
+     */
+    private function createTokenPattern($str)
+    {
+        // Don't add a space after the closing php tag as it will add a new
+        // whitespace token.
+        $tokenizer = new PHP('<?php '.$str.'?>', null);
+
+        // Remove the <?php tag from the front and the end php tag from the back.
+        $tokens = $tokenizer->getTokens();
+        $tokens = array_slice($tokens, 1, (count($tokens) - 2));
+
+        $patterns = [];
+        foreach ($tokens as $patternInfo) {
+            $patterns[] = [
+                'type'  => 'token',
+                'token' => $patternInfo['code'],
+                'value' => $patternInfo['content'],
+            ];
+        }
+
+        return $patterns;
+
+    }//end createTokenPattern()
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Sniffs/AbstractScopeSniff.php

@@ -0,0 +1,189 @@
+<?php
+/**
+ * Allows tests that extend this class to listen for tokens within a particular scope.
+ *
+ * Below is a test that listens to methods that exist only within classes:
+ * <code>
+ * class ClassScopeTest extends PHP_CodeSniffer_Standards_AbstractScopeSniff
+ * {
+ *     public function __construct()
+ *     {
+ *         parent::__construct(array(T_CLASS), array(T_FUNCTION));
+ *     }
+ *
+ *     protected function processTokenWithinScope(\PHP_CodeSniffer\Files\File $phpcsFile, $stackPtr, $currScope)
+ *     {
+ *         $className = $phpcsFile->getDeclarationName($currScope);
+ *         $phpcsFile->addWarning('encountered a method within class '.$className, $stackPtr, 'MethodFound');
+ *     }
+ * }
+ * </code>
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Sniffs;
+
+use PHP_CodeSniffer\Exceptions\RuntimeException;
+use PHP_CodeSniffer\Files\File;
+
+abstract class AbstractScopeSniff implements Sniff
+{
+
+    /**
+     * The token types that this test wishes to listen to within the scope.
+     *
+     * @var array
+     */
+    private $tokens = [];
+
+    /**
+     * The type of scope opener tokens that this test wishes to listen to.
+     *
+     * @var array<int|string>
+     */
+    private $scopeTokens = [];
+
+    /**
+     * True if this test should fire on tokens outside of the scope.
+     *
+     * @var boolean
+     */
+    private $listenOutside = false;
+
+
+    /**
+     * Constructs a new AbstractScopeTest.
+     *
+     * @param array   $scopeTokens   The type of scope the test wishes to listen to.
+     * @param array   $tokens        The tokens that the test wishes to listen to
+     *                               within the scope.
+     * @param boolean $listenOutside If true this test will also alert the
+     *                               extending class when a token is found outside
+     *                               the scope, by calling the
+     *                               processTokenOutsideScope method.
+     *
+     * @throws \PHP_CodeSniffer\Exceptions\RuntimeException If the specified tokens arrays are empty
+     *                                                      or invalid.
+     */
+    public function __construct(
+        array $scopeTokens,
+        array $tokens,
+        $listenOutside=false
+    ) {
+        if (empty($scopeTokens) === true) {
+            $error = 'The scope tokens list cannot be empty';
+            throw new RuntimeException($error);
+        }
+
+        if (empty($tokens) === true) {
+            $error = 'The tokens list cannot be empty';
+            throw new RuntimeException($error);
+        }
+
+        $invalidScopeTokens = array_intersect($scopeTokens, $tokens);
+        if (empty($invalidScopeTokens) === false) {
+            $invalid = implode(', ', $invalidScopeTokens);
+            $error   = "Scope tokens [$invalid] can't be in the tokens array";
+            throw new RuntimeException($error);
+        }
+
+        $this->listenOutside = $listenOutside;
+        $this->scopeTokens   = array_flip($scopeTokens);
+        $this->tokens        = $tokens;
+
+    }//end __construct()
+
+
+    /**
+     * The method that is called to register the tokens this test wishes to
+     * listen to.
+     *
+     * DO NOT OVERRIDE THIS METHOD. Use the constructor of this class to register
+     * for the desired tokens and scope.
+     *
+     * @return array<int|string>
+     * @see    __constructor()
+     */
+    final public function register()
+    {
+        return $this->tokens;
+
+    }//end register()
+
+
+    /**
+     * Processes the tokens that this test is listening for.
+     *
+     * @param \PHP_CodeSniffer\Files\File $phpcsFile The file where this token was found.
+     * @param int                         $stackPtr  The position in the stack where this
+     *                                               token was found.
+     *
+     * @return void|int Optionally returns a stack pointer. The sniff will not be
+     *                  called again on the current file until the returned stack
+     *                  pointer is reached. Return `$phpcsFile->numTokens` to skip
+     *                  the rest of the file.
+     * @see    processTokenWithinScope()
+     */
+    final public function process(File $phpcsFile, $stackPtr)
+    {
+        $tokens = $phpcsFile->getTokens();
+
+        $foundScope = false;
+        $skipTokens = [];
+        foreach ($tokens[$stackPtr]['conditions'] as $scope => $code) {
+            if (isset($this->scopeTokens[$code]) === true) {
+                $skipTokens[] = $this->processTokenWithinScope($phpcsFile, $stackPtr, $scope);
+                $foundScope   = true;
+            }
+        }
+
+        if ($this->listenOutside === true && $foundScope === false) {
+            $skipTokens[] = $this->processTokenOutsideScope($phpcsFile, $stackPtr);
+        }
+
+        if (empty($skipTokens) === false) {
+            return min($skipTokens);
+        }
+
+    }//end process()
+
+
+    /**
+     * Processes a token that is found within the scope that this test is
+     * listening to.
+     *
+     * @param \PHP_CodeSniffer\Files\File $phpcsFile The file where this token was found.
+     * @param int                         $stackPtr  The position in the stack where this
+     *                                               token was found.
+     * @param int                         $currScope The position in the tokens array that
+     *                                               opened the scope that this test is
+     *                                               listening for.
+     *
+     * @return void|int Optionally returns a stack pointer. The sniff will not be
+     *                  called again on the current file until the returned stack
+     *                  pointer is reached. Return `$phpcsFile->numTokens` to skip
+     *                  the rest of the file.
+     */
+    abstract protected function processTokenWithinScope(File $phpcsFile, $stackPtr, $currScope);
+
+
+    /**
+     * Processes a token that is found outside the scope that this test is
+     * listening to.
+     *
+     * @param \PHP_CodeSniffer\Files\File $phpcsFile The file where this token was found.
+     * @param int                         $stackPtr  The position in the stack where this
+     *                                               token was found.
+     *
+     * @return void|int Optionally returns a stack pointer. The sniff will not be
+     *                  called again on the current file until the returned stack
+     *                  pointer is reached. Return `$phpcsFile->numTokens` to skip
+     *                  the rest of the file.
+     */
+    abstract protected function processTokenOutsideScope(File $phpcsFile, $stackPtr);
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Sniffs/AbstractVariableSniff.php

@@ -0,0 +1,230 @@
+<?php
+/**
+ * A class to find T_VARIABLE tokens.
+ *
+ * This class can distinguish between normal T_VARIABLE tokens, and those tokens
+ * that represent class members. If a class member is encountered, then the
+ * processMemberVar method is called so the extending class can process it. If
+ * the token is found to be a normal T_VARIABLE token, then processVariable is
+ * called.
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Sniffs;
+
+use PHP_CodeSniffer\Files\File;
+use PHP_CodeSniffer\Util\Tokens;
+
+abstract class AbstractVariableSniff extends AbstractScopeSniff
+{
+
+    /**
+     * List of PHP Reserved variables.
+     *
+     * Used by various naming convention sniffs.
+     *
+     * @var array
+     */
+    protected $phpReservedVars = [
+        '_SERVER'              => true,
+        '_GET'                 => true,
+        '_POST'                => true,
+        '_REQUEST'             => true,
+        '_SESSION'             => true,
+        '_ENV'                 => true,
+        '_COOKIE'              => true,
+        '_FILES'               => true,
+        'GLOBALS'              => true,
+        'http_response_header' => true,
+        'HTTP_RAW_POST_DATA'   => true,
+        'php_errormsg'         => true,
+    ];
+
+
+    /**
+     * Constructs an AbstractVariableTest.
+     */
+    public function __construct()
+    {
+        $scopes = Tokens::$ooScopeTokens;
+
+        $listen = [
+            T_VARIABLE,
+            T_DOUBLE_QUOTED_STRING,
+            T_HEREDOC,
+        ];
+
+        parent::__construct($scopes, $listen, true);
+
+    }//end __construct()
+
+
+    /**
+     * Processes the token in the specified PHP_CodeSniffer\Files\File.
+     *
+     * @param \PHP_CodeSniffer\Files\File $phpcsFile The PHP_CodeSniffer file where this
+     *                                               token was found.
+     * @param int                         $stackPtr  The position where the token was found.
+     * @param int                         $currScope The current scope opener token.
+     *
+     * @return void|int Optionally returns a stack pointer. The sniff will not be
+     *                  called again on the current file until the returned stack
+     *                  pointer is reached. Return `$phpcsFile->numTokens` to skip
+     *                  the rest of the file.
+     */
+    final protected function processTokenWithinScope(File $phpcsFile, $stackPtr, $currScope)
+    {
+        $tokens = $phpcsFile->getTokens();
+
+        if ($tokens[$stackPtr]['code'] === T_DOUBLE_QUOTED_STRING
+            || $tokens[$stackPtr]['code'] === T_HEREDOC
+        ) {
+            // Check to see if this string has a variable in it.
+            $pattern = '|(?<!\\\\)(?:\\\\{2})*\${?[a-zA-Z0-9_]+}?|';
+            if (preg_match($pattern, $tokens[$stackPtr]['content']) !== 0) {
+                return $this->processVariableInString($phpcsFile, $stackPtr);
+            }
+
+            return;
+        }
+
+        // If this token is nested inside a function at a deeper
+        // level than the current OO scope that was found, it's a normal
+        // variable and not a member var.
+        $conditions = array_reverse($tokens[$stackPtr]['conditions'], true);
+        $inFunction = false;
+        foreach ($conditions as $scope => $code) {
+            if (isset(Tokens::$ooScopeTokens[$code]) === true) {
+                break;
+            }
+
+            if ($code === T_FUNCTION || $code === T_CLOSURE) {
+                $inFunction = true;
+            }
+        }
+
+        if ($scope !== $currScope) {
+            // We found a closer scope to this token, so ignore
+            // this particular time through the sniff. We will process
+            // this token when this closer scope is found to avoid
+            // duplicate checks.
+            return;
+        }
+
+        // Just make sure this isn't a variable in a function declaration.
+        if ($inFunction === false && isset($tokens[$stackPtr]['nested_parenthesis']) === true) {
+            foreach ($tokens[$stackPtr]['nested_parenthesis'] as $opener => $closer) {
+                if (isset($tokens[$opener]['parenthesis_owner']) === false) {
+                    // Check if this is a USE statement for a closure.
+                    $prev = $phpcsFile->findPrevious(Tokens::$emptyTokens, ($opener - 1), null, true);
+                    if ($tokens[$prev]['code'] === T_USE) {
+                        $inFunction = true;
+                        break;
+                    }
+
+                    continue;
+                }
+
+                $owner = $tokens[$opener]['parenthesis_owner'];
+                if ($tokens[$owner]['code'] === T_FUNCTION
+                    || $tokens[$owner]['code'] === T_CLOSURE
+                ) {
+                    $inFunction = true;
+                    break;
+                }
+            }
+        }//end if
+
+        if ($inFunction === true) {
+            return $this->processVariable($phpcsFile, $stackPtr);
+        } else {
+            return $this->processMemberVar($phpcsFile, $stackPtr);
+        }
+
+    }//end processTokenWithinScope()
+
+
+    /**
+     * Processes the token outside the scope in the file.
+     *
+     * @param \PHP_CodeSniffer\Files\File $phpcsFile The PHP_CodeSniffer file where this
+     *                                               token was found.
+     * @param int                         $stackPtr  The position where the token was found.
+     *
+     * @return void|int Optionally returns a stack pointer. The sniff will not be
+     *                  called again on the current file until the returned stack
+     *                  pointer is reached. Return `$phpcsFile->numTokens` to skip
+     *                  the rest of the file.
+     */
+    final protected function processTokenOutsideScope(File $phpcsFile, $stackPtr)
+    {
+        $tokens = $phpcsFile->getTokens();
+        // These variables are not member vars.
+        if ($tokens[$stackPtr]['code'] === T_VARIABLE) {
+            return $this->processVariable($phpcsFile, $stackPtr);
+        } else if ($tokens[$stackPtr]['code'] === T_DOUBLE_QUOTED_STRING
+            || $tokens[$stackPtr]['code'] === T_HEREDOC
+        ) {
+            // Check to see if this string has a variable in it.
+            $pattern = '|(?<!\\\\)(?:\\\\{2})*\${?[a-zA-Z0-9_]+}?|';
+            if (preg_match($pattern, $tokens[$stackPtr]['content']) !== 0) {
+                return $this->processVariableInString($phpcsFile, $stackPtr);
+            }
+        }
+
+    }//end processTokenOutsideScope()
+
+
+    /**
+     * Called to process class member vars.
+     *
+     * @param \PHP_CodeSniffer\Files\File $phpcsFile The PHP_CodeSniffer file where this
+     *                                               token was found.
+     * @param int                         $stackPtr  The position where the token was found.
+     *
+     * @return void|int Optionally returns a stack pointer. The sniff will not be
+     *                  called again on the current file until the returned stack
+     *                  pointer is reached. Return `$phpcsFile->numTokens` to skip
+     *                  the rest of the file.
+     */
+    abstract protected function processMemberVar(File $phpcsFile, $stackPtr);
+
+
+    /**
+     * Called to process normal member vars.
+     *
+     * @param \PHP_CodeSniffer\Files\File $phpcsFile The PHP_CodeSniffer file where this
+     *                                               token was found.
+     * @param int                         $stackPtr  The position where the token was found.
+     *
+     * @return void|int Optionally returns a stack pointer. The sniff will not be
+     *                  called again on the current file until the returned stack
+     *                  pointer is reached. Return `$phpcsFile->numTokens` to skip
+     *                  the rest of the file.
+     */
+    abstract protected function processVariable(File $phpcsFile, $stackPtr);
+
+
+    /**
+     * Called to process variables found in double quoted strings or heredocs.
+     *
+     * Note that there may be more than one variable in the string, which will
+     * result only in one call for the string or one call per line for heredocs.
+     *
+     * @param \PHP_CodeSniffer\Files\File $phpcsFile The PHP_CodeSniffer file where this
+     *                                               token was found.
+     * @param int                         $stackPtr  The position where the double quoted
+     *                                               string was found.
+     *
+     * @return void|int Optionally returns a stack pointer. The sniff will not be
+     *                  called again on the current file until the returned stack
+     *                  pointer is reached. Return `$phpcsFile->numTokens` to skip
+     *                  the rest of the file.
+     */
+    abstract protected function processVariableInString(File $phpcsFile, $stackPtr);
+
+
+}//end class

vendor/squizlabs/php_codesniffer/src/Sniffs/DeprecatedSniff.php

@@ -0,0 +1,63 @@
+<?php
+/**
+ * Marks a sniff as deprecated.
+ *
+ * Implementing this interface allows for marking a sniff as deprecated and
+ * displaying information about the deprecation to the end-user.
+ *
+ * A sniff will still need to implement the `PHP_CodeSniffer\Sniffs\Sniff` interface
+ * as well, or extend an abstract sniff which does, to be recognized as a valid sniff.
+ *
+ * @author    Juliette Reinders Folmer <phpcs_nospam@adviesenzo.nl>
+ * @copyright 2024 PHPCSStandards Contributors
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Sniffs;
+
+interface DeprecatedSniff
+{
+
+
+    /**
+     * Provide the version number in which the sniff was deprecated.
+     *
+     * Recommended format for PHPCS native sniffs: "v3.3.0".
+     * Recommended format for external sniffs: "StandardName v3.3.0".
+     *
+     * @return string
+     */
+    public function getDeprecationVersion();
+
+
+    /**
+     * Provide the version number in which the sniff will be removed.
+     *
+     * Recommended format for PHPCS native sniffs: "v3.3.0".
+     * Recommended format for external sniffs: "StandardName v3.3.0".
+     *
+     * If the removal version is not yet known, it is recommended to set
+     * this to: "a future version".
+     *
+     * @return string
+     */
+    public function getRemovalVersion();
+
+
+    /**
+     * Optionally provide an arbitrary custom message to display with the deprecation.
+     *
+     * Typically intended to allow for displaying information about what to
+     * replace the deprecated sniff with.
+     * Example: "Use the Stnd.Cat.SniffName sniff instead."
+     * Multi-line messages (containing new line characters) are supported.
+     *
+     * An empty string can be returned if there is no replacement/no need
+     * for a custom message.
+     *
+     * @return string
+     */
+    public function getDeprecationMessage();
+
+
+}//end interface

vendor/squizlabs/php_codesniffer/src/Sniffs/Sniff.php

@@ -0,0 +1,80 @@
+<?php
+/**
+ * Represents a PHP_CodeSniffer sniff for sniffing coding standards.
+ *
+ * A sniff registers what token types it wishes to listen for, then, when
+ * PHP_CodeSniffer encounters that token, the sniff is invoked and passed
+ * information about where the token was found in the stack, and the
+ * PHP_CodeSniffer file in which the token was found.
+ *
+ * @author    Greg Sherwood <gsherwood@squiz.net>
+ * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
+ * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
+ */
+
+namespace PHP_CodeSniffer\Sniffs;
+
+use PHP_CodeSniffer\Files\File;
+
+interface Sniff
+{
+
+
+    /**
+     * Registers the tokens that this sniff wants to listen for.
+     *
+     * An example return value for a sniff that wants to listen for whitespace
+     * and any comments would be:
+     *
+     * <code>
+     *    return array(
+     *        T_WHITESPACE,
+     *        T_DOC_COMMENT,
+     *        T_COMMENT,
+     *    );
+     * </code>
+     *
+     * @return array<int|string>
+     * @see    Tokens.php
+     */
+    public function register();
+
+
+    /**
+     * Called when one of the token types that this sniff is listening for
+     * is found.
+     *
+     * The stackPtr variable indicates where in the stack the token was found.
+     * A sniff can acquire information about this token, along with all the other
+     * tokens within the stack by first acquiring the token stack:
+     *
+     * <code>
+     *    $tokens = $phpcsFile->getTokens();
+     *    echo 'Encountered a '.$tokens[$stackPtr]['type'].' token';
+     *    echo 'token information: ';
+     *    print_r($tokens[$stackPtr]);
+     * </code>
+     *
+     * If the sniff discovers an anomaly in the code, they can raise an error
+     * by calling addError() on the \PHP_CodeSniffer\Files\File object, specifying an error
+     * message and the position of the offending token:
+     *
+     * <code>
+     *    $phpcsFile->addError('Encountered an error', $stackPtr);
+     * </code>
+     *
+     * @param \PHP_CodeSniffer\Files\File $phpcsFile The PHP_CodeSniffer file where the
+     *                                               token was found.
+     * @param int                         $stackPtr  The position in the PHP_CodeSniffer
+     *                                               file's token stack where the token
+     *                                               was found.
+     *
+     * @return void|int Optionally returns a stack pointer. The sniff will not be
+     *                  called again on the current file until the returned stack
+     *                  pointer is reached. Return `$phpcsFile->numTokens` to skip
+     *                  the rest of the file.
+     */
+    public function process(File $phpcsFile, $stackPtr);
+
+
+}//end interface

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/Arrays/ArrayIndentStandard.xml

@@ -0,0 +1,107 @@
+<documentation title="Array Indent">
+    <standard>
+    <![CDATA[
+    The opening brace of a multi-line array must be indented at least to the same level as the start of the statement.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: Opening brace of a multi-line array indented to the same level as the start of the statement.">
+        <![CDATA[
+$b = <em>[</em>
+    1,
+    2,
+];
+
+if ($condition) {
+    $a =
+<em>    [</em>
+        1,
+        2,
+    ];
+}
+
+        ]]>
+        </code>
+        <code title="Invalid: Opening brace of a multi-line array not indented to the same level as the start of the statement.">
+        <![CDATA[
+if ($condition) {
+    $a =
+<em>[</em>
+        1,
+        2,
+    ];
+}
+        ]]>
+        </code>
+    </code_comparison>
+    <standard>
+    <![CDATA[
+    Each array element must be indented exactly four spaces from the start of the statement.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: Each array element is indented by exactly four spaces.">
+        <![CDATA[
+$a = array(
+<em>    </em>1,
+<em>    </em>2,
+<em>    </em>3,
+);
+        ]]>
+        </code>
+        <code title="Invalid: Array elements not indented by four spaces.">
+        <![CDATA[
+$a = array(
+<em>  </em>1,
+<em>     </em>2,
+<em>        </em>3,
+);
+        ]]>
+        </code>
+    </code_comparison>
+    <standard>
+    <![CDATA[
+    The array closing brace must be on a new line.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: Array closing brace on its own line.">
+        <![CDATA[
+$a = [
+    1,
+    2,<em>
+]</em>;
+        ]]>
+        </code>
+        <code title="Invalid: Array closing brace not on its own line.">
+        <![CDATA[
+$a = [
+    1,
+    2,<em>]</em>;
+        ]]>
+        </code>
+    </code_comparison>
+    <standard>
+    <![CDATA[
+    The closing brace must be aligned with the start of the statement containing the array opener.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: Closing brace aligned with the start of the statement containing the array opener.">
+        <![CDATA[
+$a = array(
+    1,
+    2,
+<em>)</em>;
+        ]]>
+        </code>
+        <code title="Invalid: Closing brace not aligned with the start of the statement containing the array opener.">
+        <![CDATA[
+$a = array(
+    1,
+    2,
+<em>  )</em>;
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/Arrays/DisallowLongArraySyntaxStandard.xml

@@ -0,0 +1,23 @@
+<documentation title="Short Array Syntax">
+    <standard>
+    <![CDATA[
+    Short array syntax must be used to define arrays.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: Short form of array.">
+        <![CDATA[
+$arr = <em>[</em>
+    'foo' => 'bar',
+<em>]</em>;
+        ]]>
+        </code>
+        <code title="Invalid: Long form of array.">
+        <![CDATA[
+$arr = <em>array(</em>
+    'foo' => 'bar',
+<em>)</em>;
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/Arrays/DisallowShortArraySyntaxStandard.xml

@@ -0,0 +1,23 @@
+<documentation title="Long Array Syntax">
+    <standard>
+    <![CDATA[
+    Long array syntax must be used to define arrays.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: Long form of array.">
+        <![CDATA[
+$arr = <em>array(</em>
+    'foo' => 'bar',
+<em>)</em>;
+        ]]>
+        </code>
+        <code title="Invalid: Short form of array.">
+        <![CDATA[
+$arr = <em>[</em>
+    'foo' => 'bar',
+<em>]</em>;
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/Classes/DuplicateClassNameStandard.xml

@@ -0,0 +1,27 @@
+<documentation title="Duplicate Class Names">
+    <standard>
+    <![CDATA[
+    Class and Interface names should be unique in a project.  They should never be duplicated.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: A unique class name.">
+        <![CDATA[
+class <em>Foo</em>
+{
+}
+        ]]>
+        </code>
+        <code title="Invalid: A class duplicated (including across multiple files).">
+        <![CDATA[
+class <em>Foo</em>
+{
+}
+
+class <em>Foo</em>
+{
+}
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/Classes/OpeningBraceSameLineStandard.xml

@@ -0,0 +1,36 @@
+<documentation title="Opening Brace on Same Line">
+    <standard>
+    <![CDATA[
+    The opening brace of a class must be on the same line after the definition and must be the last thing on that line.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: Opening brace on the same line.">
+        <![CDATA[
+class Foo <em>{</em>
+}
+        ]]>
+        </code>
+        <code title="Invalid: Opening brace on the next line.">
+        <![CDATA[
+class Foo
+<em>{</em>
+}
+        ]]>
+        </code>
+    </code_comparison>
+    <code_comparison>
+        <code title="Valid: Opening brace is the last thing on the line.">
+        <![CDATA[
+class Foo <em>{</em>
+}
+        ]]>
+        </code>
+        <code title="Invalid: Opening brace not last thing on the line.">
+        <![CDATA[
+class Foo {<em> // Start of class.</em>
+}
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/CodeAnalysis/AssignmentInConditionStandard.xml

@@ -0,0 +1,23 @@
+<documentation title="Assignment In Condition">
+    <standard>
+    <![CDATA[
+    Variable assignments should not be made within conditions.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: A variable comparison being executed within a condition.">
+        <![CDATA[
+if (<em>$test === 'abc'</em>) {
+    // Code.
+}
+        ]]>
+        </code>
+        <code title="Invalid: A variable assignment being made within a condition.">
+        <![CDATA[
+if (<em>$test = 'abc'</em>) {
+    // Code.
+}
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/CodeAnalysis/EmptyPHPStatementStandard.xml

@@ -0,0 +1,44 @@
+<documentation title="Empty PHP Statement">
+    <standard>
+    <![CDATA[
+    Empty PHP tags are not allowed.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: There is at least one statement inside the PHP tag pair.">
+        <![CDATA[
+<?php <em>echo 'Hello World';</em> ?>
+<?= <em>'Hello World';</em> ?>
+        ]]>
+        </code>
+        <code title="Invalid: There is no statement inside the PHP tag pair.">
+        <![CDATA[
+<?php <em>;</em> ?>
+<?= <em></em> ?>
+        ]]>
+        </code>
+    </code_comparison>
+    <standard>
+    <![CDATA[
+    Superfluous semicolons are not allowed.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: There is no superfluous semicolon after a PHP statement.">
+            <![CDATA[
+function_call()<em>;</em>
+if (true) {
+    echo 'Hello World'<em>;</em>
+}
+        ]]>
+        </code>
+        <code title="Invalid: There are one or more superfluous semicolons after a PHP statement.">
+            <![CDATA[
+function_call()<em>;;;</em>
+if (true) {
+    echo 'Hello World';
+}<em>;</em>
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/CodeAnalysis/EmptyStatementStandard.xml

@@ -0,0 +1,23 @@
+<documentation title="Empty Statements">
+    <standard>
+    <![CDATA[
+    Control Structures must have at least one statement inside of the body.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: There is a statement inside the control structure.">
+        <![CDATA[
+if ($test) {
+    $var = 1;
+}
+        ]]>
+        </code>
+        <code title="Invalid: The control structure has no statements.">
+        <![CDATA[
+if ($test) {
+    <em>// do nothing</em>
+}
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/CodeAnalysis/ForLoopShouldBeWhileLoopStandard.xml

@@ -0,0 +1,23 @@
+<documentation title="Condition-Only For Loops">
+    <standard>
+    <![CDATA[
+    For loops that have only a second expression (the condition) should be converted to while loops.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: A for loop is used with all three expressions.">
+        <![CDATA[
+for (<em>$i = 0</em>; $i < 10; <em>$i++</em>) {
+    echo "{$i}\n";
+}
+        ]]>
+        </code>
+        <code title="Invalid: A for loop is used without a first or third expression.">
+        <![CDATA[
+for (<em></em>;$test;<em></em>) {
+    $test = doSomething();
+}
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/CodeAnalysis/ForLoopWithTestFunctionCallStandard.xml

@@ -0,0 +1,24 @@
+<documentation title="For Loops With Function Calls in the Test">
+    <standard>
+    <![CDATA[
+    For loops should not call functions inside the test for the loop when they can be computed beforehand.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: A for loop that determines its end condition before the loop starts.">
+        <![CDATA[
+<em>$end = count($foo);</em>
+for ($i = 0; $i < $end; $i++) {
+    echo $foo[$i]."\n";
+}
+        ]]>
+        </code>
+        <code title="Invalid: A for loop that unnecessarily computes the same value on every iteration.">
+        <![CDATA[
+for ($i = 0; $i < <em>count($foo)</em>; $i++) {
+    echo $foo[$i]."\n";
+}
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/CodeAnalysis/JumbledIncrementerStandard.xml

@@ -0,0 +1,25 @@
+<documentation title="Jumbled Incrementers">
+    <standard>
+    <![CDATA[
+    Incrementers in nested loops should use different variable names.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: Two different variables being used to increment.">
+        <![CDATA[
+for ($i = 0; $i < 10; <em>$i++</em>) {
+    for ($j = 0; $j < 10; <em>$j++</em>) {
+    }
+}
+        ]]>
+        </code>
+        <code title="Invalid: Inner incrementer is the same variable name as the outer one.">
+        <![CDATA[
+for ($i = 0; $i < 10; <em>$i++</em>) {
+    for ($j = 0; $j < 10; <em>$i++</em>) {
+    }
+}
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/CodeAnalysis/RequireExplicitBooleanOperatorPrecedenceStandard.xml

@@ -0,0 +1,44 @@
+<documentation title="Require Explicit Boolean Operator Precedence"
+    >
+    <standard>
+    <![CDATA[
+    Forbids mixing different binary boolean operators (&&, ||, and, or, xor) within a single expression without making precedence clear using parentheses.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: Making precedence clear with parentheses.">
+        <![CDATA[
+$one = false;
+$two = false;
+$three = true;
+
+$result = <em>($one && $two) || $three</em>;
+$result2 = <em>$one && ($two || $three)</em>;
+$result3 = <em>($one && !$two) xor $three</em>;
+$result4 = <em>$one && (!$two xor $three)</em>;
+
+if (
+    <em>($result && !$result3)
+    || (!$result && $result3)</em>
+) {}
+        ]]>
+        </code>
+        <code title="Invalid: Not using parentheses.">
+        <![CDATA[
+$one = false;
+$two = false;
+$three = true;
+
+$result = <em>$one && $two || $three</em>;
+
+$result3 = <em>$one && !$two xor $three</em>;
+
+
+if (
+    <em>$result && !$result3
+    || !$result && $result3</em>
+) {}
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/CodeAnalysis/UnconditionalIfStatementStandard.xml

@@ -0,0 +1,39 @@
+<documentation title="Unconditional If Statements">
+    <standard>
+    <![CDATA[
+    If statements that are always evaluated should not be used.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: An if statement that only executes conditionally.">
+        <![CDATA[
+if (<em>$test</em>) {
+    $var = 1;
+}
+        ]]>
+        </code>
+        <code title="Invalid: An if statement that is always performed.">
+        <![CDATA[
+if (<em>true</em>) {
+    $var = 1;
+}
+        ]]>
+        </code>
+    </code_comparison>
+    <code_comparison>
+        <code title="Valid: An if statement that only executes conditionally.">
+        <![CDATA[
+if (<em>$test</em>) {
+    $var = 1;
+}
+        ]]>
+        </code>
+        <code title="Invalid: An if statement that is never performed.">
+        <![CDATA[
+if (<em>false</em>) {
+    $var = 1;
+}
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/CodeAnalysis/UnnecessaryFinalModifierStandard.xml

@@ -0,0 +1,29 @@
+<documentation title="Unnecessary Final Modifiers">
+    <standard>
+    <![CDATA[
+    Methods should not be declared final inside of classes that are declared final.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: A method in a final class is not marked final.">
+        <![CDATA[
+final class Foo
+{
+    public function bar()
+    {
+    }
+}
+        ]]>
+        </code>
+        <code title="Invalid: A method in a final class is also marked final.">
+        <![CDATA[
+final class Foo
+{
+    public <em>final</em> function bar()
+    {
+    }
+}
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/CodeAnalysis/UnusedFunctionParameterStandard.xml

@@ -0,0 +1,25 @@
+<documentation title="Unused function parameters">
+    <standard>
+    <![CDATA[
+    All parameters in a functions signature should be used within the function.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: All the parameters are used.">
+        <![CDATA[
+function addThree($a, $b, $c)
+{
+    return <em>$a + $b + $c</em>;
+}
+        ]]>
+        </code>
+        <code title="Invalid: One of the parameters is not being used.">
+        <![CDATA[
+function addThree($a, $b, $c)
+{
+    return <em>$a + $b</em>;
+}
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/CodeAnalysis/UselessOverridingMethodStandard.xml

@@ -0,0 +1,32 @@
+<documentation title="Useless Overriding Method">
+    <standard>
+    <![CDATA[
+    It is discouraged to override a method if the overriding method only calls the parent method.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: A method that extends functionality of a parent method.">
+        <![CDATA[
+final class Foo extends Baz
+{
+    public function bar()
+    {
+        parent::bar();
+        <em>$this->doSomethingElse();</em>
+    }
+}
+        ]]>
+        </code>
+        <code title="Invalid: An overriding method that only calls the parent method.">
+        <![CDATA[
+final class Foo extends Baz
+{
+    public function bar()
+    {
+        <em>parent::bar();</em>
+    }
+}
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/Commenting/DocCommentStandard.xml

@@ -0,0 +1,269 @@
+<documentation title="Doc Comment">
+    <standard>
+    <![CDATA[
+    Enforces rules related to the formatting of DocBlocks ("Doc Comments") in PHP code.
+
+    DocBlocks are a special type of comment that can provide information about a structural element. In the context of DocBlocks, the following are considered structural elements:
+    class, interface, trait, enum, function, property, constant, variable declarations and require/include[_once] statements.
+
+    DocBlocks start with a `/**` marker and end on `*/`. This sniff will check the formatting of all DocBlocks, independently of whether or not they are attached to a structural element.
+    ]]>
+    </standard>
+    <standard>
+    <![CDATA[
+    A DocBlock must not be empty.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: DocBlock with some content.">
+        <![CDATA[
+/**
+ * <em>Some content.</em>
+ */
+        ]]>
+        </code>
+        <code title="Invalid: Empty DocBlock.">
+        <![CDATA[
+/**
+ * <em></em>
+ */
+        ]]>
+        </code>
+    </code_comparison>
+    <standard>
+    <![CDATA[
+    The opening and closing DocBlock tags must be the only content on the line.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: The opening and closing DocBlock tags have to be on a line by themselves.">
+        <![CDATA[
+<em>/**</em>
+ * Short description.
+ <em>*/</em>
+        ]]>
+        </code>
+        <code title="Invalid: The opening and closing DocBlock tags are not on a line by themselves.">
+        <![CDATA[
+<em>/** Short description. */</em>
+        ]]>
+        </code>
+    </code_comparison>
+    <standard>
+    <![CDATA[
+    The DocBlock must have a short description, and it must be on the first line.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: DocBlock with a short description on the first line.">
+        <![CDATA[
+/**
+ * <em>Short description.</em>
+ */
+        ]]>
+        </code>
+        <code title="Invalid: DocBlock without a short description or short description not on the first line.">
+        <![CDATA[
+/**
+ * <em></em>@return int
+ */
+
+/**
+<em> *</em>
+ * Short description.
+ */
+        ]]>
+        </code>
+    </code_comparison>
+    <standard>
+    <![CDATA[
+    Both the short description, as well as the long description, must start with a capital letter.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: Both the short and long description start with a capital letter.">
+        <![CDATA[
+/**
+ * <em>S</em>hort description.
+ *
+ * <em>L</em>ong description.
+ */
+        ]]>
+        </code>
+        <code title="Invalid: Neither short nor long description starts with a capital letter.">
+        <![CDATA[
+/**
+ * <em>s</em>hort description.
+ *
+ * <em>l</em>ong description.
+ */
+        ]]>
+        </code>
+    </code_comparison>
+    <standard>
+    <![CDATA[
+    There must be exactly one blank line separating the short description, the long description and tag groups.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: One blank line separating the short description, the long description and tag groups.">
+        <![CDATA[
+/**
+ * Short description.
+<em> *<em>
+ * Long description.
+<em> *</em>
+ * @param int $foo
+ */
+        ]]>
+        </code>
+        <code title="Invalid: More than one or no blank line separating the short description, the long description and tag groups.">
+        <![CDATA[
+/**
+ * Short description.
+<em> *
+ *
+</em>
+ * Long description.<em>
+</em> * @param int $foo
+ */
+        ]]>
+        </code>
+    </code_comparison>
+    <standard>
+    <![CDATA[
+    Parameter tags must be grouped together.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: Parameter tags grouped together.">
+        <![CDATA[
+/**
+ * Short description.
+ *
+<em> * @param int $foo
+ * @param string $bar</em>
+ */
+        ]]>
+        </code>
+        <code title="Invalid: Parameter tags not grouped together.">
+        <![CDATA[
+/**
+ * Short description.
+ *
+ * @param int $foo
+<em> *</em>
+ * @param string $bar
+ */
+        ]]>
+        </code>
+    </code_comparison>
+    <standard>
+    <![CDATA[
+    Parameter tags must not be grouped together with other tags.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: Parameter tags are not grouped together with other tags.">
+        <![CDATA[
+/**
+ * Short description.
+ *
+<em> * @param int $foo</em>
+ *
+ * @since      3.4.8
+ * @deprecated 6.0.0
+ */
+        ]]>
+        </code>
+        <code title="Invalid: Parameter tags grouped together with other tags.">
+        <![CDATA[
+/**
+ * Short description.
+ *
+<em> * @param      int $foo
+ * @since      3.4.8
+ * @deprecated 6.0.0</em>
+ */
+        ]]>
+        </code>
+    </code_comparison>
+    <standard>
+    <![CDATA[
+    Tag values for different tags in the same group must be aligned with each other.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: Tag values for different tags in the same tag group are aligned with each other.">
+        <![CDATA[
+/**
+ * Short description.
+ *
+ * @since<em>      0.5.0</em>
+ * @deprecated<em> 1.0.0</em>
+ */
+        ]]>
+        </code>
+        <code title="Invalid: Tag values for different tags in the same tag group are not aligned with each other.">
+        <![CDATA[
+/**
+ * Short description.
+ *
+ * @since<em> 0.5.0</em>
+ * @deprecated<em> 1.0.0</em>
+ */
+        ]]>
+        </code>
+    </code_comparison>
+    <standard>
+    <![CDATA[
+    Parameter tags must be defined before other tags in a DocBlock.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: Parameter tags are defined first.">
+        <![CDATA[
+/**
+ * Short description.
+ *
+ * <em>@param string $foo</em>
+ *
+ * @return void
+ */
+        ]]>
+        </code>
+        <code title="Invalid: Parameter tags are not defined first.">
+        <![CDATA[
+/**
+ * Short description.
+ *
+ * @return void
+ *
+ * <em>@param string $bar</em>
+ */
+        ]]>
+        </code>
+    </code_comparison>
+    <standard>
+    <![CDATA[
+    There must be no additional blank (comment) lines before the closing DocBlock tag.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: No additional blank lines before the closing DocBlock tag.">
+        <![CDATA[
+/**
+ * Short description.<em>
+</em> */
+        ]]>
+        </code>
+        <code title="Invalid: Additional blank lines before the closing DocBlock tag.">
+        <![CDATA[
+/**
+ * Short description.
+<em> *</em>
+ */
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/Commenting/FixmeStandard.xml

@@ -0,0 +1,25 @@
+<documentation title="Fixme Comments">
+    <standard>
+    <![CDATA[
+    FIXME Statements should be taken care of.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: A comment without a fixme.">
+        <![CDATA[
+// <em>Handle strange case</em>
+if ($test) {
+    $var = 1;
+}
+        ]]>
+        </code>
+        <code title="Invalid: A fixme comment.">
+        <![CDATA[
+// <em>FIXME</em>: This needs to be fixed!
+if ($test) {
+    $var = 1;
+}
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/Commenting/TodoStandard.xml

@@ -0,0 +1,25 @@
+<documentation title="Todo Comments">
+    <standard>
+    <![CDATA[
+    TODO Statements should be taken care of.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: A comment without a todo.">
+        <![CDATA[
+// <em>Handle strange case</em>
+if ($test) {
+    $var = 1;
+}
+        ]]>
+        </code>
+        <code title="Invalid: A todo comment.">
+        <![CDATA[
+// <em>TODO</em>: This needs to be fixed!
+if ($test) {
+    $var = 1;
+}
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/ControlStructures/DisallowYodaConditionsStandard.xml

@@ -0,0 +1,23 @@
+<documentation title="Disallow Yoda conditions">
+    <standard>
+    <![CDATA[
+    Yoda conditions are disallowed.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: Value to be asserted must go on the right side of the comparison.">
+        <![CDATA[
+if ($test === null) <em>{</em>
+    $var = 1;
+<em>}</em>
+        ]]>
+        </code>
+        <code title="Invalid: Value to be asserted must not be on the left.">
+        <![CDATA[
+if (null === $test) <em>{</em>
+    $var = 1;
+<em>}</em>
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/ControlStructures/InlineControlStructureStandard.xml

@@ -0,0 +1,22 @@
+<documentation title="Inline Control Structures">
+    <standard>
+    <![CDATA[
+    Control Structures should use braces.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: Braces are used around the control structure.">
+        <![CDATA[
+if ($test) <em>{</em>
+    $var = 1;
+<em>}</em>
+        ]]>
+        </code>
+        <code title="Invalid: No braces are used for the control structure..">
+        <![CDATA[
+if ($test)
+    $var = 1;
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/Debug/CSSLintStandard.xml

@@ -0,0 +1,19 @@
+<documentation title="CSSLint">
+    <standard>
+    <![CDATA[
+    All css files should pass the basic csslint tests.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: Valid CSS Syntax is used.">
+        <![CDATA[
+.foo: { width: 100<em></em>%; }
+        ]]>
+        </code>
+        <code title="Invalid: The CSS has a typo in it.">
+        <![CDATA[
+.foo: { width: 100<em> </em>%; }
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/Debug/ClosureLinterStandard.xml

@@ -0,0 +1,19 @@
+<documentation title="Closure Linter">
+    <standard>
+    <![CDATA[
+    All javascript files should pass basic Closure Linter tests.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: Valid JS Syntax is used.">
+        <![CDATA[
+var foo = [1, 2<em></em>];
+        ]]>
+        </code>
+        <code title="Invalid: Trailing comma in a javascript array.">
+        <![CDATA[
+var foo = [1, 2<em>,</em>];
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/Debug/JSHintStandard.xml

@@ -0,0 +1,19 @@
+<documentation title="JSHint">
+    <standard>
+    <![CDATA[
+    All javascript files should pass basic JSHint tests.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: Valid JS Syntax is used.">
+        <![CDATA[
+<em>var</em> foo = 5;
+        ]]>
+        </code>
+        <code title="Invalid: The Javascript is using an undefined variable.">
+        <![CDATA[
+<em></em>foo = 5;
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/Files/ByteOrderMarkStandard.xml

@@ -0,0 +1,7 @@
+<documentation title="Byte Order Marks">
+    <standard>
+    <![CDATA[
+    Byte Order Marks that may corrupt your application should not be used.  These include 0xefbbbf (UTF-8), 0xfeff (UTF-16 BE) and 0xfffe (UTF-16 LE).
+    ]]>
+    </standard>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/Files/EndFileNewlineStandard.xml

@@ -0,0 +1,7 @@
+<documentation title="End of File Newline">
+    <standard>
+    <![CDATA[
+    Files should end with a newline character.
+    ]]>
+    </standard>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/Files/EndFileNoNewlineStandard.xml

@@ -0,0 +1,7 @@
+<documentation title="No End of File Newline">
+    <standard>
+    <![CDATA[
+    Files should not end with a newline character.
+    ]]>
+    </standard>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/Files/ExecutableFileStandard.xml

@@ -0,0 +1,7 @@
+<documentation title="Executable Files">
+    <standard>
+    <![CDATA[
+    Files should not be executable.
+    ]]>
+    </standard>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/Files/InlineHTMLStandard.xml

@@ -0,0 +1,24 @@
+<documentation title="Inline HTML">
+    <standard>
+    <![CDATA[
+    Files that contain PHP code should only have PHP code and should not have any "inline html".
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: A PHP file with only PHP code in it.">
+        <![CDATA[
+<?php
+$foo = 'bar';
+echo $foo . 'baz';
+        ]]>
+        </code>
+        <code title="Invalid: A PHP file with html in it outside of the PHP tags.">
+        <![CDATA[
+<em>some string here</em>
+<?php
+$foo = 'bar';
+echo $foo . 'baz';
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/Files/LineEndingsStandard.xml

@@ -0,0 +1,7 @@
+<documentation title="Line Endings">
+    <standard>
+    <![CDATA[
+    Unix-style line endings are preferred ("\n" instead of "\r\n").
+    ]]>
+    </standard>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/Files/LineLengthStandard.xml

@@ -0,0 +1,7 @@
+<documentation title="Line Length">
+    <standard>
+    <![CDATA[
+    It is recommended to keep lines at approximately 80 characters long for better code readability.
+    ]]>
+    </standard>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/Files/LowercasedFilenameStandard.xml

@@ -0,0 +1,7 @@
+<documentation title="Lowercased Filenames">
+    <standard>
+    <![CDATA[
+    Lowercase filenames are required.
+    ]]>
+    </standard>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/Files/OneClassPerFileStandard.xml

@@ -0,0 +1,29 @@
+<documentation title="One Class Per File">
+    <standard>
+    <![CDATA[
+    There should only be one class defined in a file.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: Only one class in the file.">
+        <![CDATA[
+<?php
+<em>class Foo</em>
+{
+}
+        ]]>
+        </code>
+        <code title="Invalid: Multiple classes defined in one file.">
+        <![CDATA[
+<?php
+<em>class Foo</em>
+{
+}
+
+<em>class Bar</em>
+{
+}
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/Files/OneInterfacePerFileStandard.xml

@@ -0,0 +1,29 @@
+<documentation title="One Interface Per File">
+    <standard>
+    <![CDATA[
+    There should only be one interface defined in a file.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: Only one interface in the file.">
+        <![CDATA[
+<?php
+<em>interface Foo</em>
+{
+}
+        ]]>
+        </code>
+        <code title="Invalid: Multiple interfaces defined in one file.">
+        <![CDATA[
+<?php
+<em>interface Foo</em>
+{
+}
+
+<em>interface Bar</em>
+{
+}
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/Files/OneObjectStructurePerFileStandard.xml

@@ -0,0 +1,29 @@
+<documentation title="One Object Structure Per File">
+    <standard>
+    <![CDATA[
+    There should only be one class or interface or trait defined in a file.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: Only one object structure in the file.">
+        <![CDATA[
+<?php
+<em>trait Foo</em>
+{
+}
+        ]]>
+        </code>
+        <code title="Invalid: Multiple object structures defined in one file.">
+        <![CDATA[
+<?php
+<em>trait Foo</em>
+{
+}
+
+<em>class Bar</em>
+{
+}
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/Files/OneTraitPerFileStandard.xml

@@ -0,0 +1,29 @@
+<documentation title="One Trait Per File">
+    <standard>
+    <![CDATA[
+    There should only be one trait defined in a file.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: Only one trait in the file.">
+        <![CDATA[
+<?php
+<em>trait Foo</em>
+{
+}
+        ]]>
+        </code>
+        <code title="Invalid: Multiple traits defined in one file.">
+        <![CDATA[
+<?php
+<em>trait Foo</em>
+{
+}
+
+<em>trait Bar</em>
+{
+}
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/Formatting/DisallowMultipleStatementsStandard.xml

@@ -0,0 +1,20 @@
+<documentation title="Multiple Statements On a Single Line">
+    <standard>
+    <![CDATA[
+    Multiple statements are not allowed on a single line.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: Two statements are spread out on two separate lines.">
+        <![CDATA[
+$foo = 1;
+$bar = 2;
+        ]]>
+        </code>
+        <code title="Invalid: Two statements are combined onto one line.">
+        <![CDATA[
+$foo = 1; $bar = 2;
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/Formatting/MultipleStatementAlignmentStandard.xml

@@ -0,0 +1,56 @@
+<documentation title="Aligning Blocks of Assignments">
+    <standard>
+    <![CDATA[
+    There should be one space on either side of an equals sign used to assign a value to a variable. In the case of a block of related assignments, more space may be inserted to promote readability.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: Equals signs aligned.">
+        <![CDATA[
+$shortVar        <em>=</em> (1 + 2);
+$veryLongVarName <em>=</em> 'string';
+$var             <em>=</em> foo($bar, $baz);
+        ]]>
+        </code>
+        <code title="Invalid: Not aligned; harder to read.">
+        <![CDATA[
+$shortVar <em>=</em> (1 + 2);
+$veryLongVarName <em>=</em> 'string';
+$var <em>=</em> foo($bar, $baz);
+        ]]>
+        </code>
+    </code_comparison>
+    <standard>
+    <![CDATA[
+    When using plus-equals, minus-equals etc. still ensure the equals signs are aligned to one space after the longest variable name.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: Equals signs aligned; only one space after longest var name.">
+        <![CDATA[
+$shortVar       <em>+= </em>1;
+$veryLongVarName<em> = </em>1;
+        ]]>
+        </code>
+        <code title="Invalid: Two spaces after longest var name.">
+        <![CDATA[
+$shortVar       <em> += </em>1;
+$veryLongVarName<em>  = </em>1;
+        ]]>
+        </code>
+    </code_comparison>
+    <code_comparison>
+        <code title="Valid: Equals signs aligned.">
+        <![CDATA[
+$shortVar       <em>  = </em>1;
+$veryLongVarName<em> -= </em>1;
+        ]]>
+        </code>
+        <code title="Invalid: Equals signs not aligned.">
+        <![CDATA[
+$shortVar       <em> = </em>1;
+$veryLongVarName<em> -= </em>1;
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/Formatting/NoSpaceAfterCastStandard.xml

@@ -0,0 +1,19 @@
+<documentation title="No Space After Cast">
+    <standard>
+    <![CDATA[
+    Spaces are not allowed after casting operators.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: A cast operator is immediately before its value.">
+        <![CDATA[
+$foo = (string)1;
+        ]]>
+        </code>
+        <code title="Invalid: A cast operator is followed by whitespace.">
+        <![CDATA[
+$foo = (string)<em> </em>1;
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/Formatting/SpaceAfterCastStandard.xml

@@ -0,0 +1,19 @@
+<documentation title="Space After Cast">
+    <standard>
+    <![CDATA[
+    Exactly one space is allowed after a cast.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: A cast operator is followed by one space.">
+        <![CDATA[
+$foo = (string)<em> </em>1;
+        ]]>
+        </code>
+        <code title="Invalid: A cast operator is not followed by whitespace.">
+        <![CDATA[
+$foo = (string)<em></em>1;
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/Formatting/SpaceAfterNotStandard.xml

@@ -0,0 +1,22 @@
+<documentation title="Space After NOT operator">
+    <standard>
+    <![CDATA[
+    Exactly one space is allowed after the NOT operator.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: A NOT operator followed by one space.">
+        <![CDATA[
+if (!<em> </em>$someVar || !<em> </em>$x instanceOf stdClass) {};
+        ]]>
+        </code>
+        <code title="Invalid: A NOT operator not followed by whitespace or followed by too much whitespace.">
+        <![CDATA[
+if (!<em></em>$someVar || !<em></em>$x instanceOf stdClass) {};
+
+if (!<em>     </em>$someVar || !<em>
+    </em>$x instanceOf stdClass) {};
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/Formatting/SpaceBeforeCastStandard.xml

@@ -0,0 +1,21 @@
+<documentation title="Space Before Cast">
+    <standard>
+    <![CDATA[
+    There should be exactly one space before a cast operator.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: Single space before a cast operator.">
+        <![CDATA[
+$integer =<em> </em>(int) $string;
+$c = $a .<em> </em>(string) $b;
+        ]]>
+        </code>
+        <code title="Invalid: No space or multiple spaces before a cast operator.">
+        <![CDATA[
+$integer =<em></em>(int) $string;
+$c = $a .<em>   </em>(string) $b;
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>

vendor/squizlabs/php_codesniffer/src/Standards/Generic/Docs/Functions/CallTimePassByReferenceStandard.xml

@@ -0,0 +1,31 @@
+<documentation title="Call-Time Pass-By-Reference">
+    <standard>
+    <![CDATA[
+    Call-time pass-by-reference is not allowed. It should be declared in the function definition.
+    ]]>
+    </standard>
+    <code_comparison>
+        <code title="Valid: Pass-by-reference is specified in the function definition.">
+        <![CDATA[
+function foo(<em>&</em>$bar)
+{
+    $bar++;
+}
+
+$baz = 1;
+foo($baz);
+        ]]>
+        </code>
+        <code title="Invalid: Pass-by-reference is done in the call to a function.">
+        <![CDATA[
+function foo($bar)
+{
+    $bar++;
+}
+
+$baz = 1;
+foo(<em>&</em>$baz);
+        ]]>
+        </code>
+    </code_comparison>
+</documentation>